| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Benzene, hexafluoro-; perfluorobenzene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C6F6/c7-1-2(8)4(10)6(12)5(11)3(1)9 | ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | FC1=C(F)C(F)=C(F)C(F)=C1F | perfluorobenzene |
| State | Conformation |
|---|---|
| 1A1G | D6H |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-956.00 | 1.20 | kJ mol-1 | webbook | -1015. (webbook) |
Hfg(0K) ![]() |
1.20 | kJ mol-1 | webbook | -1015. (webbook) |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1g | 1493 | 2000Bra/Hud:982 | 1 | |||||
| 2 | A1g | 556 | 2000Bra/Hud:982 | 2 | |||||
| 3 | A2g | 788 | 2000Bra/Hud:982 | 3 | |||||
| 4 | A2u | 210 | 2000Bra/Hud:982 | 11 | |||||
| 5 | B1u | 1330 | 2000Bra/Hud:982 | 12 | |||||
| 6 | B1u | 600 | 2000Bra/Hud:982 | 13 | |||||
| 7 | B2g | 719 | 2000Bra/Hud:982 | 4 | |||||
| 8 | B2g | 205 | 2000Bra/Hud:982 | 5 | |||||
| 9 | B2u | 1252 | 2000Bra/Hud:982 | 14 | |||||
| 10 | B2u | 278 | 2000Bra/Hud:982 | 15 | |||||
| 11 | E1g | 365 | 2000Bra/Hud:982 | 10 | |||||
| 12 | E1u | 1533 | 2000Bra/Hud:982 | 18 | |||||
| 13 | E1u | 1019 | 2000Bra/Hud:982 | 19 | |||||
| 14 | E1u | 313 | 2000Bra/Hud:982 | 20 | |||||
| 15 | E2g | 1656 | 2000Bra/Hud:982 | 6 | |||||
| 16 | E2g | 1162 | 2000Bra/Hud:982 | 7 | |||||
| 17 | E2g | 440 | 2000Bra/Hud:982 | 8 | |||||
| 18 | E2g | 267 | 2000Bra/Hud:982 | 9 | |||||
| 19 | E2u | 645 | 2000Bra/Hud:982 | 16 | |||||
| 20 | E2u | 137 | 2000Bra/Hud:982 | 17 | |||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D6h
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.401 | 0.014 | 1 | 2 | 1976Hellwege(II/7) | |||
| rCF | 1.325 | 0.010 | 1 | 7 | 1976Hellwege(II/7) | |||
| aCCC | 120 | 1 | 2 | 3 | by symmetry | |||
| aCCF | 120 | 1 | 2 | 8 | by symmetry | |||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C:C | 6 |
| C-F | 6 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C6 |
| C1 | F7 |
| C2 | C3 |
| C2 | F8 |
| C3 | C4 |
| C3 | F9 |
| C4 | C5 |
| C4 | F10 |
| C5 | C6 |
| C5 | F11 |
| C6 | F12 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1G |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.800 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1G | D6h | True | D6h | 0 | 1 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1G | D6h | True | -4.750 | -4.750 | 9.500 | 1981Bat/Buc:421 | +-0.5 | D6h | 0 | 1 |
| alpha | unc. | Reference |
|---|---|---|
| 9.580 | HCP_Polar |
| squib | reference | DOI |
|---|---|---|
| 1976Hellwege(II/7) | Hellwege, KH and AM Hellwege (ed.). Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 7: Structure Data of Free Polyatomic Molecules. Springer-Verlag. Berlin. 1976. | |
| 1981Bat/Buc:421 | MR Battaglia, AD Buckingham, JH Williams "The electric quadrupole moments of benzene and hexafluorobenzene" Chem. Phys. Lett. 78, 421, 1981 | 10.1016/0009-2614(81)85228-1 |
| 2000Bra/Hud:982 | DA Braden, BS Hudson "C6F6 and sym-C6F3H3: Ab Initio and DFT Studies of Structure, Vibrations, and Inelastic Neutron Scattering Spectra" J. Phys. Chem. A 2000, 104, 982-989 | 10.1021/jp992580w |
| HCP_Polar | TM Miller, Handbook of Chemistry and Physics Online (http://hbcponline.com/faces/documents/10_04/10_04_0001.xhtml) | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |