|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for BeCO3 (Beryllium Carbonate)
1A1 C2V
1910171554
InChI=1S/CH2O3.Be/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 INChIKey=ZBUQRSWEONVBES-UHFFFAOYSA-L
TPSSh/3-21G
Point group is C2v
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.0000 |
0.3695 |
|
0.3695 |
0.0000 |
0.0000 |
O2 |
0.0000 |
0.0000 |
1.5725 |
|
1.5725 |
0.0000 |
0.0000 |
Be3 |
0.0000 |
0.0000 |
-1.5300 |
|
-1.5300 |
0.0000 |
0.0000 |
O4 |
0.0000 |
1.1416 |
-0.5423 |
|
-0.5423 |
1.1416 |
0.0000 |
O5 |
0.0000 |
-1.1416 |
-0.5423 |
|
-0.5423 |
-1.1416 |
0.0000 |
Atom - Atom Distances (Å)
|
C1 |
O2 |
Be3 |
O4 |
O5 |
C1 |
|
1.2030 |
1.8995 |
1.4610 |
1.4610 |
O2 |
1.2030 |
| 3.1025 |
2.4032 |
2.4032 |
Be3 |
1.8995 |
3.1025 |
|
1.5096 |
1.5096 |
O4 |
1.4610 |
2.4032 |
1.5096 |
| 2.2832 |
O5 |
1.4610 |
2.4032 |
1.5096 |
2.2832 |
|
Maximum atom distance is 3.1025Å
between atoms O2 and Be3.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
O4 |
Be3 |
79.480 |
|
C1 |
O5 |
Be3 |
79.480 |
O2 |
C1 |
O4 |
128.613 |
|
O2 |
C1 |
O5 |
128.613 |
O4 |
C1 |
O5 |
102.774 |
|
O4 |
Be3 |
O5 |
98.265 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.