| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Propadiene, tetrafluoro-; 1,1,3,3-Tetrafluoro-1,2-propadiene; Perfluoropropadiene; Tetrafluoropropadiene; perfluoroallene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C3F4/c4-2(5)1-3(6)7 | PWWKERINVYVSIE-UHFFFAOYSA-N | FC(F)=C=C(F)F |
| State | Conformation |
|---|---|
| 1A1 | D2D |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 1560 | 2002Jen:69 | ||||||
| 2 | A1 | 734 | |||||||
| 3 | A1 | 398 | |||||||
| 4 | B1 | 165 | |||||||
| 5 | B2 | 2052 | |||||||
| 6 | B2 | 1030 | |||||||
| 7 | B2 | 581 | |||||||
| 8 | E | 1248 | |||||||
| 9 | E | 613 | |||||||
| 10 | E | 550 | |||||||
| 11 | E | 90 | |||||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D2d
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.282 | 0.002 | 1 | 2 | 2000Bus/Kor:487 | |||
| rCF | 1.320 | 0.002 | 2 | 4 | 2000Bus/Kor:487 | |||
| aFCF | 108.5 | 0.2 | 4 | 2 | 5 | 2000Bus/Kor:487 | ||
| aCCF | 125.75 | 1 | 2 | 4 | 2000Bus/Kor:487 | by symmetry | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.0000 | 0.0000 |
| C2 | 0.0000 | 0.0000 | 1.2820 |
| C3 | 0.0000 | 0.0000 | -1.2820 |
| F4 | 0.0000 | 1.0713 | 2.0532 |
| F5 | 0.0000 | -1.0713 | 2.0532 |
| F6 | 1.0713 | 0.0000 | -2.0532 |
| F7 | -1.0713 | 0.0000 | -2.0532 |
| C1 | C2 | C3 | F4 | F5 | F6 | F7 | |
|---|---|---|---|---|---|---|---|
| C1 | 1.2820 | 1.2820 | 2.3159 | 2.3159 | 2.3159 | 2.3159 | |
| C2 | 1.2820 | 2.5640 | 1.3200 | 1.3200 | 3.5030 | 3.5030 | |
| C3 | 1.2820 | 2.5640 | 3.5030 | 3.5030 | 1.3200 | 1.3200 | |
| F4 | 2.3159 | 1.3200 | 3.5030 | 2.1426 | 4.3770 | 4.3770 | |
| F5 | 2.3159 | 1.3200 | 3.5030 | 2.1426 | 4.3770 | 4.3770 | |
| F6 | 2.3159 | 3.5030 | 1.3200 | 4.3770 | 4.3770 | 2.1426 | |
| F7 | 2.3159 | 3.5030 | 1.3200 | 4.3770 | 4.3770 | 2.1426 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| C1 | C2 | F4 | 125.750 | C1 | C2 | F5 | 125.750 | |
| C1 | C3 | F6 | 125.750 | C1 | C3 | F7 | 125.750 | |
| C2 | C1 | C3 | 180.000 | F4 | C2 | F5 | 108.500 | |
| F6 | C3 | F7 | 108.500 |
Bond descriptions
| Bond Type | Count |
|---|---|
| C=C | 2 |
| C-F | 4 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C2 | F4 |
| C2 | F5 |
| C3 | F6 |
| C3 | F7 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 10.880 | 11.240 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | D2d | True | D2d | 0 | 1 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | D2d | True | D2d | 0 | 1 | |||||
| squib | reference | DOI |
|---|---|---|
| 2000Bus/Kor:487 | J Buschmann, T Koristsanszky, D Lentz, P Luger, N Nickelt, S Willemsen "Structure and charge density studies on 1,1-difluoroallene and tetrafluoroallene" Z. fur KRISTALLOGRAPHIE 215(8) 487-494, 2000 | 10.1524/zkri.2000.215.8.487 |
| 2002Jen:69 | JO Jensen "Vibrational frequencies and structural dterminations of perfluoroallene" J. Mol. Struct. (Theochem) 619 (2002) 69-77 | 10.1016/S0166-1280(02)00544-4 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |