| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Silane, trichloro-; Silici-chloroforme; Siliciumchloroform; Silicochloroform; Trichloorsilaan; Trichloromonosilane; Trichlorosilane; Triclorosilano; Trichlorsilan; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/Cl3HSi/c1-4(2)3/h4H | ZDHXKXAHOVTTAH-UHFFFAOYSA-N | Cl[SiH](Cl)Cl | Trichlorosilane |
| State | Conformation |
|---|---|
| 1A1 | C3V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-496.22 | 4.20 | kJ mol-1 | JANAF | |
Hfg(0K) ![]() |
-491.15 | 4.20 | kJ mol-1 | JANAF | |
Entropy (298.15K) ![]() |
313.72 | 0.40 | J K-1 mol-1 | JANAF | |
Integrated Heat Capacity (0 to 298.15K) ![]() |
16.15 | kJ mol-1 | JANAF | ||
Heat Capacity (298.15K) ![]() |
75.44 | J K-1 mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 2261 | Shim | ||||||
| 2 | A1 | 499 | Shim | ||||||
| 3 | A1 | 254 | Shim | ||||||
| 4 | E | 811 | Shim | ||||||
| 5 | E | 600 | Shim | ||||||
| 6 | E | 176 | Shim | ||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.08247 | 0.08247 | 0.05003 | 1986Smi:110 | C constrained |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 1.407629E+07 | amu3Å6 | 6.445493777388E-113 | gm3 cm6 | |
Point Group C3v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rSiH | 1.464 | 1 | 2 | 1977Tak/Mat:1633 | rs value | |||
| rSiCl | 2.020 | 1 | 3 | 1977Tak/Mat:1633 | rs value | |||
| aClSiCl | 109.4 | 3 | 1 | 4 | 1977Tak/Mat:1633 | |||
| aHSiCl | 109.5 | 2 | 1 | 3 | 1977Tak/Mat:1633 | |||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| Si1 | 0.0000 | 0.0000 | 0.4989 |
| H2 | 0.0000 | 0.0000 | 1.9629 |
| Cl3 | 0.0000 | 1.9041 | -0.1754 |
| Cl4 | 1.6490 | -0.9521 | -0.1754 |
| Cl5 | -1.6490 | -0.9521 | -0.1754 |
| Si1 | H2 | Cl3 | Cl4 | Cl5 | |
|---|---|---|---|---|---|
| Si1 | 1.4640 | 2.0200 | 2.0200 | 2.0200 | |
| H2 | 1.4640 | 2.8632 | 2.8632 | 2.8632 | |
| Cl3 | 2.0200 | 2.8632 | 3.2981 | 3.2981 | |
| Cl4 | 2.0200 | 2.8632 | 3.2981 | 3.2981 | |
| Cl5 | 2.0200 | 2.8632 | 3.2981 | 3.2981 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| H2 | Si1 | Cl3 | 109.500 | H2 | Si1 | Cl4 | 109.500 | |
| H2 | Si1 | Cl5 | 109.500 | Cl3 | Si1 | Cl4 | 109.442 | |
| Cl3 | Si1 | Cl5 | 109.442 | Cl4 | Si1 | Cl5 | 109.442 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-Si | 1 |
| Si-Cl | 3 |
| Atom 1 | Atom 2 |
|---|---|
| Si1 | H2 |
| Si1 | Cl3 |
| Si1 | Cl4 |
| Si1 | Cl5 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 11.940 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C3v | True | 0.860 | NSRDS-NBS10 | DT | C3v | 1 | 1 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C3v | True | C3v | 1 | 1 | |||||
| squib | reference | DOI |
|---|---|---|
| 1977Tak/Mat:1633 | H Takeo, C Matsumura "The Microwave Spectra, Molecular Structures, and Quadrupole Coupling Constants of Methyltrichlorosilane and Trichlorosilane" Bulletin of the Chemical Society of Japan Vol. 50 (1977) No. 6 P 1633-1634 | 10.1246/bcsj.50.1633 |
| 1986Smi:110 | JG Smith "The Millimetre Wave Spectrum of Trichlorosilane" J. Mol. Spect. 120, 110-117, 1986 | 10.1016/0022-2852(86)90074-3 |
| JANAF | Chase, M.W., Jr.; Davies, C.A.; Downey, J.R., Jr.; Frurip, D.J.; McDonald, R.A.; Syverud, A.N., JANAF Thermochemical Tables (Third Edition), J. Phys. Chem. Ref. Data,Suppl. 1, 1985, 14, 1. | |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| Shim | Shimanouchi, T. , Tables of Molecular Vibrational Frequencies, Consolidated Volu | 10.6028/NBS.NSRDS.39 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |