|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Vibrations > Calculated > Frequencies OR Calculated > Vibrations > Frequencies
|
Calculated Frequencies
for C3H7NO (Propanamide) 1A' C1
BLYP/STO-3G 1A' C1
19 05 15 13 41
InChI=1S/C3H7NO/c1-2-3(4)5/h2H2,1H3,(H2,4,5) INChIKey=QLNJFJADRCOGBJ-UHFFFAOYSA-N
Mode Number |
Symmetry |
Frequency (cm-1) |
Scaled Frequency (cm-1) |
IR Intensity (km/mol) |
reduced mass (u) |
description |
Raman Act (Å4/u) |
Dep P |
Dep U |
| 1
|
A |
3622 |
3351 |
2.019 |
1.0965 |
|
|
|
|
| 2
|
A |
3409 |
3154 |
1.730 |
1.05 |
|
|
|
|
| 3
|
A |
3380 |
3127 |
2.784 |
1.1067 |
|
|
|
|
| 4
|
A |
3376 |
3123 |
2.123 |
1.107 |
|
|
|
|
| 5
|
A |
3317 |
3068 |
2.088 |
1.1074 |
|
|
|
|
| 6
|
A |
3217 |
2976 |
6.835 |
1.0448 |
|
|
|
|
| 7
|
A |
3213 |
2972 |
0.442 |
1.0538 |
|
|
|
|
| 8
|
A |
1787 |
1653 |
50.474 |
6.2716 |
|
|
|
|
| 9
|
A |
1712 |
1584 |
9.304 |
1.1829 |
|
|
|
|
| 10
|
A |
1643 |
1521 |
3.963 |
1.0543 |
|
|
|
|
| 11
|
A |
1636 |
1513 |
2.825 |
1.0456 |
|
|
|
|
| 12
|
A |
1606 |
1486 |
1.546 |
1.0913 |
|
|
|
|
| 13
|
A |
1527 |
1412 |
1.051 |
1.235 |
|
|
|
|
| 14
|
A |
1406 |
1301 |
1.576 |
1.6097 |
|
|
|
|
| 15
|
A |
1339 |
1239 |
0.446 |
1.1993 |
|
|
|
|
| 16
|
A |
1249 |
1156 |
85.207 |
1.9306 |
|
|
|
|
| 17
|
A |
1149 |
1063 |
12.727 |
2.064 |
|
|
|
|
| 18
|
A |
1122 |
1038 |
0.131 |
1.3976 |
|
|
|
|
| 19
|
A |
1059 |
980 |
15.479 |
1.6966 |
|
|
|
|
| 20
|
A |
1036 |
959 |
2.377 |
1.9725 |
|
|
|
|
| 21
|
A |
829 |
767 |
10.119 |
1.2734 |
|
|
|
|
| 22
|
A |
770 |
712 |
14.440 |
2.9666 |
|
|
|
|
| 23
|
A |
620 |
574 |
155.799 |
1.6053 |
|
|
|
|
| 24
|
A |
525 |
486 |
11.110 |
3.8372 |
|
|
|
|
| 25
|
A |
501 |
464 |
59.507 |
2.2543 |
|
|
|
|
| 26
|
A |
418 |
387 |
16.439 |
2.1208 |
|
|
|
|
| 27
|
A |
369 |
341 |
29.632 |
1.3792 |
|
|
|
|
| 28
|
A |
218 |
202 |
2.563 |
3.4099 |
|
|
|
|
| 29
|
A |
163 |
151 |
0.112 |
1.1548 |
|
|
|
|
30
|
A |
31 |
28 |
0.689 |
1.9713 |
|
|
|
|
The
icon indicates there is calculated data on internal rotation or inversion
corresponding to this vibrational mode.
Click on the icon in the table to go to the pages on internal rotation.
Other modes may correspond to internal rotation too,
but we have only calculated the internal rotation potential energy surface for the indicated modes.
List of frequencies only
Unscaled Zero Point Vibrational Energy (zpe) 23124 cm-1
Scaled (by 0.9252) Zero Point Vibrational Energy (zpe) 21394 cm-1
See section Calculated; Vibrations; Scale Factors; Set scaling factors to change the scale factors used here.
See section Calculated; Vibrations; Scale Factors; Calculate a scale factor to determine the least squares best scaling factor.
List of Irreducible Representations for C1
| Rep |
deg. |
n vib |
IR |
R |
| A |
1 |
30 |
active
|
active
|