![]() |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
You are here: Experimental > One molecule all properties |
Other names |
---|
Bicyclo[1.1.0]butane; |
INChI | INChIKey | SMILES | IUPAC name |
---|---|---|---|
InChI=1S/C4H6/c1-3-2-4(1)3/h3-4H,1-2H2 | LASLVGACQUUOEB-UHFFFAOYSA-N | [C@@H]12C[C@@H]1C2 | Bicyclo[1.1.0]butane |
State | Conformation |
---|---|
1A1 | C2V |
Property | Value | Uncertainty | units | Reference | Comment |
---|---|---|---|---|---|
Hfg(298.15K) ![]() |
217.15 | 0.84 | kJ mol-1 | webbook | |
Hfg(0K) ![]() |
0.84 | kJ mol-1 | webbook | ||
Entropy (298.15K) ![]() |
J K-1 mol-1 | ||||
Integrated Heat Capacity (0 to 298.15K) ![]() |
kJ mol-1 |
Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
---|---|---|---|---|---|---|---|---|---|
Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
1 | A1 | 3131 | 1990Wib/Wad:2184 | ||||||
2 | A1 | 3044 | 1990Wib/Wad:2184 | ||||||
3 | A1 | 2935 | 1990Wib/Wad:2184 | ||||||
4 | A1 | 1501 | 1990Wib/Wad:2184 | ||||||
5 | A1 | 1266 | 1990Wib/Wad:2184 | ||||||
6 | A1 | 1081 | 1990Wib/Wad:2184 | ||||||
7 | A1 | 839 | 1990Wib/Wad:2184 | ||||||
8 | A1 | 657 | 1990Wib/Wad:2184 | ||||||
9 | A1 | 423 | 1990Wib/Wad:2184 | ||||||
10 | A2 | 1172 | 1990Wib/Wad:2184 | ||||||
11 | A2 | 1063 | 1990Wib/Wad:2184 | ||||||
12 | A2 | 909 | 1990Wib/Wad:2184 | ||||||
13 | A2 | 838 | 1990Wib/Wad:2184 | ||||||
14 | B1 | 3120 | 1990Wib/Wad:2184 | ||||||
15 | B1 | 1110 | 1990Wib/Wad:2184 | ||||||
16 | B1 | 1092 | 1990Wib/Wad:2184 | ||||||
17 | B1 | 980 | 1990Wib/Wad:2184 | ||||||
18 | B1 | 737 | 1990Wib/Wad:2184 | ||||||
19 | B2 | 3044 | 1990Wib/Wad:2184 | ||||||
20 | B2 | 2969 | 1990Wib/Wad:2184 | ||||||
21 | B2 | 1485 | 1990Wib/Wad:2184 | ||||||
22 | B2 | 1261 | 1990Wib/Wad:2184 | ||||||
23 | B2 | 1081 | 1990Wib/Wad:2184 | ||||||
24 | B2 | 935 | 1990Wib/Wad:2184 |
A | B | C | reference | comment |
---|---|---|---|---|
0.57747 | 0.31067 | 0.27998 | 1966Har/Cox:5049 |
Product of moments of inertia ![]() | ||||
---|---|---|---|---|
95377.81 | amu3Å6 | 4.3673233285875E-115 | gm3 cm6 |
Point Group C2v
Description | Value | unc. | Connectivity | Reference | Comment | |||
---|---|---|---|---|---|---|---|---|
Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
rCC | 1.497 | 1 | 2 | 1969Cox/Har:1976 | across ring | |||
rCC | 1.498 | 1 | 3 | 1969Cox/Har:1976 | ||||
rCH | 1.093 | 3 | 8 | 1969Cox/Har:1976 | corner of ring | |||
rCH | 1.071 | 1 | 9 | 1969Cox/Har:1976 | in middle | |||
aCCC | 60 | 2 | 1 | 3 | 1969Cox/Har:1976 | across center and to corner | ||
aCCC | 60 | 1 | 3 | 2 | 1969Cox/Har:1976 | corner of ring | ||
aCCC | 98.3 | 3 | 1 | 4 | 1969Cox/Har:1976 | across a side | ||
aHCH | 115.6 | 5 | 4 | 7 | 1969Cox/Har:1976 | |||
aHCC | 116.9 | 1 | 3 | 8 | 1969Cox/Har:1976 | corner to middle | ||
aHCC | 118.1 | 1 | 3 | 6 | 1969Cox/Har:1976 | corner to middle | ||
aHCC | 129.9 | 3 | 1 | 9 | 1969Cox/Har:1976 | corner to middle H | ||
aHCC | 128.4 | 1 | 2 | 10 | 1969Cox/Har:1976 | across center to H |
Atom | x (Å) | y (Å) | z (Å) |
---|---|---|---|
C1 | 0.7485 | 0.0000 | -0.3163 |
C2 | -0.7485 | 0.0000 | -0.3163 |
C3 | 0.0000 | 1.1346 | 0.3126 |
C4 | 0.0000 | -1.1346 | 0.3126 |
H5 | 0.0000 | -1.1537 | 1.4054 |
H6 | 0.0000 | 1.1537 | 1.4054 |
H7 | 0.0000 | -2.0850 | -0.2273 |
H8 | 0.0000 | 2.0850 | -0.2273 |
H9 | 1.4137 | 0.0000 | -1.1557 |
H10 | -1.4137 | 0.0000 | -1.1557 |
C1 | C2 | C3 | C4 | H5 | H6 | H7 | H8 | H9 | H10 | |
---|---|---|---|---|---|---|---|---|---|---|
C1 | 1.4970 | 1.4977 | 1.4977 | 2.2036 | 2.2036 | 2.2171 | 2.2171 | 1.0710 | 2.3194 | |
