| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Methyl ethynyl ketone; 1-Butyn-3-one; Ketone, ethynyl methyl; Ethynyl methyl ketone; Acetylacetylene; Acetylethyne; But-3-yn-2-one; 3-Butyne-2-one; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C4H4O/c1-3-4(2)5/h1H,2H3 | XRGPFNGLRSIPSA-UHFFFAOYSA-N | CC(C#C)=O |
| State | Conformation |
|---|---|
| 1A' | CS |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A' | 3262 | 1973Cor:1885 | ||||||
| 2 | A' | 3011 | 1973Cor:1885 | ||||||
| 3 | A' | 2921 | 1973Cor:1885 | ||||||
| 4 | A' | 2099 | 1973Cor:1885 | ||||||
| 5 | A' | 1690 | 1973Cor:1885 | ||||||
| 6 | A' | 1426 | 1973Cor:1885 | ||||||
| 7 | A' | 1364 | 1973Cor:1885 | ||||||
| 8 | A' | 1198 | 1973Cor:1885 | ||||||
| 9 | A' | 981 | 1973Cor:1885 | ||||||
| 10 | A' | 741 | 1973Cor:1885 | ||||||
| 11 | A' | 700 | 1973Cor:1885 | ||||||
| 12 | A' | 587 | 1973Cor:1885 | ||||||
| 13 | A' | 435 | 1973Cor:1885 | ||||||
| 14 | A' | 183 | 1973Cor:1885 | ||||||
| 15 | A" | 2972 | 1973Cor:1885 | ||||||
| 16 | A" | 1426 | 1973Cor:1885 | ||||||
| 17 | A" | 1022 | 1973Cor:1885 | ||||||
| 18 | A" | 700 | 1973Cor:1885 | ||||||
| 19 | A" | 587 | 1973Cor:1885 | ||||||
| 20 | A" | 228 | 1973Cor:1885 | nu21 | |||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group Cs
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 4 |
| C-C | 2 |
| C=O | 1 |
| C#C | 1 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | H6 |
| C1 | H7 |
| C1 | H8 |
| C2 | O3 |
| C2 | C4 |
| C4 | C5 |
| C5 | H9 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A' |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 10.250 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | Cs | 2 | 3 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | Cs | 2 | 3 | |||||
| squib | reference | DOI |
|---|---|---|
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |