|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
B2PLYP/6-311+G(3df,2p)
Point group is Cs
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
-0.6738 |
-0.1400 |
0.0000 |
|
0.3817 |
-0.5553 |
-0.1400 |
H2 |
-1.5749 |
0.4554 |
0.0000 |
|
0.8922 |
-1.2978 |
0.4554 |
Br3 |
0.8151 |
1.1128 |
0.0000 |
|
-0.4618 |
0.6717 |
1.1128 |
Cl4 |
-0.6738 |
-1.1342 |
1.4579 |
|
1.5831 |
0.2707 |
-1.1342 |
Cl5 |
-0.6738 |
-1.1342 |
-1.4579 |
|
-0.8197 |
-1.3812 |
-1.1342 |
Atom - Atom Distances (Å)
|
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
C1 |
|
1.0800 |
1.9459 |
1.7646 |
1.7646 |
H2 |
1.0800 |
| 2.4788 |
2.3376 |
2.3376 |
Br3 |
1.9459 |
2.4788 |
| 3.0646 |
3.0646 |
Cl4 |
1.7646 |
2.3376 |
3.0646 |
| 2.9158 |
Cl5 |
1.7646 |
2.3376 |
3.0646 |
2.9158 |
|
Maximum atom distance is 3.0646Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Br3 |
C1 |
Cl4 |
111.269 |
|
Br3 |
C1 |
Cl5 |
111.269 |
Cl4 |
C1 |
Cl5 |
111.418 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
H2 |
C1 |
Br3 |
106.464 |
|
H2 |
C1 |
Cl4 |
108.096 |
H2 |
C1 |
Cl5 |
108.096 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.