|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
HF/6-311G*
Point group is Cs
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
-0.6633 |
-0.1420 |
0.0000 |
|
-0.4890 |
0.0000 |
-0.4702 |
H2 |
-1.5638 |
0.4351 |
0.0000 |
|
-0.5148 |
0.0000 |
-1.5394 |
Br3 |
0.8028 |
1.1149 |
0.0000 |
|
1.3732 |
0.0000 |
0.0411 |
Cl4 |
-0.6633 |
-1.1354 |
1.4559 |
|
-1.3122 |
1.4559 |
0.0859 |
Cl5 |
-0.6633 |
-1.1354 |
-1.4559 |
|
-1.3122 |
-1.4559 |
0.0859 |
Atom - Atom Distances (Å)
|
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
C1 |
|
1.0695 |
1.9311 |
1.7625 |
1.7625 |
H2 |
1.0695 |
| 2.4622 |
2.3232 |
2.3232 |
Br3 |
1.9311 |
2.4622 |
| 3.0550 |
3.0550 |
Cl4 |
1.7625 |
2.3232 |
3.0550 |
| 2.9118 |
Cl5 |
1.7625 |
2.3232 |
3.0550 |
2.9118 |
|
Maximum atom distance is 3.0550Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Br3 |
C1 |
Cl4 |
111.521 |
|
Br3 |
C1 |
Cl5 |
111.521 |
Cl4 |
C1 |
Cl5 |
111.385 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
H2 |
C1 |
Br3 |
106.737 |
|
H2 |
C1 |
Cl4 |
107.707 |
H2 |
C1 |
Cl5 |
107.707 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.