|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHFClBr (fluorochlorobromomethane)
1A C1
1910171554
InChI=1S/CHBrClF/c2-1(3)4/h1H/t1-/m0/s1 INChIKey=YNKZSBSRKWVMEZ-SFOWXEAESA-N
TPSSh/aug-cc-pVDZ
Point group is C1
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.5743 |
0.4621 |
0.4189 |
|
-0.5714 |
0.4606 |
0.4245 |
Br2 |
-1.2105 |
-0.1865 |
-0.0287 |
|
1.2088 |
-0.1978 |
-0.0274 |
Cl3 |
1.8381 |
-0.6888 |
-0.0685 |
|
-1.8444 |
-0.6697 |
-0.0866 |
F4 |
0.7842 |
1.6518 |
-0.2052 |
|
-0.7674 |
1.6625 |
-0.1804 |
H5 |
0.6188 |
0.5991 |
1.5016 |
|
-0.6186 |
0.5800 |
1.5092 |
Atom - Atom Distances (Å)
|
C1 |
Br2 |
Cl3 |
F4 |
H5 |
C1 |
| 1.9511 |
1.7774 |
1.3598 |
1.0923 |
Br2 |
1.9511 |
| 3.0900 |
2.7183 |
2.5111 |
Cl3 |
1.7774 |
3.0900 |
| 2.5705 |
2.3687 |
F4 |
1.3598 |
2.7183 |
2.5705 |
| 2.0122 |
H5 |
1.0923 |
2.5111 |
2.3687 |
2.0122 |
|
Maximum atom distance is 3.0900Å
between atoms Br2 and Cl3.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Br2 |
C1 |
Cl3 |
111.856 |
|
Br2 |
C1 |
F4 |
109.073 |
Cl3 |
C1 |
F4 |
109.322 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Br2 |
C1 |
H5 |
107.841 |
|
Cl3 |
C1 |
H5 |
108.911 |
F4 |
C1 |
H5 |
109.812 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.