| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Iron carbonyl; Pentacarbonyl iron; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/5CO.Fe/c5*1-2; | FYOFOKCECDGJBF-UHFFFAOYSA-N | O#C[Fe](C#O)(C#O)(C#O)C#O | pentacarbonyliron |
| State | Conformation |
|---|---|
| 1A1 | C4V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1' | 2121 | 1972Jon/McD:2050 | ||||||
| 2 | A1' | 2042 | 1972Jon/McD:2050 | ||||||
| 3 | A1' | 443 | 1972Jon/McD:2050 | ||||||
| 4 | A1' | 413 | 1972Jon/McD:2050 | ||||||
| 5 | A2' | 383 | 1972Jon/McD:2050 | ||||||
| 6 | A2" | 2034 | 1972Jon/McD:2050 | ||||||
| 7 | A2" | 619 | 1972Jon/McD:2050 | ||||||
| 8 | A2" | 429 | 1972Jon/McD:2050 | ||||||
| 9 | A2" | 100 | 1972Jon/McD:2050 | ||||||
| 10 | E' | 2013 | 1972Jon/McD:2050 | ||||||
| 11 | E' | 645 | 1972Jon/McD:2050 | ||||||
| 12 | E' | 543 | 1972Jon/McD:2050 | ||||||
| 13 | E' | 474 | 1972Jon/McD:2050 | ||||||
| 14 | E' | 105 | 1972Jon/McD:2050 | ||||||
| 15 | E' | 74 | 1972Jon/McD:2050 | ||||||
| 16 | E" | 488 | 1972Jon/McD:2050 | ||||||
| 17 | E" | 375 | 1972Jon/McD:2050 | ||||||
| 18 | E" | 97 | 1972Jon/McD:2050 | ||||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C-Fe | 5 |
| C#O | 5 |
| Atom 1 | Atom 2 |
|---|---|
| Fe1 | C2 |
| Fe1 | C3 |
| Fe1 | C4 |
| Fe1 | C5 |
| Fe1 | C6 |
| C2 | O7 |
| C3 | O8 |
| C4 | O9 |
| C5 | O10 |
| C6 | O11 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C4v | False | C4v | 1 | 1 | ||||||
| 1 | 2 | 1A1' | D3h | False | D3h | 0 | 1 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C4v | False | C4v | 1 | 1 | |||||
| 1 | 2 | 1A1' | D3h | False | D3h | 0 | 1 | |||||
| squib | reference | DOI |
|---|---|---|
| 1972Jon/McD:2050 | LH JOnes, RS McDowell, M Goldblatt, BI Swanson "Potential Constants of Iron Pentacarbonyl from Vibrational Spectra of Isotopic Species" J. Chem. Phys. 57(5) 2050 1972 | 10.1063/1.1678529 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |