| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Ethene, trifluoro-; Ethylene, trifluoro-; Ethylene trifluoride; Trifluoroethene; 1,1,2-Trifluoroethylene; 1,1,2-trifluoroethene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C2HF3/c3-1-2(4)5/h1H | MIZLGWKEZAPEFJ-UHFFFAOYSA-N | FC(F)=CF | 1,1,2-trifluoroethene |
| State | Conformation |
|---|---|
| 1A' | CS |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-474.00 | 8.40 | kJ mol-1 | webbook | |
Hfg(0K) ![]() |
8.40 | kJ mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group Cs
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.341 | 0.012 | 1 | 2 | 1987Kuchitsu(II/15) | |||
| rCF | 1.316 | 0.011 | 1 | 3 | 1987Kuchitsu(II/15) | C1-F3 assumed = C1-F4 | ||
| rCF | 1.342 | 0.024 | 2 | 5 | 1987Kuchitsu(II/15) | |||
| rCH | 1.100 | 0.010 | 2 | 6 | 1987Kuchitsu(II/15) | |||
| aCCF | 123.1 | 1.5 | 2 | 1 | 4 | 1987Kuchitsu(II/15) | ||
| aCCF | 124 | 0.6 | 2 | 1 | 3 | 1987Kuchitsu(II/15) | ||
| aFCF | 112 | 1.8 | 3 | 1 | 4 | 1987Kuchitsu(II/15) | ||
| aCCF | 120 | 0.7 | 1 | 2 | 5 | 1987Kuchitsu(II/15) | ||
| aHCC | 124 | 1.7 | 1 | 2 | 6 | 1987Kuchitsu(II/15) | ||
| aHCF | 116 | 1.4 | 5 | 2 | 6 | 1987Kuchitsu(II/15) | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.4436 | 0.0000 |
| C2 | -0.7139 | -0.6916 | 0.0000 |
| F3 | 1.3153 | 0.4857 | 0.0000 |
| F4 | -0.5506 | 1.6388 | 0.0000 |
| F5 | -0.0873 | -1.8784 | 0.0000 |
| H6 | -1.8133 | -0.7269 | 0.0000 |
| C1 | C2 | F3 | F4 | F5 | H6 | |
|---|---|---|---|---|---|---|
| C1 | 1.3410 | 1.3160 | 1.3160 | 2.3235 | 2.1582 | |
| C2 | 1.3410 | 2.3460 | 2.3362 | 1.3420 | 1.1000 | |
| F3 | 1.3160 | 2.3460 | 2.1935 | 2.7488 | 3.3554 | |
| F4 | 1.3160 | 2.3362 | 2.1935 | 3.5476 | 2.6816 | |
| F5 | 2.3235 | 1.3420 | 2.7488 | 3.5476 | 2.0749 | |
| H6 | 2.1582 | 1.1000 | 3.3554 | 2.6816 | 2.0749 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| C1 | C2 | F5 | 120.000 | C1 | C2 | H6 | 124.000 | |
| C2 | C1 | F3 | 124.000 | C2 | C1 | F4 | 123.100 | |
| F3 | C1 | F4 | 112.900 | F5 | C2 | H6 | 116.000 |
Bond descriptions
| Bond Type | Count |
|---|---|
| C=C | 1 |
| C-F | 3 |
| H-C | 1 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | F3 |
| C1 | F4 |
| C2 | F5 |
| C2 | H6 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A' |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 10.140 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | 1.400 | NSRDS-NBS10 | MW | Cs | 2 | 3 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | 2.700 | -3.500 | 0.800 | 1971Fly/Ben:225 | Qxx=-3.5+-0.4, Qyy=2.7+-0.4, Qzz=0.8+-0.5 | Cs | 2 | 3 |
| squib | reference | DOI |
|---|---|---|
| 1971Fly/Ben:225 | WH Flygare, RC Benson "The molecular Zeeman effect in diamagnetic molecules and the determination of molecular magnetic moments (g values), magnetic susceptibilities, and molecular quadrupole moments" Mol. Phys. 1971, 20 (2), 225-250 | 10.1080/00268977100100221 |
| 1987Kuchitsu(II/15) | Kuchitsu (ed.), Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 15: Structure Data of Free Polyatomic Molecules. Springer-Verlag, Berlin, 1987. | |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |