| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C5H8/c1-4-2-5(1)3-4/h4-5H,1-3H2 | MKCBRYIXFFGIKN-UHFFFAOYSA-N | C1(C2)CC2C1 |
| State | Conformation |
|---|---|
| 1A1' | D3H |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Heat Capacity (298.15K) ![]() |
82.34 | J K-1 mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1' | 2976 | 1992Wib/Ros:8293 | ||||||
| 2 | A1' | 2887 | |||||||
| 3 | A1' | 1509 | |||||||
| 4 | A1' | 1107 | |||||||
| 5 | A1' | 898 | |||||||
| 6 | A1" | 15 | |||||||
| 7 | A2' | 6 | |||||||
| 8 | A2' | 7 | |||||||
| 8 | A2" | 2976 | 16 | ||||||
| 9 | A2" | 1220 | 17 | ||||||
| 9 | A2" | 832 | 18 | ||||||
| 10 | E' | 2976 | 8 | ||||||
| 11 | E' | 2887 | 9 | ||||||
| 12 | E' | 1456 | 10 | ||||||
| 13 | E' | 1232 | 11 | ||||||
| 14 | E' | 1098 | 12 | ||||||
| 16 | E' | 886 | 13 | ||||||
| 17 | E' | 540 | 14 | ||||||
| 19 | E" | ||||||||
| 20 | E" | ||||||||
| 21 | E" | 1006 | |||||||
| 22 | E" | 711 | |||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.23994 | 0.23994 | 2012Per/Mar:22 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D3h
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.557 | 0.002 | 1 | 2 | 1992Wib/Ros:8293 | |||
| rCC | 1.874 | 0.003 | 1 | 5 | 1992Wib/Ros:8293 | not bonded | ||
| rHC | 1.107 | 0.004 | 1 | 6 | 1992Wib/Ros:8293 | |||
| rHC | 1.107 | 0.004 | 2 | 8 | 1992Wib/Ros:8293 | |||
| aHCH | 111.7 | 1.8 | 8 | 2 | 9 | 1992Wib/Ros:8293 | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C-C | 6 |
| H-C | 8 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C1 | C4 |
| C1 | H6 |
| C2 | C5 |
| C2 | H8 |
| C2 | H9 |
| C3 | C5 |
| C3 | H10 |
| C3 | H11 |
| C4 | C5 |
| C4 | H12 |
| C4 | H13 |
| C5 | H7 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1' |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.650 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1' | D3h | True | D3h | 0 | 1 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1' | D3h | True | D3h | 0 | 1 | |||||
| squib | reference | DOI |
|---|---|---|
| 1992Wib/Ros:8293 | KB Wiberg, RE Rosenberg, ST Waddell "Infrared Intensities: Bicyclo[1.1.1]pentane. A Normal-Corrdinate Analysis and Comparison with [1.1.1]Propellane" J. Phys. Chem. 1992, 96, 8293-8303 | 10.1021/j100200a017 |
| 2012Per/Mar:22 | A Perry, MA Martin, JW Nibler, A Maki, A Weber, TA Blake "Coriolis analysis of several high-resolution infrared bands of bicyclo[1.1.1]pentane-d0 and -d1" J. Mol. Spect. 276-277 (2012) 22-32 | 10.1016/j.jms.2012.06.008 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |