|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
PBEPBE/aug-cc-pVTZ
Point group is Cs
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
-0.6759 |
-0.1452 |
0.0000 |
|
0.3835 |
-0.5566 |
-0.1452 |
H2 |
-1.5847 |
0.4559 |
0.0000 |
|
0.8992 |
-1.3048 |
0.4559 |
Br3 |
0.8177 |
1.1230 |
0.0000 |
|
-0.4640 |
0.6733 |
1.1230 |
Cl4 |
-0.6759 |
-1.1438 |
1.4690 |
|
1.5931 |
0.2770 |
-1.1438 |
Cl5 |
-0.6759 |
-1.1438 |
-1.4690 |
|
-0.8260 |
-1.3901 |
-1.1438 |
Atom - Atom Distances (Å)
|
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
C1 |
|
1.0896 |
1.9594 |
1.7762 |
1.7762 |
H2 |
1.0896 |
| 2.4933 |
2.3543 |
2.3543 |
Br3 |
1.9594 |
2.4933 |
| 3.0866 |
3.0866 |
Cl4 |
1.7762 |
2.3543 |
3.0866 |
| 2.9379 |
Cl5 |
1.7762 |
2.3543 |
3.0866 |
2.9379 |
|
Maximum atom distance is 3.0866Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Br3 |
C1 |
Cl4 |
111.338 |
|
Br3 |
C1 |
Cl5 |
111.338 |
Cl4 |
C1 |
Cl5 |
111.587 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
H2 |
C1 |
Br3 |
106.181 |
|
H2 |
C1 |
Cl4 |
108.069 |
H2 |
C1 |
Cl5 |
108.069 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.