| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Bicyclo[2.1.0]pent-2-ene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C5H6/c1-2-5-3-4(1)5/h1-2,4-5H,3H2 | CGKPQMCLTLUAOW-UHFFFAOYSA-N | [C@@H]12C=C[C@@H]1C2 | Bicyclo[2.1.0]pent-2-ene |
| State | Conformation |
|---|---|
| 1A' | CS |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
333.05 | kJ mol-1 | 1991Rot/Ada:2499 | ||
Hfg(0K) ![]() |
kJ mol-1 | 1991Rot/Ada:2499 | |||
Entropy (298.15K) ![]() |
J K-1 mol-1 | ||||
Integrated Heat Capacity (0 to 298.15K) ![]() |
kJ mol-1 |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.36064 | 0.21741 | 0.17400 | NISThydrocarbon |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 351149.2 | amu3Å6 | 1.60790229738525E-114 | gm3 cm6 | |
Point Group Cs
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.560 | 3 | 5 | 1976Hellwege(II/7) | connection to tri | |||
| rCC | 1.530 | 1 | 3 | 1976Hellwege(II/7) | edge of square | |||
| d | 114 | 1 | 2 | 4 | 5 | 1976Hellwege(II/7) | dihedral between ring planes | |
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 6 |
| C-C | 5 |
| C=C | 1 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C1 | H6 |
| C2 | C4 |
| C2 | H7 |
| C3 | C4 |
| C3 | C5 |
| C3 | H8 |
| C4 | C5 |
| C4 | H9 |
| C5 | H10 |
| C5 | H11 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A' |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 8.000 | 8.600 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | 0.398 | 0.025 | 0.401 | NISThydrocarbon | x=a z=c | Cs | 2 | 3 | |
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | -1.900 | 2.700 | -0.800 | 1971Fly/Ben:225 | Qxx=-1.9+-1.5, Qyy=2.7+-1.7, Qzz=-0.8+-2.4 | Cs | 2 | 3 |
| squib | reference | DOI |
|---|---|---|
| 1971Fly/Ben:225 | WH Flygare, RC Benson "The molecular Zeeman effect in diamagnetic molecules and the determination of molecular magnetic moments (g values), magnetic susceptibilities, and molecular quadrupole moments" Mol. Phys. 1971, 20 (2), 225-250 | 10.1080/00268977100100221 |
| 1976Hellwege(II/7) | Hellwege, KH and AM Hellwege (ed.). Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 7: Structure Data of Free Polyatomic Molecules. Springer-Verlag. Berlin. 1976. | |
| 1991Rot/Ada:2499 | WR Roth, O Adamczak, R. Breuckmann, H-W Lennartz, R Boese, "Die Berechnung von Resonanzenergien; das MM2ERW-Kraftfeld" Chem. Ber. 124 (1991) 2499-2521 | 10.1002/cber.19911241121 |
| NISThydrocarbon | NIST Hydrocarbon spectral database (http://www.physics.nist.gov/PhysRefData/MolSpec/Hydro/index.html) | 10.18434/T4PC70 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |