| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/As4/c1-2-3(1)4(1)2/t1-,2+,3-,4+ | UYVQXFOBKTWZCW-GNSDDBTRSA-N | [As]12[As]3[As]1[As]23 |
| State | Conformation |
|---|---|
| 1A1 | Td |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group Td
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rAsAs | 2.435 | 1 | 2 | 1976Hellwege(II/7) | ED | |||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| As1 | 0.8609 | 0.8609 | 0.8609 |
| As2 | 0.8609 | -0.8609 | -0.8609 |
| As3 | -0.8609 | 0.8609 | -0.8609 |
| As4 | -0.8609 | -0.8609 | 0.8609 |
| As1 | As2 | As3 | As4 | |
|---|---|---|---|---|
| As1 | 2.4350 | 2.4350 | 2.4350 | |
| As2 | 2.4350 | 2.4350 | 2.4350 | |
| As3 | 2.4350 | 2.4350 | 2.4350 | |
| As4 | 2.4350 | 2.4350 | 2.4350 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| As1 | As2 | As3 | 60.000 | As1 | As2 | As4 | 60.000 | |
| As1 | As3 | As2 | 60.000 | As1 | As3 | As4 | 60.000 | |
| As1 | As4 | As2 | 60.000 | As1 | As4 | As3 | 60.000 | |
| As2 | As1 | As3 | 60.000 | As2 | As1 | As4 | 60.000 | |
| As2 | As3 | As4 | 60.000 | As2 | As4 | As3 | 60.000 | |
| As3 | As1 | As4 | 60.000 | As3 | As2 | As4 | 60.000 |
Bond descriptions
| Bond Type | Count |
|---|---|
| As-As | 6 |
| Atom 1 | Atom 2 |
|---|---|
| As1 | As2 |
| As1 | As3 |
| As1 | As4 |
| As2 | As3 |
| As2 | As4 |
| As3 | As4 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.300 | 0.300 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | Td | True | Td | 0 | 0 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | Td | True | Td | 0 | 0 | |||||
| alpha | unc. | Reference |
|---|---|---|
| 17.293 | 0.163 | 2015Tha/Wu:144302 |
| squib | reference | DOI |
|---|---|---|
| 1976Hellwege(II/7) | Hellwege, KH and AM Hellwege (ed.). Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 7: Structure Data of Free Polyatomic Molecules. Springer-Verlag. Berlin. 1976. | |
| 2015Tha/Wu:144302 | AJ Thakkar, T Wu "How well do static electronic dipole polarizabilities from gas-phase experiments compare with density functional and MP2 computations?" J. Chem. Phys. 143, 144302 (2015) | 10.1063/1.4932594 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |