|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2Br4 (tetrabromoethene)
1AG D2H
1910171554
InChI=1S/C2Br4/c3-1(4)2(5)6 INChIKey=OVRRJBSHBOXFQE-UHFFFAOYSA-N
B3PW91/3-21G
Point group is D2h
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.0000 |
0.6633 |
|
0.6633 |
0.0000 |
0.0000 |
C2 |
0.0000 |
0.0000 |
-0.6633 |
|
-0.6633 |
0.0000 |
0.0000 |
Br3 |
0.0000 |
1.6047 |
1.6982 |
|
1.6982 |
1.6047 |
0.0000 |
Br4 |
0.0000 |
-1.6047 |
1.6982 |
|
1.6982 |
-1.6047 |
0.0000 |
Br5 |
0.0000 |
-1.6047 |
-1.6982 |
|
-1.6982 |
-1.6047 |
0.0000 |
Br6 |
0.0000 |
1.6047 |
-1.6982 |
|
-1.6982 |
1.6047 |
0.0000 |
Atom - Atom Distances (Å)
|
C1 |
C2 |
Br3 |
Br4 |
Br5 |
Br6 |
C1 |
|
1.3265 |
1.9095 |
1.9095 |
2.8552 |
2.8552 |
C2 |
1.3265 |
| 2.8552 |
2.8552 |
1.9095 |
1.9095 |
Br3 |
1.9095 |
2.8552 |
| 3.2095 |
4.6730 |
3.3965 |
Br4 |
1.9095 |
2.8552 |
3.2095 |
| 3.3965 |
4.6730 |
Br5 |
2.8552 |
1.9095 |
4.6730 |
3.3965 |
| 3.2095 |
Br6 |
2.8552 |
1.9095 |
3.3965 |
4.6730 |
3.2095 |
|
Maximum atom distance is 4.6730Å
between atoms Br3 and Br5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
Br5 |
122.819 |
|
C1 |
C2 |
Br6 |
122.819 |
C2 |
C1 |
Br3 |
122.819 |
|
C2 |
C1 |
Br4 |
122.819 |
Br3 |
C1 |
Br4 |
114.361 |
|
Br5 |
C2 |
Br6 |
114.361 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.