|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C4F4 (tetrafluorcyclobutadiene)
1AG C2H
1910171554
InChI=1S/C4F4/c5-1-2(6)4(8)3(1)7 INChIKey=CZCWNUQRLNESIL-UHFFFAOYSA-N
MP2=FULL/6-31+G**
Point group is C2h
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.1584 |
0.7448 |
0.6750 |
|
0.6822 |
0.1239 |
0.7448 |
C2 |
-0.1584 |
-0.7448 |
0.6750 |
|
0.6661 |
-0.1925 |
-0.7448 |
C3 |
-0.1584 |
-0.7448 |
-0.6750 |
|
-0.6822 |
-0.1239 |
-0.7448 |
C4 |
0.1584 |
0.7448 |
-0.6750 |
|
-0.6661 |
0.1925 |
0.7448 |
F5 |
-0.1584 |
1.6783 |
1.5716 |
|
1.5615 |
-0.2380 |
1.6783 |
F6 |
0.1584 |
-1.6783 |
1.5716 |
|
1.5776 |
0.0784 |
-1.6783 |
F7 |
0.1584 |
-1.6783 |
-1.5716 |
|
-1.5615 |
0.2380 |
-1.6783 |
F8 |
-0.1584 |
1.6783 |
-1.5716 |
|
-1.5776 |
-0.0784 |
1.6783 |
Atom - Atom Distances (Å)
|
C1 |
C2 |
C3 |
C4 |
F5 |
F6 |
F7 |
F8 |
C1 |
|
1.5228 |
2.0351 |
1.3500 |
1.3326 |
2.5836 |
3.3043 |
2.4534 |
C2 |
1.5228 |
|
1.3500 |
2.0351 |
2.5836 |
1.3326 |
2.4534 |
3.3043 |
C3 |
2.0351 |
1.3500 |
|
1.5228 |
3.3043 |
2.4534 |
1.3326 |
2.5836 |
C4 |
1.3500 |
2.0351 |
1.5228 |
| 2.4534 |
3.3043 |
2.5836 |
1.3326 |
F5 |
1.3326 |
2.5836 |
3.3043 |
2.4534 |
| 3.3715 |
4.6094 |
3.1432 |
F6 |
2.5836 |
1.3326 |
2.4534 |
3.3043 |
3.3715 |
| 3.1432 |
4.6094 |
F7 |
3.3043 |
2.4534 |
1.3326 |
2.5836 |
4.6094 |
3.1432 |
| 3.3715 |
F8 |
2.4534 |
3.3043 |
2.5836 |
1.3326 |
3.1432 |
4.6094 |
3.3715 |
|
Maximum atom distance is 4.6094Å
between atoms F5 and F7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
C3 |
90.000 |
|
C1 |
C2 |
F6 |
129.478 |
C1 |
C4 |
C3 |
90.000 |
|
C1 |
C4 |
F8 |
132.287 |
C2 |
C1 |
C4 |
90.000 |
|
C2 |
C1 |
F5 |
129.478 |
C2 |
C3 |
C4 |
90.000 |
|
C2 |
C3 |
F7 |
132.287 |
C3 |
C2 |
F6 |
132.287 |
|
C3 |
C4 |
F8 |
129.478 |
C4 |
C1 |
F5 |
132.287 |
|
C4 |
C3 |
F7 |
129.478 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.