| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| 1-Propene, 2-methyl-; γ-Butylene; 1,1-Dimethylethylene; 2-Methyl-1-propene; 2-Methylpropene; 2-Methylpropene-isobutylene; Isobutene; Isobutylene; iso-C4H8; Isopropylidenemethylene; Liquefied petroleum gas; Methylpropene; Propene, 2-methyl-; gamma-Butylene; 2-methylprop-1-ene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 | VQTUBCCKSQIDNK-UHFFFAOYSA-N | C=C(C)C | 2-methylprop-1-ene |
| State | Conformation |
|---|---|
| 1A1 | C2V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-17.80 | 0.60 | kJ mol-1 | 1970COX/PIL | |
Hfg(0K) ![]() |
4.00 | 0.60 | kJ mol-1 | 1970COX/PIL | |
Entropy (298.15K) ![]() |
293.20 | J K-1 mol-1 | TRC | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
17.01 | kJ mol-1 | TRC | ||
Heat Capacity (298.15K) ![]() |
88.09 | J K-1 mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 2989 | Shim | ||||||
| 2 | A1 | 2941 | Shim | ||||||
| 3 | A1 | 2911 | Shim | ||||||
| 4 | A1 | 1661 | Shim | ||||||
| 5 | A1 | 1470 | Shim | ||||||
| 6 | A1 | 1416 | Shim | ||||||
| 7 | A1 | 1366 | Shim | ||||||
| 8 | A1 | 1064 | Shim | ||||||
| 9 | A1 | 801 | Shim | ||||||
| 10 | A1 | 383 | Shim | ||||||
| 11 | A2 | 2970 | Shim | ||||||
| 12 | A2 | 1459 | Shim | ||||||
| 13 | A2 | 1076 | Shim | ||||||
| 14 | A2 | Shim | assignment questionable (listed as 981) | ||||||
| 15 | A2 | 193 | Shim | ||||||
| 16 | B1 | 2945 | Shim | ||||||
| 17 | B1 | 1444 | Shim | ||||||
| 18 | B1 | 1079 | Shim | ||||||
| 19 | B1 | 890 | Shim | ||||||
| 20 | B1 | 429 | Shim | ||||||
| 21 | B1 | 196 | Shim | ||||||
| 22 | B2 | 3086 | Shim | ||||||
| 23 | B2 | 2980 | Shim | ||||||
| 24 | B2 | 2893 | Shim | ||||||
| 25 | B2 | 1458 | Shim | ||||||
| 26 | B2 | 1381 | Shim | ||||||
| 27 | B2 | 1282 | Shim | ||||||
| 28 | B2 | 1043 | Shim | ||||||
| 29 | B2 | 974 | Shim | ||||||
| 30 | B2 | 430 | Shim | ||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.30466 | 0.27959 | 0.15397 | 1961Laurie:1516 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 365277.4 | amu3Å6 | 1.67259515854425E-114 | gm3 cm6 | |
Point Group C2v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.507 | 1 | 5 | 1976Hellwege(II/7) | ||||
| rCC | 1.330 | 1 | 2 | 1976Hellwege(II/7) | ||||
| rCH | 1.088 | 2 | 3 | 1976Hellwege(II/7) | C at end of = | |||
| rCH | 1.072 | 5 | 7 | 1976Hellwege(II/7) | ||||
| rCH | 1.095 | 5 | 8 | 1976Hellwege(II/7) | ||||
| aHCH | 118.5 | 3 | 2 | 4 | 1976Hellwege(II/7) | |||
| aHCC | 112.9 | 1 | 5 | 7 | 1976Hellwege(II/7) | |||
| aHCC | 110.7 | 1 | 5 | 8 | 1976Hellwege(II/7) | |||
| aCCC | 115.3 | 5 | 1 | 6 | 1976Hellwege(II/7) | |||
| aCCC | 122.35 | 2 | 1 | 5 | 1976Hellwege(II/7) | by symmetry | ||
| aHCC | 120.75 | 1 | 2 | 3 | 1976Hellwege(II/7) | by symmetry | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 8 |
| C-C | 2 |
| C=C | 1 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C5 |
| C1 | C6 |
| C2 | H3 |
| C2 | H4 |
| C5 | H7 |
| C5 | H8 |
| C5 | H9 |
| C6 | H10 |
| C6 | H11 |
| C6 | H12 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.220 | 0.020 | 9.410 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | 0.503 | 1961Laurie:1516 | ± 0.009 | C2v | 1 | 2 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | C2v | 1 | 2 | |||||
| alpha | unc. | Reference |
|---|---|---|
| 7.880 | 1998Gus/Rui:163 |
| squib | reference | DOI |
|---|---|---|
| 1961Laurie:1516 | VW Laurie "MICROWAVE SPECTRUM OF ISOBUTYLENE DIPOLE MOMENT, INTERNAL BARRIER, EQUILIBRIUM CONFORMATION, AND STRUCTURE" J. Chem. Phys. 34(5) 1516, 1961 | 10.1063/1.1701038 |
| 1970COX/PIL | J.D. Cox, G. Pilcher, "Thermochemistry of Organic and Organometallic Compounds" Academic Press, London, 1970 | 10.1002/bbpc.19700740727 |
| 1976Hellwege(II/7) | Hellwege, KH and AM Hellwege (ed.). Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 7: Structure Data of Free Polyatomic Molecules. Springer-Verlag. Berlin. 1976. | |
| 1998Gus/Rui:163 | M Gussoni, R Rui, G Zerbi "Electronic and relaxation contribution to linear molecular polarizability. An analysis of the experimental values" J. Mol. Struct. 447 (1998) 163-215 | 10.1016/S0022-2860(97)00292-5 |
| Shim | Shimanouchi, T. , Tables of Molecular Vibrational Frequencies, Consolidated Volu | 10.6028/NBS.NSRDS.39 |
| TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |