|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for SiHF3 (trifluorosilane)
1A1 C3V
1910171554
InChI=1S/F3HSi/c1-4(2)3/h4H INChIKey=WPPVEXTUHHUEIV-UHFFFAOYSA-N
QCISD/6-31G
Point group is C3v
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
Si1 |
0.0000 |
0.0000 |
0.3599 |
|
0.0000 |
0.0000 |
0.3599 |
H2 |
0.0000 |
0.0000 |
1.8419 |
|
0.0000 |
0.0000 |
1.8419 |
F3 |
0.0000 |
1.5540 |
-0.2548 |
|
1.5540 |
-0.0000 |
-0.2548 |
F4 |
1.3458 |
-0.7770 |
-0.2548 |
|
-0.7770 |
1.3458 |
-0.2548 |
F5 |
-1.3458 |
-0.7770 |
-0.2548 |
|
-0.7770 |
-1.3458 |
-0.2548 |
Atom - Atom Distances (Å)
|
Si1 |
H2 |
F3 |
F4 |
F5 |
Si1 |
| 1.4820 |
1.6711 |
1.6711 |
1.6711 |
H2 |
1.4820 |
| 2.6098 |
2.6098 |
2.6098 |
F3 |
1.6711 |
2.6098 |
| 2.6915 |
2.6915 |
F4 |
1.6711 |
2.6098 |
2.6915 |
| 2.6915 |
F5 |
1.6711 |
2.6098 |
2.6915 |
2.6915 |
|
Maximum atom distance is 2.6915Å
between atoms F3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
F3 |
Si1 |
F4 |
107.280 |
|
F3 |
Si1 |
F5 |
107.280 |
F4 |
Si1 |
F5 |
107.280 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
H2 |
Si1 |
F3 |
111.582 |
|
H2 |
Si1 |
F4 |
111.582 |
H2 |
Si1 |
F5 |
111.582 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.