| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/HNO4/c2-1(3)5-4/h4H | UUZZMWZGAZGXSF-UHFFFAOYSA-N | OO[N+]([O-])=O |
| State | Conformation |
|---|---|
| 1A | C1 |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A' | 3540 | webbook | ||||||
| 2 | A' | 1728 | |||||||
| 3 | A' | 1397 | |||||||
| 4 | A' | 1304 | |||||||
| 5 | A' | 941 | |||||||
| 6 | A' | 803 | |||||||
| 7 | A' | 648 | |||||||
| 8 | A' | 466 | |||||||
| 10 | A" | 722 | |||||||
| 12 | A" | 145 | |||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.40009 | 0.15562 | 0.11332 | 1986Sue/Lov:406 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 679008.9 | amu3Å6 | 3.1091626263765E-114 | gm3 cm6 | |
Point Group C1
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| N=O | 2 |
| N-O | 1 |
| O-O | 1 |
| H-O | 1 |
| Atom 1 | Atom 2 |
|---|---|
| N1 | O2 |
| N1 | O4 |
| N1 | O5 |
| O2 | O3 |
| O3 | H6 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A | C1 | True | 1.185 | 0.940 | 1.288 | 1.987 | 1986Sue/Lov:406 | MW μ0 | C1 | 3 | 5 |
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A | C1 | True | C1 | 3 | 5 | |||||
| squib | reference | DOI |
|---|---|---|
| 1986Sue/Lov:406 | RD Suenram, FJ Lovas "The microwave Spectrum and Molecular Conformation of Peroxynitric Acid (HOONO2)" Journal of Molecular Spectroscopy 116, 406-421 (1986) | 10.1016/0022-2852(86)90136-0 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |