|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for BrONO2 (Bromine nitrate)
1A' CS
1910171554
InChI=1S/BrNO3/c1-5-2(3)4 INChIKey=RRTWEEAEXPZMPY-UHFFFAOYSA-N
HF/LANL2DZ
Point group is Cs
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
Br1 |
-1.1482 |
-0.6227 |
0.0000 |
|
1.3061 |
0.0160 |
0.0000 |
O2 |
0.0000 |
0.8787 |
0.0000 |
|
-0.4094 |
-0.7774 |
0.0000 |
N3 |
1.3832 |
0.6797 |
0.0000 |
|
-1.5406 |
0.0431 |
0.0000 |
O4 |
2.0075 |
1.7237 |
0.0000 |
|
-2.5793 |
-0.5898 |
0.0000 |
O5 |
1.8058 |
-0.4728 |
0.0000 |
|
-1.3775 |
1.2597 |
0.0000 |
Atom - Atom Distances (Å)
|
Br1 |
O2 |
N3 |
O4 |
O5 |
Br1 |
| 1.8901 |
2.8468 |
3.9324 |
2.9578 |
O2 |
1.8901 |
|
1.3975 |
2.1780 |
2.2555 |
N3 |
2.8468 |
1.3975 |
|
1.2164 |
1.2275 |
O4 |
3.9324 |
2.1780 |
1.2164 |
| 2.2056 |
O5 |
2.9578 |
2.2555 |
1.2275 |
2.2056 |
|
Maximum atom distance is 3.9324Å
between atoms Br1 and O4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Br1 |
O2 |
N3 |
119.224 |
|
O2 |
N3 |
O4 |
112.693 |
O2 |
N3 |
O5 |
118.322 |
|
O4 |
N3 |
O5 |
128.986 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.