|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for MgCO3 (Magnesium Carbonate)
1A1 C2V
1910171554
InChI=1S/CH2O3.Mg/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 INChIKey=ZLNQQNXFFQJAID-UHFFFAOYSA-L
mPW1PW91/aug-cc-pVTZ
Point group is C2v
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.0000 |
-0.6948 |
|
-0.6948 |
0.0000 |
0.0000 |
O2 |
0.0000 |
0.0000 |
-1.8953 |
|
-1.8953 |
0.0000 |
0.0000 |
Mg3 |
0.0000 |
0.0000 |
1.5216 |
|
1.5216 |
0.0000 |
0.0000 |
O4 |
0.0000 |
1.1299 |
0.0670 |
|
0.0670 |
1.1299 |
0.0000 |
O5 |
0.0000 |
-1.1299 |
0.0670 |
|
0.0670 |
-1.1299 |
0.0000 |
Atom - Atom Distances (Å)
|
C1 |
O2 |
Mg3 |
O4 |
O5 |
C1 |
|
1.2005 |
2.2164 |
1.3627 |
1.3627 |
O2 |
1.2005 |
| 3.4169 |
2.2644 |
2.2644 |
Mg3 |
2.2164 |
3.4169 |
| 1.8418 |
1.8418 |
O4 |
1.3627 |
2.2644 |
1.8418 |
| 2.2598 |
O5 |
1.3627 |
2.2644 |
1.8418 |
2.2598 |
|
Maximum atom distance is 3.4169Å
between atoms O2 and Mg3.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
O4 |
Mg3 |
86.150 |
|
C1 |
O5 |
Mg3 |
86.150 |
O2 |
C1 |
O4 |
123.990 |
|
O2 |
C1 |
O5 |
123.990 |
O4 |
C1 |
O5 |
112.020 |
|
O4 |
Mg3 |
O5 |
75.680 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.