C2 | 1.4970 | 1.4977 | 1.4977 | 2.2036 | 2.2036 | 2.2171 | 2.2171 | 2.3194 | 1.0710 | |
C3 | 1.4977 | 1.4977 | 2.2693 | 2.5359 | 1.0930 | 3.2646 | 1.0930 | 2.3328 | 2.3328 | |
C4 | 1.4977 | 1.4977 | 2.2693 | 1.0930 | 2.5359 | 1.0930 | 3.2646 | 2.3328 | 2.3328 | |
H5 | 2.2036 | 2.2036 | 2.5359 | 1.0930 | 2.3075 | 1.8796 | 3.6270 | 3.1447 | 3.1447 | |
H6 | 2.2036 | 2.2036 | 1.0930 | 2.5359 | 2.3075 | 3.6270 | 1.8796 | 3.1447 | 3.1447 | |
H7 | 2.2171 | 2.2171 | 3.2646 | 1.0930 | 1.8796 | 3.6270 | 4.1700 | 2.6847 | 2.6847 | |
H8 | 2.2171 | 2.2171 | 1.0930 | 3.2646 | 3.6270 | 1.8796 | 4.1700 | 2.6847 | 2.6847 | |
H9 | 1.0710 | 2.3194 | 2.3328 | 2.3328 | 3.1447 | 3.1447 | 2.6847 | 2.6847 | 2.8275 | |
H10 | 2.3194 | 1.0710 | 2.3328 | 2.3328 | 3.1447 | 3.1447 | 2.6847 | 2.6847 | 2.8275 |
Experimental Bond Angles (degrees) from cartesians
atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
---|---|---|---|---|---|---|---|---|
C1 | C2 | C3 | 60.017 | C1 | C2 | C4 | 60.017 | |
C1 | C2 | H6 | 70.143 | C1 | C3 | C2 | 59.967 | |
C1 | C3 | H7 | 35.256 | C1 | C3 | H9 | 20.668 | |
C1 | C4 | C2 | 59.967 | C1 | C4 | H8 | 35.256 | |
C1 | C4 | H10 | 70.736 | C2 | C1 | C3 | 60.017 | |
C2 | C1 | C4 | 60.017 | C2 | C1 | H5 | 70.143 | |
C2 | C3 | H7 | 35.256 | C2 | C3 | H9 | 70.736 | |
C2 | C4 | H8 | 35.256 | C2 | C4 | H10 | 20.668 | |
C3 | C1 | C4 | 98.501 | C3 | C1 | H5 | 84.190 | |
C3 | C2 | C4 | 98.501 | C3 | C2 | H6 | 26.556 | |
C4 | C1 | H5 | 26.556 | C4 | C2 | H6 | 84.190 | |
H7 | C3 | H9 | 54.283 | H8 | C4 | H10 | 54.283 |
Bond descriptions
Bond Type | Count |
---|---|
C-C | 5 |
H-C | 6 |
Atom 1 | Atom 2 |
---|---|
C1 | C2 |
C1 | C3 |
C1 | C4 |
C1 | H5 |
C2 | C3 |
C2 | C4 |
C2 | H6 |
C3 | H7 |
C3 | H9 |
C4 | H8 |
C4 | H10 |
Energy (cm-1) | Degeneracy | reference | description |
---|---|---|---|
0 | 1 | 1A1 |
Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
---|---|---|---|---|
8.700 | 0.010 | webbook |
State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
x | y | z | total | dipole | quadrupole | ||||||||
1 | 1 | 1A1 | C2v | True | 0.675 | 0.675 | 1966Har/Cox:5049 | MW +-0.01 μ0 | C2v | 1 | 2 |
State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
---|---|---|---|---|---|---|---|---|---|---|---|---|
xx | yy | zz | dipole | quadrupole | ||||||||
1 | 1 | 1A1 | C2v | True | -2.600 | 1.300 | 1.300 | 1971Fly/Ben:225 | Qxx=1.3+-0.2 (my yy), Qyy=-2.6+-0.3(my xx), Qzz=1.3+-0.4 (my zz); | C2v | 1 | 2 |
squib | reference | DOI |
---|---|---|
1966Har/Cox:5049 | Harmoy, M; Cox, K. "Microwave Spectrum, Dipole Moment, and Structure of Bicyclo[1.1.0]butane." Journal of the American Chemical Society. 88, 5049-5050 (1966) | 10.1021/ja00973a066 |
1969Cox/Har:1976 | Cox, Harmony, Nelson, Wiberg, Microwave Spectrum and Stucture of Bicyclo[1.1.0]butane, J. of Chem. Phys., Vol. 50, #5, pgs. 1976-1980 | 10.1063/1.1671318 |
1971Fly/Ben:225 | WH Flygare, RC Benson "The molecular Zeeman effect in diamagnetic molecules and the determination of molecular magnetic moments (g values), magnetic susceptibilities, and molecular quadrupole moments" Mol. Phys. 1971, 20 (2), 225-250 | 10.1080/00268977100100221 |
1990Wib/Wad:2184 | KB Wiberg, ST Waddell, RE Rosenberg "INFRARED INTENSITIES - BICYCLO[1.1.0]BUTANE - A NORMAL COORDINATE ANALYSIS AND COMPARISON WITH CYCLOPROPANE AND [1.1.1]PROPELLANE" J. Am. Chem. Soc. 112(6) 2184-2194, 1990 | 10.1021/ja00162a021 |
webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
Browse | |
---|---|
Previous | Next |