![]() |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
You are here: Experimental > One molecule all properties |
Other names |
---|
2,5-Furandione; cis-Butenedioic Anhydride; Dihydro-2,5-dioxofuran; Maleic acid anhydride; Toxilic anhydride; furan-2,5-dione; |
INChI | INChIKey | SMILES | IUPAC name |
---|---|---|---|
InChI=1S/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H | FPYJFEHAWHCUMM-UHFFFAOYSA-N | O=C(C=C1)OC1=O | furan-2,5-dione |
State | Conformation |
---|---|
1A1 | C2V |
Property | Value | Uncertainty | units | Reference | Comment |
---|---|---|---|---|---|
Heat Capacity (298.15K) ![]() |
90.04 | J K-1 mol-1 | webbook |
Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
---|---|---|---|---|---|---|---|---|---|
Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
1 | A1 | 3132 | 2011Vog/Dem:337-343 | solid | CH stretch | ||||
2 | A1 | 1865 | gas | C=O str | |||||
3 | A1 | 1595 | solid | C=C str | |||||
4 | A1 | 1232 | gas | CO stretch | |||||
5 | A1 | 1066 | solid | CH bend | |||||
6 | A1 | 872 | solid | CC s-stretch | |||||
7 | A1 | 641 | solid | ring deform | |||||
8 | A1 | 415 | solid | C=O bend | |||||
9 | A2 | 959 | solid | CH out-of-plane bend | |||||
10 | A2 | 768 | solid | ring deform | |||||
11 | A2 | 275 | solid | C=O bend | |||||
12 | B1 | 840 | gas B1 B2 switched | CH out-of-plane bend | |||||
13 | B1 | 631 | solid B1 B2 switched | ring deform | |||||
14 | B1 | 161 | gas B1 B2 switched | CO op-bend | |||||
15 | B2 | 3120 | gas B1 B2 switched | CH stretch | |||||
16 | B2 | 1805 | gas B1 B2 switched | C=O str | |||||
17 | B2 | 1309 | solid B1 B2 switched | CH bend | |||||
18 | B2 | 1055 | gas B1 B2 switched | CO a-sym str | |||||
19 | B2 | 896 | solid B1 B2 switched | CC a-stretch | |||||
20 | B2 | 697 | gas B1 B2 switched | ring deform | |||||
21 | B2 | 556 | gas B1 B2 switched | C=O bend |
A | B | C | reference | comment |
---|---|---|---|---|
0.22963 | 0.08272 | 0.06081 | 2010Vog/Alt:153 | Be values |
Product of moments of inertia ![]() | ||||
---|---|---|---|---|
4147367 | amu3Å6 | 1.8990678511467E-113 | gm3 cm6 |
Point Group C2v
Description | Value | unc. | Connectivity | Reference | Comment | |||
---|---|---|---|---|---|---|---|---|
Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
rCC | 1.485 | 0.001 | 2 | 5 | 2010Vog/Alt:153 | |||
rCC | 1.332 | 0.001 | 6 | 7 | 2010Vog/Alt:153 | |||
rCO | 1.386 | 0.001 | 1 | 2 | 2010Vog/Alt:153 | |||
rCO | 1.192 | 0.001 | 2 | 4 | 2010Vog/Alt:153 | |||
rCH | 1.078 | 5 | 8 | 2010Vog/Alt:153 | assumed | |||
aCCC | 107.8 | 0.1 | 2 | 6 | 7 | 2010Vog/Alt:153 | ||
aCCO | 129.2 | 0.2 | 4 | 2 | 6 | 2010Vog/Alt:153 | ||
aHCC | 129.7 | 6 | 7 | 9 | 2010Vog/Alt:153 | assumed | ||
aCCO | 108.2 | 0.1 | 1 | 2 | 6 | 2010Vog/Alt:153 | ||
aCOC | 107.9 | 0.1 | 2 | 1 | 3 | 2010Vog/Alt:153 | ||
aOCO | 122.6 | 0.1 | 1 | 2 | 4 | 2010Vog/Alt:153 |
Atom | x (Å) | y (Å) | z (Å) |
---|---|---|---|
O1 | 0.0000 | 0.0000 | 0.9753 |
C2 | 0.0000 | 1.1206 | 0.1596 |
C3 | 0.0000 | -1.1206 | 0.1596 |
O4 | 0.0000 | 2.2308 | 0.5936 |
O5 | 0.0000 | -2.2308 | 0.5936 |
C6 | 0.0000 | 0.6654 | -1.2539 |
