| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Bicyclo[2.2.1]heptane; Cyclohexane, 1,4-endo-methylene-; Norbornylane; Norcamphane; Norfenchane; Norsantane; 1,4-Endomethylenecyclohexane; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C7H12/c1-2-7-4-3-6(1)5-7/h6-7H,1-5H2 | UMRZSTCPUPJPOJ-UHFFFAOYSA-N | C1CC2CCC1C2 | Bicyclo[2.2.1]heptane |
| State | Conformation |
|---|---|
| 1A1 | C2V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-54.90 | 1.10 | kJ mol-1 | webbook | |
Hfg(0K) ![]() |
1.10 | kJ mol-1 | webbook | ||
Heat Capacity (298.15K) ![]() |
120.08 | J K-1 mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.12323 | 0.10716 | 0.09259 | NISThydrocarbon |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 3918173 | amu3Å6 | 1.794120216867E-113 | gm3 cm6 | |
Point Group C2v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.536 | 2 | 4 | 1987Kuchitsu(II/15) | ||||
| rCC | 1.573 | 4 | 7 | 1987Kuchitsu(II/15) | ||||
| rCC | 1.546 | 1 | 2 | 1987Kuchitsu(II/15) | ||||
| rCH | 1.113 | 1 | 8 | 1987Kuchitsu(II/15) | average C-H | |||
| aCCC | 102 | 1 | 2 | 4 | 1987Kuchitsu(II/15) | |||
| aCCC | 93.4 | 2 | 1 | 3 | 1987Kuchitsu(II/15) | |||
| aCCC | 102.7 | 2 | 4 | 7 | 1987Kuchitsu(II/15) | |||
| aCCC | 109 | 4 | 2 | 5 | 1987Kuchitsu(II/15) | |||
| dCCCC | 35.8 | 1 | 2 | 5 | 6 | 1987Kuchitsu(II/15) | ||
| dCCCC | 56.3 | 2 | 1 | 3 | 6 | 1987Kuchitsu(II/15) | ||
| dCCCC | 71.6 | 4 | 2 | 5 | 6 | 1987Kuchitsu(II/15) | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C-C | 8 |
| H-C | 12 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C1 | H8 |
| C1 | H9 |
| C2 | C4 |
| C2 | C5 |
| C2 | H10 |
| C3 | C6 |
| C3 | C7 |
| C3 | H11 |
| C4 | C7 |
| C4 | H12 |
| C4 | H18 |
| C5 | C6 |
| C5 | H15 |
| C5 | H17 |
| C6 | H13 |
| C6 | H19 |
| C7 | H14 |
| C7 | H16 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.770 | 0.030 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | 0.091 | NISThydrocarbon | C2v | 1 | 2 | ||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | C2v | 1 | 2 | |||||
| squib | reference | DOI |
|---|---|---|
| 1987Kuchitsu(II/15) | Kuchitsu (ed.), Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 15: Structure Data of Free Polyatomic Molecules. Springer-Verlag, Berlin, 1987. | |
| NISThydrocarbon | NIST Hydrocarbon spectral database (http://www.physics.nist.gov/PhysRefData/MolSpec/Hydro/index.html) | 10.18434/T4PC70 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |