|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2HF3 (Trifluoroethylene)
1A' CS
1910171554
InChI=1S/C2HF3/c3-1-2(4)5/h1H INChIKey=MIZLGWKEZAPEFJ-UHFFFAOYSA-N
PBEPBE/cc-pVTZ
Point group is Cs
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.4352 |
0.0000 |
|
0.4344 |
0.0269 |
0.0000 |
C2 |
-0.7036 |
-0.6969 |
0.0000 |
|
-0.6520 |
-0.7454 |
0.0000 |
F3 |
1.3231 |
0.5120 |
0.0000 |
|
0.4292 |
1.3522 |
0.0000 |
F4 |
-0.5702 |
1.6368 |
0.0000 |
|
1.6690 |
-0.4678 |
0.0000 |
F5 |
-0.0850 |
-1.8949 |
0.0000 |
|
-1.8860 |
-0.2021 |
0.0000 |
H6 |
-1.7901 |
-0.7154 |
0.0000 |
|
-0.6032 |
-1.8309 |
0.0000 |
Atom - Atom Distances (Å)
|
C1 |
C2 |
F3 |
F4 |
F5 |
H6 |
C1 |
|
1.3330 |
1.3253 |
1.3300 |
2.3317 |
2.1279 |
C2 |
1.3330 |
| 2.3599 |
2.3375 |
1.3483 |
1.0866 |
F3 |
1.3253 |
2.3599 |
| 2.2022 |
2.7885 |
3.3464 |
F4 |
1.3300 |
2.3375 |
2.2022 |
| 3.5649 |
2.6497 |
F5 |
2.3317 |
1.3483 |
2.7885 |
3.5649 |
| 2.0733 |
H6 |
2.1279 |
1.0866 |
3.3464 |
2.6497 |
2.0733 |
|
Maximum atom distance is 3.5649Å
between atoms F4 and F5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
F5 |
120.827 |
|
C2 |
C1 |
F3 |
125.184 |
C2 |
C1 |
F4 |
122.755 |
|
F3 |
C1 |
F4 |
112.061 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
H6 |
122.834 |
|
F5 |
C2 |
H6 |
116.339 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.