| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Spiro[2.2]pentane; Spiropentane; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C5H8/c1-2-5(1)3-4-5/h1-4H2 | OGNAOIGAPPSUMG-UHFFFAOYSA-N | C1CC12CC2 | Spiro[2.2]pentane |
| State | Conformation |
|---|---|
| 1A1 | D2D |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
185.20 | kJ mol-1 | TRC | ||
Hfg(0K) ![]() |
kJ mol-1 | TRC | |||
Entropy (298.15K) ![]() |
282.16 | 0.63 | J K-1 mol-1 | 1950Sco/Fin:4664 | |
Integrated Heat Capacity (0 to 298.15K) ![]() |
kJ mol-1 | ||||
Heat Capacity (298.15K) ![]() |
87.87 | J K-1 mol-1 |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 3000 | 1972Bur/McG:540 | ||||||
| 2 | A1 | 1423 | 1972Bur/McG:540 | ||||||
| 3 | A1 | 1160 | 1972Bur/McG:540 | questionable assignment | |||||
| 4 | A1 | 1037 | 1972Bur/McG:540 | ||||||
| 5 | A1 | 588 | 1972Bur/McG:540 | ||||||
| 6 | A2 | 3070 | 1972Bur/McG:540 | ||||||
| 7 | A2 | 1174 | 1972Bur/McG:540 | ||||||
| 8 | A2 | 919 | 1972Bur/McG:540 | questionable assignment | |||||
| 9 | B1 | 3066 | 1972Bur/McG:540 | ||||||
| 10 | B1 | 1166 | 1972Bur/McG:540 | ||||||
| 11 | B1 | 888 | 1972Bur/McG:540 | questionable assignment | |||||
| 12 | B1 | 300 | 1972Bur/McG:540 | ||||||
| 13 | B2 | 3000 | 1972Bur/McG:540 | ||||||
| 14 | B2 | 1521 | 1972Bur/McG:540 | ||||||
| 15 | B2 | 1415 | 1972Bur/McG:540 | ||||||
| 16 | B2 | 990 | 1972Bur/McG:540 | ||||||
| 17 | B2 | 872 | 1972Bur/McG:540 | ||||||
| 18 | E | 3067 | 1972Bur/McG:540 | ||||||
| 19 | E | 2985 | 1972Bur/McG:540 | ||||||
| 20 | E | 1431 | 1972Bur/McG:540 | ||||||
| 21 | E | 1150 | 1972Bur/McG:540 | ||||||
| 22 | E | 1049 | 1972Bur/McG:540 | ||||||
| 23 | E | 870 | 1972Bur/McG:540 | ||||||
| 24 | E | 780 | 1972Bur/McG:540 | ||||||
| 25 | E | 308 | 1972Bur/McG:540 | ||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.13947 | 2011Pri/Cou:129-136 | B0 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D2d
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCH | 1.105 | 0.002 | 2 | 6 | 2017San/Eri:4923-4929 | |||
| rCC | 1.482 | 1 | 2 | 2017San/Eri:4923-4929 | ||||
| rCC | 1.557 | 2 | 3 | 2017San/Eri:4923-4929 | ||||
| aHCH | 113.7 | 6 | 2 | 7 | 2017San/Eri:4923-4929 | |||
| aHCC | 118.7 | 1 | 2 | 6 | 2017San/Eri:4923-4929 | |||
| aHCC | 118.3 | 1.2 | 2 | 3 | 8 | 2017San/Eri:4923-4929 | ||
| aCCC | 63.4 | 0.1 | 2 | 1 | 3 | 2017San/Eri:4923-4929 | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.0000 | 0.0000 |
| C2 | 0.0000 | 0.7787 | 1.2609 |
| C3 | 0.0000 | -0.7787 | 1.2609 |
| C4 | -0.7787 | 0.0000 | -1.2609 |
| C5 | 0.7787 | 0.0000 | -1.2609 |
| H6 | 0.9255 | 1.3026 | 1.5611 |
| H7 | -0.9255 | 1.3026 | 1.5611 |
| H8 | -0.9255 | -1.3026 | 1.5611 |
| H9 | 0.9255 | -1.3026 | 1.5611 |
| H10 | -1.3026 | -0.9255 | -1.5611 |
| H11 | -1.3026 | 0.9255 | -1.5611 |
| H12 | 1.3026 | 0.9255 | -1.5611 |
| H13 | 1.3026 | -0.9255 | -1.5611 |
| C1 | C2 | C3 | C4 | C5 | H6 | H7 | H8 | H9 | H10 | H11 | H12 | H13 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| C1 | 1.4820 | 1.4820 | 1.4820 | 1.4820 | 2.2339 | 2.2339 | 2.2339 | 2.2339 | 2.2339 | 2.2339 | 2.2339 | 2.2339 | |
| C2 | 1.4820 | 1.5575 | 2.7518 | 2.7518 | 1.1050 | 1.1050 | 2.2975 | 2.2975 | 3.5447 | 3.1116 | 3.1116 | 3.5447 | |
| C3 | 1.4820 | 1.5575 | 2.7518 | 2.7518 | 2.2975 | 2.2975 | 1.1050 | 1.1050 | 3.1116 | 3.5447 | 3.5447 | 3.1116 | |
| C4 | 1.4820 | 2.7518 | 2.7518 | 1.5575 | 3.5447 | 3.1116 | 3.1116 | 3.5447 | 1.1050 | 1.1050 | 2.2975 | 2.2975 | |
| C5 | 1.4820 | 2.7518 | 2.7518 | 1.5575 | 3.1116 | 3.5447 | 3.5447 | 3.1116 | 2.2975 | 2.2975 | 1.1050 | 1.1050 | |
