| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| 1,1,2,2-Tetrafluoroethylene; Ethene, tetrafluoro-; Ethylene, tetrafluoro-; Fluoroplast 4; Perfluoroethene; Perfluoroethylene; Tetrafluorethylene; Tetrafluoroethene; Ethane, tetrafluoro-; Tetrafluoroethylene, inhibited; TFE; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C2F4/c3-1(4)2(5)6 | BFKJFAAPBSQJPD-UHFFFAOYSA-N | FC(F)=C(F)F | Perfluoroethene |
| State | Conformation |
|---|---|
| 1Ag | D2H |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-659.50 | 2.50 | kJ mol-1 | Gurvich | |
Hfg(0K) ![]() |
-656.08 | 2.50 | kJ mol-1 | Gurvich | |
Entropy (298.15K) ![]() |
300.12 | J K-1 mol-1 | Gurvich | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
16.33 | kJ mol-1 | Gurvich | ||
Heat Capacity (298.15K) ![]() |
80.46 | J K-1 mol-1 | Gurvich |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | Ag | 1872 | Shim | ||||||
| 2 | Ag | 778 | Shim | ||||||
| 3 | Ag | 394 | Shim | ||||||
| 4 | Au | 190 | Shim | ||||||
| 5 | B1u | 1186 | Shim | ||||||
| 6 | B1u | 558 | Shim | ||||||
| 7 | B2g | 508 | Shim | ||||||
| 8 | B2u | 1337 | Shim | ||||||
| 9 | B2u | 218 | Shim | ||||||
| 10 | B3g | 1340 | Shim | ||||||
| 11 | B3g | 551 | Shim | ||||||
| 12 | B3u | 406 | Shim | ||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D2h
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.311 | 1 | 2 | 1976Hellwege(II/7) | ||||
| rCF | 1.319 | 1 | 3 | 1976Hellwege(II/7) | ||||
| aCCF | 123.8 | 1 | 2 | 5 | 1976Hellwege(II/7) | |||
| aFCF | 112.4 | 3 | 1 | 4 | 1976Hellwege(II/7) | by symmetry | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.0000 | 0.6555 |
| C2 | 0.0000 | 0.0000 | -0.6555 |
| F3 | 0.0000 | 1.0961 | 1.3893 |
| F4 | 0.0000 | -1.0961 | 1.3893 |
| F5 | 0.0000 | -1.0961 | -1.3893 |
| F6 | 0.0000 | 1.0961 | -1.3893 |
| C1 | C2 | F3 | F4 | F5 | F6 | |
|---|---|---|---|---|---|---|
| C1 | 1.3110 | 1.3190 | 1.3190 | 2.3200 | 2.3200 | |
| C2 | 1.3110 | 2.3200 | 2.3200 | 1.3190 | 1.3190 | |
| F3 | 1.3190 | 2.3200 | 2.1921 | 3.5391 | 2.7785 | |
| F4 | 1.3190 | 2.3200 | 2.1921 | 2.7785 | 3.5391 | |
| F5 | 2.3200 | 1.3190 | 3.5391 | 2.7785 | 2.1921 | |
| F6 | 2.3200 | 1.3190 | 2.7785 | 3.5391 | 2.1921 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| C1 | C2 | F5 | 123.800 | C1 | C2 | F6 | 123.800 | |
| C2 | C1 | F3 | 123.800 | C2 | C1 | F4 | 123.800 | |
| F3 | C1 | F4 | 112.400 | F5 | C2 | F6 | 112.400 |
Bond descriptions
| Bond Type | Count |
|---|---|
| C=C | 1 |
| C-F | 4 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | F3 |
| C1 | F4 |
| C2 | F5 |
| C2 | F6 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1Ag |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 10.140 | 0.070 | 10.690 | 0.020 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1Ag | D2h | True | 0.000 | NSRDS-NBS10 | D2h | 0 | 2 | ||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1Ag | D2h | True | D2h | 0 | 2 | |||||
| squib | reference | DOI |
|---|---|---|
| 1976Hellwege(II/7) | Hellwege, KH and AM Hellwege (ed.). Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 7: Structure Data of Free Polyatomic Molecules. Springer-Verlag. Berlin. 1976. | |
| Gurvich | Gurvich, L.V.; Veyts, I. V.; Alcock, C. B., Thermodynamic Properties of Individual Substances, Fouth Edition, Hemisphere Pub. Co., New York, 1989 | |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| Shim | Shimanouchi, T. , Tables of Molecular Vibrational Frequencies, Consolidated Volu | 10.6028/NBS.NSRDS.39 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |