| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Cyclobutadibenzene; Diphenylene; 1,1'-Biphenylene; Dibenzocyclobutadiene; biphenylene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H | IFVTZJHWGZSXFD-UHFFFAOYSA-N | C12=C(C=CC=C2)C3=CC=CC=C13 | biphenylene |
| State | Conformation |
|---|---|
| 1Ag | D2H |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
417.20 | 1.90 | kJ mol-1 | webbook | |
Hfg(0K) ![]() |
1.90 | kJ mol-1 | webbook | ||
Heat Capacity (298.15K) ![]() |
159.30 | J K-1 mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D2h
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.372 | 0.012 | 1 | 5 | 1976Hellwege(II/7) | |||
| rCC | 1.428 | 0.012 | 5 | 6 | 1976Hellwege(II/7) | |||
| rCC | 1.370 | 0.015 | 6 | 7 | 1976Hellwege(II/7) | |||
| rCC | 1.524 | 0.006 | 1 | 2 | 1976Hellwege(II/7) | |||
| rCC | 1.432 | 0.018 | 1 | 3 | 1976Hellwege(II/7) | |||
| rCH | 1.096 | 0.009 | 5 | 13 | 1976Hellwege(II/7) | |||
| aCCC | 115 | 1.2 | 1 | 5 | 6 | 1976Hellwege(II/7) | ||
| aCCC | 122.5 | 1.2 | 5 | 6 | 7 | 1976Hellwege(II/7) | ||
| aCCC | 122.5 | 0.6 | 1 | 3 | 8 | 1976Hellwege(II/7) | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C-C | 2 |
| C:C | 12 |
| H-C | 8 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C1 | C5 |
| C2 | C4 |
| C2 | C9 |
| C3 | C4 |
| C3 | C8 |
| C4 | C12 |
| C5 | C6 |
| C5 | H13 |
| C6 | C7 |
| C6 | H14 |
| C7 | C8 |
| C7 | H15 |
| C8 | H16 |
| C9 | C10 |
| C9 | H17 |
| C10 | C11 |
| C10 | H18 |
| C11 | C12 |
| C11 | H19 |
| C12 | H20 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1Ag |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference | Comment |
|---|---|---|---|---|---|
| 7.580 | 0.030 | webbook |
| Electron Affinity | unc. | reference | Comment |
|---|---|---|---|
| 0.890 | 0.100 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1Ag | D2h | True | D2h | 0 | 2 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1Ag | D2h | True | D2h | 0 | 2 | |||||
| squib | reference | DOI |
|---|---|---|
| 1976Hellwege(II/7) | Hellwege, KH and AM Hellwege (ed.). Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 7: Structure Data of Free Polyatomic Molecules. Springer-Verlag. Berlin. 1976. | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |