![]() |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
You are here: Experimental > One molecule all properties |
Other names |
---|
Cyanoform; Methanetricarbonitrile; |
INChI | INChIKey | SMILES | IUPAC name |
---|---|---|---|
nChI=1S/C4HN3/c5-1-4(2-6)3-7/h4H | HFWIMJHBCIGYFH-UHFFFAOYSA-N | C(#N)C(C#N)C#N | Methanetricarbonitrile |
State | Conformation |
---|---|
1A1 | C3V |
Property | Value | Uncertainty | units | Reference | Comment |
---|
Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
---|---|---|---|---|---|---|---|---|---|
Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
1 | A1 | 2928 | 2017Ban/Chi:9582– 9586 | ||||||
2 | A1 | 2288 | |||||||
3 | A1 | 823 | |||||||
4 | A1 | 571 | |||||||
5 | A1 | 164 | |||||||
6 | A2 | 349 | |||||||
7 | E | 2268 | |||||||
8 | E | 1268 | |||||||
9 | E | 1023 | |||||||
10 | E | 556 | |||||||
11 | E | 349 | |||||||
12 | E | 149 |
A | B | C | reference | comment |
---|---|---|---|---|
0.09557 | 1977Bak/Sva:153-156 |
Product of moments of inertia ![]() | ||||
---|---|---|---|---|
amu3Å6 | 0 | gm3 cm6 |
Point Group C3v
Description | Value | unc. | Connectivity | Reference | Comment | |||
---|---|---|---|---|---|---|---|---|
Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
rCN | 1.158 | 3 | 6 | 1977Bak/Sva:153-156 | ||||
rCC | 1.460 | 1 | 3 | 1977Bak/Sva:153-156 | ||||
rCH | 1.100 | 1 | 2 | 1977Bak/Sva:153-156 | ||||
aHCC | 106.59 | 2 | 1 | 3 | 1977Bak/Sva:153-156 | |||
aCCN | 177 | 1 | 3 | 6 | 1977Bak/Sva:153-156 |
Atom | x (Å) | y (Å) | z (Å) |
---|---|---|---|
C1 | 0.0000 | 0.0000 | 0.4537 |
H2 | 0.0000 | 0.0000 | 1.5537 |
C3 | 0.0000 | 1.3992 | 0.0369 |
C4 | 1.2118 | -0.6996 | 0.0369 |
C5 | -1.2118 | -0.6996 | 0.0369 |
N6 | 0.0000 | 2.5248 | -0.2352 |
N7 | 2.1865 | -1.2624 | -0.2352 |
N8 | -2.1865 | -1.2624 | -0.2352 |
C1 | H2 | C3 | C4 | C5 | N6 | N7 | N8 | |
---|---|---|---|---|---|---|---|---|
C1 | 1.1000 | 1.4600 | 1.4600 | 1.4600 | 2.6171 | 2.6171 | 2.6171 | |
H2 | 1.1000 | 2.0637 | 2.0637 | 2.0637 | 3.0943 | 3.0943 | 3.0943 | |
C3 | 1.4600 | 2.0637 | 2.4235 | 2.4235 | 1.1580 | 3.4553 | 3.4553 | |
C4 | 1.4600 | 2.0637 | 2.4235 | 2.4235 | 3.4553 | 1.1580 | 3.4553 | |
C5 | 1.4600 | 2.0637 | 2.4235 | 2.4235 | 3.4553 | 3.4553 | 1.1580 | |
N6 | 2.6171 | 3.0943 | 1.1580 | 3.4553 | 3.4553 | 4.3731 | 4.3731 | |
N7 | 2.6171 | 3.0943 | 3.4553 | 1.1580 | 3.4553 | 4.3731 | 4.3731 | |
N8 | 2.6171 | 3.0943 | 3.4553 | 3.4553 | 1.1580 | 4.3731 | 4.3731 |
Experimental Bond Angles (degrees) from cartesians
atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
---|---|---|---|---|---|---|---|---|
C1 | C3 | N6 | 177.000 | C1 | C4 | N7 | 177.000 | |
C1 | C5 | N8 | 177.000 | H2 | C1 | C3 | 106.590 | |
H2 | C1 | C4 | 106.590 | H2 | C1 | C5 | 106.590 | |
C3 | C1 | C4 | 112.192 | C3 | C1 | C5 | 112.192 | |
C4 | C1 | C5 | 112.192 |
Bond descriptions
Bond Type | Count |
---|---|
H-C | 1 |
C-C | 3 |
C#N | 3 |
Atom 1 | Atom 2 |
---|---|
C1 | H2 |
C1 | C3 |
C1 | C4 |
C1 | C5 |
C3 | N6 |
C4 | N7 |
C5 | N8 |
Energy (cm-1) | Degeneracy | reference | description |
---|---|---|---|
0 | 1 | 1A1 |
State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
x | y | z | total | dipole | quadrupole | ||||||||
1 | 1 | 1A1 | C3v | True | C3v | 1 | 1 |
State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
---|---|---|---|---|---|---|---|---|---|---|---|---|
xx | yy | zz | dipole | quadrupole | ||||||||
1 | 1 | 1A1 | C3v | True | C3v | 1 | 1 |
squib | reference | DOI |
---|---|---|
1977Bak/Sva:153-156 | R Bak, H Svanholt "THE EXISTENCE OF GASEOUS CYANOFORM AS OBSERVED BY MICROWAVE SPECTRA" Journal of Molecular Structure. 37 (1977) 153-156 | 10.1016/0022-2860(77)87015-4 |
2017Ban/Chi:9582– 9586 | K Banert, M Chityala, M Hagedorn, H Beckers, T Stuker, S Riedel, T Ruffer, H Lang "Tricyanomethane and Its Ketenimine Tautomer: Generation from Different Precursors and Analysis in Solution, Argon Matrix, and as a Single Crystal" Angew. Chem., Int. Ed. 2017, 56, 9582– 9586 | 10.1002/anie.201704561 |
Got a better number? Please email us at
[email protected]
Browse | |
---|---|
Previous | Next |