|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C3H2O2 (Propiolic acid)
1A' CS
1910171554
InChI=1S/C3H2O2/c1-2-3(4)5/h1H,(H,4,5) INChIKey=UORVCLMRJXCDCP-UHFFFAOYSA-N
BLYP/6-31G
Point group is Cs
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.4745 |
0.0000 |
|
0.4602 |
-0.1155 |
0.0000 |
C2 |
-0.2456 |
-0.9431 |
0.0000 |
|
-0.9746 |
-0.0087 |
0.0000 |
C3 |
-0.5303 |
-2.1325 |
0.0000 |
|
-2.1974 |
0.0045 |
0.0000 |
O4 |
1.3713 |
0.7616 |
0.0000 |
|
1.0724 |
1.1447 |
0.0000 |
O5 |
-0.8763 |
1.3670 |
0.0000 |
|
1.1127 |
-1.1826 |
0.0000 |
H6 |
-0.7831 |
-3.1740 |
0.0000 |
|
-3.2692 |
0.0128 |
0.0000 |
H7 |
1.4794 |
1.7518 |
0.0000 |
|
2.0592 |
1.0086 |
0.0000 |
Atom - Atom Distances (Å)
|
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
C1 |
|
1.4388 |
2.6603 |
1.4010 |
1.2508 |
3.7316 |
1.9545 |
C2 |
1.4388 |
|
1.2229 |
2.3496 |
2.3947 |
2.2947 |
3.1998 |
C3 |
2.6603 |
1.2229 |
| 3.4629 |
3.5165 |
1.0718 |
4.3734 |
O4 |
1.4010 |
2.3496 |
3.4629 |
| 2.3277 |
4.4867 |
0.9961 |
O5 |
1.2508 |
2.3947 |
3.5165 |
2.3277 |
| 4.5420 |
2.3869 |
H6 |
3.7316 |
2.2947 |
1.0718 |
4.4867 |
4.5420 |
| 5.4206 |
H7 |
1.9545 |
3.1998 |
4.3734 |
0.9961 |
2.3869 |
5.4206 |
|
Maximum atom distance is 5.4206Å
between atoms H6 and H7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
C3 |
176.367 |
|
C2 |
C1 |
O4 |
111.654 |
C2 |
C1 |
O5 |
125.696 |
|
O4 |
C1 |
O5 |
122.650 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
O4 |
H7 |
108.057 |
|
C2 |
C3 |
H6 |
179.820 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.