|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrF2 (Methane, bromodifluoro-)
1A' CS
1910171554
InChI=1S/CHBrF2/c2-1(3)4/h1H INChIKey=GRCDJFHYVYUNHM-UHFFFAOYSA-N
B3PW91/6-31G*
Point group is Cs
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
-0.4247 |
-0.9231 |
0.0000 |
|
0.0192 |
-0.4243 |
-0.9231 |
H2 |
-1.5135 |
-0.9775 |
0.0000 |
|
0.0685 |
-1.5120 |
-0.9775 |
Br3 |
0.0766 |
0.9656 |
0.0000 |
|
-0.0035 |
0.0766 |
0.9656 |
F4 |
0.0766 |
-1.5156 |
1.0883 |
|
1.0838 |
0.1258 |
-1.5156 |
F5 |
0.0766 |
-1.5156 |
-1.0883 |
|
-1.0907 |
0.0273 |
-1.5156 |
Atom - Atom Distances (Å)
|
C1 |
H2 |
Br3 |
F4 |
F5 |
C1 |
|
1.0902 |
1.9541 |
1.3367 |
1.3367 |
H2 |
1.0902 |
| 2.5108 |
2.0006 |
2.0006 |
Br3 |
1.9541 |
2.5108 |
| 2.7094 |
2.7094 |
F4 |
1.3367 |
2.0006 |
2.7094 |
| 2.1767 |
F5 |
1.3367 |
2.0006 |
2.7094 |
2.1767 |
|
Maximum atom distance is 2.7094Å
between atoms Br3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Br3 |
C1 |
F4 |
109.402 |
|
Br3 |
C1 |
F5 |
109.402 |
F4 |
C1 |
F5 |
109.013 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
H2 |
C1 |
Br3 |
107.727 |
|
H2 |
C1 |
F4 |
110.636 |
H2 |
C1 |
F5 |
110.636 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.