|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2F4 (Tetrafluoroethylene)
1Ag D2H
1910171554
InChI=1S/C2F4/c3-1(4)2(5)6 INChIKey=BFKJFAAPBSQJPD-UHFFFAOYSA-N
MP2/CEP-31G
Point group is D2h
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.0000 |
0.6882 |
|
0.6882 |
0.0000 |
0.0000 |
C2 |
0.0000 |
0.0000 |
-0.6882 |
|
-0.6882 |
0.0000 |
0.0000 |
F3 |
0.0000 |
1.1627 |
1.4527 |
|
1.4527 |
1.1627 |
0.0000 |
F4 |
0.0000 |
-1.1627 |
1.4527 |
|
1.4527 |
-1.1627 |
0.0000 |
F5 |
0.0000 |
-1.1627 |
-1.4527 |
|
-1.4527 |
-1.1627 |
0.0000 |
F6 |
0.0000 |
1.1627 |
-1.4527 |
|
-1.4527 |
1.1627 |
0.0000 |
Atom - Atom Distances (Å)
|
C1 |
C2 |
F3 |
F4 |
F5 |
F6 |
C1 |
|
1.3764 |
1.3915 |
1.3915 |
2.4362 |
2.4362 |
C2 |
1.3764 |
| 2.4362 |
2.4362 |
1.3915 |
1.3915 |
F3 |
1.3915 |
2.4362 |
| 2.3254 |
3.7214 |
2.9054 |
F4 |
1.3915 |
2.4362 |
2.3254 |
| 2.9054 |
3.7214 |
F5 |
2.4362 |
1.3915 |
3.7214 |
2.9054 |
| 2.3254 |
F6 |
2.4362 |
1.3915 |
2.9054 |
3.7214 |
2.3254 |
|
Maximum atom distance is 3.7214Å
between atoms F3 and F5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
F5 |
123.327 |
|
C1 |
C2 |
F6 |
123.327 |
C2 |
C1 |
F3 |
123.327 |
|
C2 |
C1 |
F4 |
123.327 |
F3 |
C1 |
F4 |
113.347 |
|
F5 |
C2 |
F6 |
113.347 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.