| H6 | 2.2339 | 1.1050 | 2.2975 | 3.5447 | 3.1116 | 1.8509 | 3.1958 | 2.6052 | 4.4358 | 3.8541 | 3.1673 | 3.8541 | |
| H7 | 2.2339 | 1.1050 | 2.2975 | 3.1116 | 3.5447 | 1.8509 | 2.6052 | 3.1958 | 3.8541 | 3.1673 | 3.8541 | 4.4358 | |
| H8 | 2.2339 | 2.2975 | 1.1050 | 3.1116 | 3.5447 | 3.1958 | 2.6052 | 1.8509 | 3.1673 | 3.8541 | 4.4358 | 3.8541 | |
| H9 | 2.2339 | 2.2975 | 1.1050 | 3.5447 | 3.1116 | 2.6052 | 3.1958 | 1.8509 | 3.8541 | 4.4358 | 3.8541 | 3.1673 | |
| H10 | 2.2339 | 3.5447 | 3.1116 | 1.1050 | 2.2975 | 4.4358 | 3.8541 | 3.1673 | 3.8541 | 1.8509 | 3.1958 | 2.6052 | |
| H11 | 2.2339 | 3.1116 | 3.5447 | 1.1050 | 2.2975 | 3.8541 | 3.1673 | 3.8541 | 4.4358 | 1.8509 | 2.6052 | 3.1958 | |
| H12 | 2.2339 | 3.1116 | 3.5447 | 2.2975 | 1.1050 | 3.1673 | 3.8541 | 4.4358 | 3.8541 | 3.1958 | 2.6052 | 1.8509 | |
| H13 | 2.2339 | 3.5447 | 3.1116 | 2.2975 | 1.1050 | 3.8541 | 4.4358 | 3.8541 | 3.1673 | 2.6052 | 3.1958 | 1.8509 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| C1 | C2 | C3 | 58.300 | C1 | C2 | H6 | 118.700 | |
| C1 | C2 | H7 | 118.700 | C1 | C3 | C2 | 58.300 | |
| C1 | C3 | H8 | 118.700 | C1 | C3 | H9 | 118.700 | |
| C1 | C4 | C5 | 58.300 | C1 | C4 | H10 | 118.700 | |
| C1 | C4 | H11 | 118.700 | C1 | C5 | C4 | 58.300 | |
| C1 | C5 | H12 | 118.700 | C1 | C5 | H13 | 118.700 | |
| C2 | C1 | C3 | 63.400 | C2 | C1 | C4 | 136.376 | |
| C2 | C1 | C5 | 136.376 | C2 | C3 | H8 | 118.300 | |
| C2 | C3 | H9 | 118.300 | C3 | C1 | C4 | 136.376 | |
| C3 | C1 | C5 | 136.376 | C3 | C2 | H6 | 118.300 | |
| C3 | C2 | H7 | 118.300 | C4 | C1 | C5 | 63.400 | |
| C4 | C5 | H12 | 118.300 | C4 | C5 | H13 | 118.300 | |
| C5 | C4 | H10 | 118.300 | C5 | C4 | H11 | 118.300 | |
| H6 | C2 | H7 | 113.761 | H8 | C3 | H9 | 113.761 | |
| H10 | C4 | H11 | 113.761 | H12 | C5 | H13 | 113.761 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 8 |
| C-C | 6 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C1 | C4 |
| C1 | C5 |
| C2 | C3 |
| C2 | H6 |
| C2 | H7 |
| C3 | H8 |
| C3 | H9 |
| C4 | C5 |
| C4 | H10 |
| C4 | H11 |
| C5 | H12 |
| C5 | H13 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.260 | 9.730 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | D2d | True | D2d | 0 | 1 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | D2d | True | D2d | 0 | 1 | |||||
| alpha | unc. | Reference |
|---|---|---|
| 8.049 | 1998Gus/Rui:163 |
| squib | reference | DOI |
|---|---|---|
| 1950Sco/Fin:4664 | D. W. Scott, H. L. Finke, W. N. Hubbard, J. P. McCullough, M. E. Gross, K. D. Williamson, Guy Waddington, H. M. Huffman "Spiropentane: Heat Capacity, Heats of Fusion and Vaporization, Vapor Pressure, Entropy and Thermodynamic Functions" J. Am. Chem. Soc., 1950, 72 (10), pp 4664–4668 | 10.1021/ja01166a089 |
| 1972Bur/McG:540 | GR Burns, DG McGavin "Infrared and Raman Spectra fo Spiropentane-H8" Applied Spectroscopy 26(5) 540, 1972 | 10.1366/000370272774351778 |
| 1998Gus/Rui:163 | M Gussoni, R Rui, G Zerbi "Electronic and relaxation contribution to linear molecular polarizability. An analysis of the experimental values" J. Mol. Struct. 447 (1998) 163-215 | 10.1016/S0022-2860(97)00292-5 |
| 2011Pri/Cou:129-136 | JE Price, KA Coulterpark, T Masiello, JW Nibler, A Weber, A Maki, TA Blake "High-Resolution infrared spectra of spiropentane, C5H8" J. Mol. Spect. 269 (2011) 129-136 | 10.1016/j.jms.2011.05.011 |
| 2017San/Eri:4923-4929 | JW Sandwisch, BA Erikson, K Hedberg, JW Niber "Combined Electron-Diffraction and Spectroscopic Determination of the Structure of Spiropentane, C5H8" J. Phys. Chem. A 121, 2017, 4923-4929 | 10.1021/acs.jpca.7b04450 |
| TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |