| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Cyanoform; Methanetricarbonitrile; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| nChI=1S/C4HN3/c5-1-4(2-6)3-7/h4H | HFWIMJHBCIGYFH-UHFFFAOYSA-N | C(#N)C(C#N)C#N | Methanetricarbonitrile |
| State | Conformation |
|---|---|
| 1A1 | C3V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 2928 | 2017Ban/Chi:9582– 9586 | ||||||
| 2 | A1 | 2288 | |||||||
| 3 | A1 | 823 | |||||||
| 4 | A1 | 571 | |||||||
| 5 | A1 | 164 | |||||||
| 6 | A2 | 349 | |||||||
| 7 | E | 2268 | |||||||
| 8 | E | 1268 | |||||||
| 9 | E | 1023 | |||||||
| 10 | E | 556 | |||||||
| 11 | E | 349 | |||||||
| 12 | E | 149 | |||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.09557 | 1977Bak/Sva:153-156 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group C3v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCN | 1.158 | 3 | 6 | 1977Bak/Sva:153-156 | ||||
| rCC | 1.460 | 1 | 3 | 1977Bak/Sva:153-156 | ||||
| rCH | 1.100 | 1 | 2 | 1977Bak/Sva:153-156 | ||||
| aHCC | 106.59 | 2 | 1 | 3 | 1977Bak/Sva:153-156 | |||
| aCCN | 177 | 1 | 3 | 6 | 1977Bak/Sva:153-156 | |||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.0000 | 0.4537 |
| H2 | 0.0000 | 0.0000 | 1.5537 |
| C3 | 0.0000 | 1.3992 | 0.0369 |
| C4 | 1.2118 | -0.6996 | 0.0369 |
| C5 | -1.2118 | -0.6996 | 0.0369 |
| N6 | 0.0000 | 2.5248 | -0.2352 |
| N7 | 2.1865 | -1.2624 | -0.2352 |
| N8 | -2.1865 | -1.2624 | -0.2352 |
| C1 | H2 | C3 | C4 | C5 | N6 | N7 | N8 | |
|---|---|---|---|---|---|---|---|---|
| C1 | 1.1000 | 1.4600 | 1.4600 | 1.4600 | 2.6171 | 2.6171 | 2.6171 | |
| H2 | 1.1000 | 2.0637 | 2.0637 | 2.0637 | 3.0943 | 3.0943 | 3.0943 | |
| C3 | 1.4600 | 2.0637 | 2.4235 | 2.4235 | 1.1580 | 3.4553 | 3.4553 | |
| C4 | 1.4600 | 2.0637 | 2.4235 | 2.4235 | 3.4553 | 1.1580 | 3.4553 | |
| C5 | 1.4600 | 2.0637 | 2.4235 | 2.4235 | 3.4553 | 3.4553 | 1.1580 | |
| N6 | 2.6171 | 3.0943 | 1.1580 | 3.4553 | 3.4553 | 4.3731 | 4.3731 | |
| N7 | 2.6171 | 3.0943 | 3.4553 | 1.1580 | 3.4553 | 4.3731 | 4.3731 | |
| N8 | 2.6171 | 3.0943 | 3.4553 | 3.4553 | 1.1580 | 4.3731 | 4.3731 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| C1 | C3 | N6 | 177.000 | C1 | C4 | N7 | 177.000 | |
| C1 | C5 | N8 | 177.000 | H2 | C1 | C3 | 106.590 | |
| H2 | C1 | C4 | 106.590 | H2 | C1 | C5 | 106.590 | |
| C3 | C1 | C4 | 112.192 | C3 | C1 | C5 | 112.192 | |
| C4 | C1 | C5 | 112.192 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 1 |
| C-C | 3 |
| C#N | 3 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | H2 |
| C1 | C3 |
| C1 | C4 |
| C1 | C5 |
| C3 | N6 |
| C4 | N7 |
| C5 | N8 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C3v | True | C3v | 1 | 1 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C3v | True | C3v | 1 | 1 | |||||
| squib | reference | DOI |
|---|---|---|
| 1977Bak/Sva:153-156 | R Bak, H Svanholt "THE EXISTENCE OF GASEOUS CYANOFORM AS OBSERVED BY MICROWAVE SPECTRA" Journal of Molecular Structure. 37 (1977) 153-156 | 10.1016/0022-2860(77)87015-4 |
| 2017Ban/Chi:9582– 9586 | K Banert, M Chityala, M Hagedorn, H Beckers, T Stuker, S Riedel, T Ruffer, H Lang "Tricyanomethane and Its Ketenimine Tautomer: Generation from Different Precursors and Analysis in Solution, Argon Matrix, and as a Single Crystal" Angew. Chem., Int. Ed. 2017, 56, 9582– 9586 | 10.1002/anie.201704561 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |