| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Diboron tetrachloride; Dichloroborane; perchlorodiborane; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/B2Cl4/c3-1(4)2(5)6 | LCWVIHDXYOFGEG-UHFFFAOYSA-N | ClB(Cl)B(Cl)Cl | perchlorodiborane |
| State | Conformation |
|---|---|
| 1A1 | D2 |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-490.00 | 10.00 | kJ mol-1 | Gurvich | Internal rotor V=630 cm-1 I=1.33E-38 g cm2 sigma=2 n=2 See Gurvich |
Hfg(0K) ![]() |
-490.78 | 10.00 | kJ mol-1 | Gurvich | Internal rotor V=630 cm-1 I=1.33E-38 g cm2 sigma=2 n=2 See Gurvich |
Entropy (298.15K) ![]() |
371.27 | J K-1 mol-1 | Gurvich | Internal rotor V=630 cm-1 I=1.33E-38 g cm2 sigma=2 n=2 See Gurvich | |
Integrated Heat Capacity (0 to 298.15K) ![]() |
21.59 | kJ mol-1 | Gurvich | Internal rotor V=630 cm-1 I=1.33E-38 g cm2 sigma=2 n=2 See Gurvich | |
Heat Capacity (298.15K) ![]() |
98.00 | J K-1 mol-1 | Gurvich | Internal rotor V=630 cm-1 I=1.33E-38 g cm2 sigma=2 n=2 See Gurvich | |
| Barrier to Internal Rotation | 7.5 | kJ mol-1 | Gurvich | V2=630 cm-1 |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 1122 | Gurvich | ||||||
| 2 | A1 | 401 | Gurvich | ||||||
| 3 | A1 | 176 | Gurvich | ||||||
| 5 | B2 | 728 | Gurvich | ||||||
| 6 | B2 | 289 | Gurvich | ||||||
| 7 | E | 917 | Gurvich | ||||||
| 8 | E | 512 | Gurvich | ||||||
| 9 | E | 104 | Gurvich | ||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D2d
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rBCl | 1.750 | 1 | 3 | 1969Rya/Hed:4986 | ||||
| rBB | 1.702 | 1 | 2 | 1969Rya/Hed:4986 | ||||
| aClBCl | 118.65 | 3 | 1 | 4 | 1969Rya/Hed:4986 | |||
| aBBCl | 120.675 | 1 | 2 | 5 | 1969Rya/Hed:4986 | by symmetry | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| B1 | 0.0000 | 0.0000 | 0.8510 |
| B2 | 0.0000 | 0.0000 | -0.8510 |
| Cl3 | 0.0000 | 1.5140 | 1.7286 |
| Cl4 | 0.0000 | -1.5140 | 1.7286 |
| Cl5 | 1.5140 | 0.0000 | -1.7286 |
| Cl6 | -1.5140 | 0.0000 | -1.7286 |
| B1 | B2 | Cl3 | Cl4 | Cl5 | Cl6 | |
|---|---|---|---|---|---|---|
| B1 | 1.7020 | 1.7500 | 1.7500 | 2.9911 | 2.9911 | |
| B2 | 1.7020 | 2.9911 | 2.9911 | 1.7500 | 1.7500 | |
| Cl3 | 1.7500 | 2.9911 | 3.0280 | 4.0666 | 4.0666 | |
| Cl4 | 1.7500 | 2.9911 | 3.0280 | 4.0666 | 4.0666 | |
| Cl5 | 2.9911 | 1.7500 | 4.0666 | 4.0666 | 3.0280 | |
| Cl6 | 2.9911 | 1.7500 | 4.0666 | 4.0666 | 3.0280 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| B1 | B2 | Cl5 | 120.100 | B1 | B2 | Cl6 | 120.100 | |
| B2 | B1 | Cl3 | 120.100 | B2 | B1 | Cl4 | 120.100 | |
| Cl3 | B1 | Cl4 | 119.800 | Cl5 | B2 | Cl6 | 119.800 |
Bond descriptions
| Bond Type | Count |
|---|---|
| B-B | 1 |
| B-Cl | 4 |
| Atom 1 | Atom 2 |
|---|---|
| B1 | B2 |
| B1 | Cl3 |
| B1 | Cl4 |
| B2 | Cl5 |
| B2 | Cl6 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference | Comment |
|---|---|---|---|---|---|
| 10.420 | 0.020 | webbook | upper limit for IE |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | D2 | True | 0.000 | NSRDS-NBS10 | D2d | 0 | 1 | ||||
| 1 | 2 | 1A | C1 | False | C1 | 3 | 5 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | D2 | True | D2d | 0 | 1 | |||||
| 1 | 2 | 1A | C1 | False | C1 | 3 | 5 | |||||
| squib | reference | DOI |
|---|---|---|
| 1969Rya/Hed:4986 | Ryan, Hedberg, Effect of Temperature on the Structure of Gaseous Molecules.* II. An Electron-Diffraction Investigation of the Molecular Structures of B2Cl4 and SiCl4. The Potential Function for Internal Rotation in B2Cl4., J. Chem. Phys., Vol. 50, #11, pgs. 4986-4995 | 10.1063/1.1670995 |
| Gurvich | Gurvich, L.V.; Veyts, I. V.; Alcock, C. B., Thermodynamic Properties of Individual Substances, Fouth Edition, Hemisphere Pub. Co., New York, 1989 | |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |