| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Benzene, p-dichloro-; p-Dichlorobenzene; paradichlorobenzene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H | OCJBOOLMMGQPQU-UHFFFAOYSA-N | ClC1=CC=C(Cl)C=C1 | 1,4-Dichlorobenzene |
| State | Conformation |
|---|---|
| 1AG | D2H |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
24.90 | 4.20 | kJ mol-1 | TRC | |
Hfg(0K) ![]() |
4.20 | kJ mol-1 | TRC | ||
Entropy (298.15K) ![]() |
337.40 | 3.40 | J K-1 mol-1 | TRC | |
Heat Capacity (298.15K) ![]() |
114.30 | 1.10 | J K-1 mol-1 | TRC |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | Ag | 3072 | 1970Gre:1503 | 1 | |||||
| 2 | Ag | 1574 | 2 | ||||||
| 3 | Ag | 1169 | 3 | ||||||
| 4 | Ag | 1096 | 4 | ||||||
| 5 | Ag | 747 | 5 | ||||||
| 6 | Ag | 328 | 6 | ||||||
| 7 | Au | 951 | 16 | ||||||
| 8 | Au | 405 | 17 | ||||||
| 9 | B1g | 815 | 7 | ||||||
| 10 | B1u | 3078 | 18 | ||||||
| 11 | B1u | 1477 | 19 | ||||||
| 12 | B1u | 1090 | 20 | ||||||
| 13 | B1u | 1015 | 21 | ||||||
| 14 | B1u | 550 | 22 | ||||||
| 15 | B2g | 934 | 8 | ||||||
| 16 | B2g | 687 | 9 | ||||||
| 17 | B2g | 298 | 10 | ||||||
| 18 | B2u | 3087 | 23 | ||||||
| 19 | B2u | 1394 | 24 | ||||||
| 20 | B2u | 1220 | 25 | ||||||
| 21 | B2u | 1107 | 26 | ||||||
| 22 | B2u | 226 | 27 | ||||||
| 23 | B3g | 3065 | 11 | ||||||
| 24 | B3g | 1574 | 12 | ||||||
| 25 | B3g | 1290 | 13 | ||||||
| 26 | B3g | 626 | 14 | ||||||
| 27 | B3g | 350 | 15 | ||||||
| 28 | B3u | 819 | 28 | ||||||
| 29 | B3u | 485 | 29 | ||||||
| 30 | B3u | 122 | 30 | ||||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D2h
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.388 | 0.001 | 1 | 3 | 1987Kuchitsu(II/15) | |||
| rCC | 1.394 | 0.002 | 3 | 6 | 1987Kuchitsu(II/15) | |||
| rCCl | 1.729 | 0.001 | 1 | 7 | 1987Kuchitsu(II/15) | |||
| rHC | 1.081 | 0.004 | 3 | 9 | 1987Kuchitsu(II/15) | |||
| aCCC | 121.6 | 0.1 | 3 | 1 | 4 | 1987Kuchitsu(II/15) | ||
| aHCC | 120 | 3 | 6 | 12 | 1987Kuchitsu(II/15) | assumed | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C:C | 6 |
| H-C | 4 |
| C-Cl | 2 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C3 |
| C1 | C4 |
| C1 | Cl7 |
| C2 | C5 |
| C2 | C6 |
| C2 | Cl8 |
| C3 | C6 |
| C3 | H9 |
| C4 | C5 |
| C4 | H10 |
| C5 | H11 |
| C6 | H12 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1AG |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 8.920 | 0.030 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1AG | D2h | True | D2h | 0 | 2 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1AG | D2h | True | D2h | 0 | 2 | |||||
| squib | reference | DOI |
|---|---|---|
| 1970Gre:1503 | JHS Green "Vibrational spectra of benzene derivatives - VI. p-Disubstituted compounds" Spectrochimica Acta A 26, 1503-1513, 1970 | 10.1016/0584-8539(70)80211-2 |
| 1987Kuchitsu(II/15) | Kuchitsu (ed.), Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 15: Structure Data of Free Polyatomic Molecules. Springer-Verlag, Berlin, 1987. | |
| TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |