![]() |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
You are here: Experimental > One molecule all properties |
Other names |
---|
Ethene, trifluoro-; Ethylene, trifluoro-; Ethylene trifluoride; Trifluoroethene; 1,1,2-Trifluoroethylene; 1,1,2-trifluoroethene; |
INChI | INChIKey | SMILES | IUPAC name |
---|---|---|---|
InChI=1S/C2HF3/c3-1-2(4)5/h1H | MIZLGWKEZAPEFJ-UHFFFAOYSA-N | FC(F)=CF | 1,1,2-trifluoroethene |
State | Conformation |
---|---|
1A' | CS |
Property | Value | Uncertainty | units | Reference | Comment |
---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-474.00 | 8.40 | kJ mol-1 | webbook | |
Hfg(0K) ![]() |
8.40 | kJ mol-1 | webbook |
Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
---|---|---|---|---|---|---|---|---|---|
Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference |
A | B | C | reference | comment |
---|
Product of moments of inertia ![]() | ||||
---|---|---|---|---|
amu3Å6 | 0 | gm3 cm6 |
Point Group Cs
Description | Value | unc. | Connectivity | Reference | Comment | |||
---|---|---|---|---|---|---|---|---|
Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
rCC | 1.341 | 0.012 | 1 | 2 | 1987Kuchitsu(II/15) | |||
rCF | 1.316 | 0.011 | 1 | 3 | 1987Kuchitsu(II/15) | C1-F3 assumed = C1-F4 | ||
rCF | 1.342 | 0.024 | 2 | 5 | 1987Kuchitsu(II/15) | |||
rCH | 1.100 | 0.010 | 2 | 6 | 1987Kuchitsu(II/15) | |||
aCCF | 123.1 | 1.5 | 2 | 1 | 4 | 1987Kuchitsu(II/15) | ||
aCCF | 124 | 0.6 | 2 | 1 | 3 | 1987Kuchitsu(II/15) | ||
aFCF | 112 | 1.8 | 3 | 1 | 4 | 1987Kuchitsu(II/15) | ||
aCCF | 120 | 0.7 | 1 | 2 | 5 | 1987Kuchitsu(II/15) | ||
aHCC | 124 | 1.7 | 1 | 2 | 6 | 1987Kuchitsu(II/15) | ||
aHCF | 116 | 1.4 | 5 | 2 | 6 | 1987Kuchitsu(II/15) |
Atom | x (Å) | y (Å) | z (Å) |
---|---|---|---|
C1 | 0.0000 | 0.4436 | 0.0000 |
C2 | -0.7139 | -0.6916 | 0.0000 |
F3 | 1.3153 | 0.4857 | 0.0000 |
F4 | -0.5506 | 1.6388 | 0.0000 |
F5 | -0.0873 | -1.8784 | 0.0000 |
H6 | -1.8133 | -0.7269 | 0.0000 |
C1 | C2 | F3 | F4 | F5 | H6 | |
---|---|---|---|---|---|---|
C1 | 1.3410 | 1.3160 | 1.3160 | 2.3235 | 2.1582 | |
C2 | 1.3410 | 2.3460 | 2.3362 | 1.3420 | 1.1000 | |
F3 | 1.3160 | 2.3460 | 2.1935 | 2.7488 | 3.3554 | |
F4 | 1.3160 | 2.3362 | 2.1935 | 3.5476 | 2.6816 | |
F5 | 2.3235 | 1.3420 | 2.7488 | 3.5476 | 2.0749 | |
H6 | 2.1582 | 1.1000 | 3.3554 | 2.6816 | 2.0749 |
Experimental Bond Angles (degrees) from cartesians
atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
---|---|---|---|---|---|---|---|---|
C1 | C2 | F5 | 120.000 | C1 | C2 | H6 | 124.000 | |
C2 | C1 | F3 | 124.000 | C2 | C1 | F4 | 123.100 | |
F3 | C1 | F4 | 112.900 | F5 | C2 | H6 | 116.000 |
Bond descriptions
Bond Type | Count |
---|---|
C=C | 1 |
C-F | 3 |
H-C | 1 |
Atom 1 | Atom 2 |
---|---|
C1 | C2 |
C1 | F3 |
C1 | F4 |
C2 | F5 |
C2 | H6 |
Energy (cm-1) | Degeneracy | reference | description |
---|---|---|---|
0 | 1 | 1A' |
Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
---|---|---|---|---|
10.140 | webbook |
State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
x | y | z | total | dipole | quadrupole | ||||||||
1 | 1 | 1A' | Cs | True | 1.400 | NSRDS-NBS10 | MW | Cs | 2 | 3 |
State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
---|---|---|---|---|---|---|---|---|---|---|---|---|
xx | yy | zz | dipole | quadrupole | ||||||||
1 | 1 | 1A' | Cs | True | 2.700 | -3.500 | 0.800 | 1971Fly/Ben:225 | Qxx=-3.5+-0.4, Qyy=2.7+-0.4, Qzz=0.8+-0.5 | Cs | 2 | 3 |
squib | reference | DOI |
---|---|---|
1971Fly/Ben:225 | WH Flygare, RC Benson "The molecular Zeeman effect in diamagnetic molecules and the determination of molecular magnetic moments (g values), magnetic susceptibilities, and molecular quadrupole moments" Mol. Phys. 1971, 20 (2), 225-250 | 10.1080/00268977100100221 |
1987Kuchitsu(II/15) | Kuchitsu (ed.), Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 15: Structure Data of Free Polyatomic Molecules. Springer-Verlag, Berlin, 1987. | |
NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
Browse | |
---|---|
Previous | Next |