C7 | 0.0000 | -0.6654 | -1.2539 |
H8 | 0.0000 | 1.3533 | -2.0839 |
H9 | 0.0000 | -1.3533 | -2.0839 |
O1 | C2 | C3 | O4 | O5 | C6 | C7 | H8 | H9 | |
---|---|---|---|---|---|---|---|---|---|
O1 | 1.3860 | 1.3860 | 2.2632 | 2.2632 | 2.3264 | 2.3264 | 3.3451 | 3.3451 | |
C2 | 1.3860 | 2.2412 | 1.1920 | 3.3794 | 1.4850 | 2.2777 | 2.2556 | 3.3397 | |
C3 | 1.3860 | 2.2412 | 3.3794 | 1.1920 | 2.2777 | 1.4850 | 3.3397 | 2.2556 | |
O4 | 2.2632 | 1.1920 | 3.3794 | 4.4616 | 2.4215 | 3.4353 | 2.8176 | 4.4737 | |
O5 | 2.2632 | 3.3794 | 1.1920 | 4.4616 | 3.4353 | 2.4215 | 4.4737 | 2.8176 | |
C6 | 2.3264 | 1.4850 | 2.2777 | 2.4215 | 3.4353 | 1.3308 | 1.0780 | 2.1826 | |
C7 | 2.3264 | 2.2777 | 1.4850 | 3.4353 | 2.4215 | 1.3308 | 2.1826 | 1.0780 | |
H8 | 3.3451 | 2.2556 | 3.3397 | 2.8176 | 4.4737 | 1.0780 | 2.1826 | 2.7065 | |
H9 | 3.3451 | 3.3397 | 2.2556 | 4.4737 | 2.8176 | 2.1826 | 1.0780 | 2.7065 |
Experimental Bond Angles (degrees) from cartesians
atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
---|---|---|---|---|---|---|---|---|
O1 | C2 | O4 | 122.600 | O1 | C2 | C6 | 108.200 | |
O1 | C3 | O5 | 122.600 | O1 | C3 | C7 | 108.200 | |
C2 | O1 | C3 | 107.900 | C2 | C6 | C7 | 107.850 | |
C2 | C6 | H8 | 122.500 | C3 | C7 | C6 | 107.850 | |
C3 | C7 | H9 | 122.500 | O4 | C2 | C6 | 129.200 | |
O5 | C3 | C7 | 129.200 | C6 | C7 | H9 | 129.650 | |
C7 | C6 | H8 | 129.650 |
Bond descriptions
Bond Type | Count |
---|---|
C-C | 2 |
C=C | 1 |
H-C | 2 |
C-O | 2 |
C=O | 2 |
Atom 1 | Atom 2 |
---|---|
O1 | C2 |
O1 | C3 |
C2 | O4 |
C2 | C6 |
C3 | O5 |
C3 | C7 |
C6 | C7 |
C6 | H8 |
C7 | H9 |
Energy (cm-1) | Degeneracy | reference | description |
---|---|---|---|
0 | 1 | 1A1 |
Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
---|---|---|---|---|
11.070 | webbook |
Electron Affinity | unc. | reference |
---|---|---|
1.440 | 0.087 | webbook |
State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
x | y | z | total | dipole | quadrupole | ||||||||
1 | 1 | 1A1 | C2v | True | 4.141 | 4.141 | 1983Alo/Pas:215-222 | ± 0.022 D MW μ0 | C2v | 1 | 2 |
Vibrational Quantum numbers | Dip x | Dip y | Dip z | Dip total | Squib | Comment |
---|---|---|---|---|---|---|
0 | 4.141 | 1983Alo/Pas:215-222 | ± 0.022 D | |||
ν14 = 1 | 4.171 | 1983Alo/Pas:215-222 | ± 0.038 D | |||
ν14 = 2 | 4.177 | 1983Alo/Pas:215-222 | ± 0.017 D |
State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
---|---|---|---|---|---|---|---|---|---|---|---|---|
xx | yy | zz | dipole | quadrupole | ||||||||
1 | 1 | 1A1 | C2v | True | C2v | 1 | 2 |
squib | reference | DOI |
---|---|---|
1983Alo/Pas:215-222 | JL Alonso, MR Pastrana, J Pelaez, A Arauzo "Ring-bending potential function and electric dipole moment of maleic anhydride" Spec. Acta A 39, 1983, 215-222 | 10.1016/0584-8539(83)80139-1 |
2010Vog/Alt:153 | N Vogt, EP Altova, NM Karasev "Equilibrium structure of maleic anhydride from gas-phase electron difraction (GED) and quantum-chemical studies" Journal of Molecular Structure 978 (2010) 153-157 | 10.1016/j.molstruc.2010.02.037 |
webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
Browse | |
---|---|
Previous | Next |