|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CFClCFCl (cis-1,2-dichloro-1,2-difluoroethylene)
1A1 C2V
1910171554
InChI=1S/C2Cl2F2/c3-1(5)2(4)6/b2-1- INChIKey=UPVJEODAZWTJKZ-UPHRSURJSA-N
G2
This model chemistry uses a geometry from
MP2=FULL/6-31G*
Point group is C2v
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.6692 |
0.4017 |
|
0.4017 |
0.0000 |
0.6692 |
C2 |
0.0000 |
-0.6692 |
0.4017 |
|
0.4017 |
0.0000 |
-0.6692 |
F3 |
0.0000 |
1.3211 |
1.5724 |
|
1.5724 |
0.0000 |
1.3211 |
F4 |
0.0000 |
-1.3211 |
1.5724 |
|
1.5724 |
0.0000 |
-1.3211 |
Cl5 |
0.0000 |
1.6658 |
-0.9742 |
|
-0.9742 |
0.0000 |
1.6658 |
Cl6 |
0.0000 |
-1.6658 |
-0.9742 |
|
-0.9742 |
0.0000 |
-1.6658 |
Atom - Atom Distances (Å)
|
C1 |
C2 |
F3 |
F4 |
Cl5 |
Cl6 |
C1 |
|
1.3383 |
1.3400 |
2.3090 |
1.6990 |
2.7102 |
C2 |
1.3383 |
| 2.3090 |
1.3400 |
2.7102 |
1.6990 |
F3 |
1.3400 |
2.3090 |
| 2.6423 |
2.5698 |
3.9252 |
F4 |
2.3090 |
1.3400 |
2.6423 |
| 3.9252 |
2.5698 |
Cl5 |
1.6990 |
2.7102 |
2.5698 |
3.9252 |
| 3.3316 |
Cl6 |
2.7102 |
1.6990 |
3.9252 |
2.5698 |
3.3316 |
|
Maximum atom distance is 3.9252Å
between atoms F3 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
F4 |
119.694 |
|
C1 |
C2 |
Cl6 |
126.384 |
C2 |
C1 |
F3 |
119.694 |
|
C2 |
C1 |
Cl5 |
126.384 |
F3 |
C1 |
Cl5 |
113.923 |
|
F4 |
C2 |
Cl6 |
113.923 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.