| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Benzene, p-difluoro-; p-Difluorobenzene; Benzene, 1,4-difluoro-; para-Difluorobenzene; 1,4-difluorobenzene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C6H4F2/c7-5-1-2-6(8)4-3-5/h1-4H | QUGUFLJIAFISSW-UHFFFAOYSA-N | FC1=CC=C(F)C=C1 | 1,4-difluorobenzene |
| State | Conformation |
|---|---|
| 1Ag | D2H |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-306.70 | 1.00 | kJ mol-1 | webbook | |
Hfg(0K) ![]() |
1.00 | kJ mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | Ag | 3088 | 1985Zim/Dun:312 | ||||||
| 2 | Ag | 1595 | |||||||
| 3 | Ag | 1250 | |||||||
| 4 | Ag | 1140 | |||||||
| 5 | Ag | 859 | |||||||
| 6 | Ag | 450 | |||||||
| 7 | Au | 945 | |||||||
| 8 | Au | 420 | |||||||
| 9 | B1g | 800 | |||||||
| 10 | B1u | 3073 | |||||||
| 11 | B1u | 1514 | |||||||
| 12 | B1u | 1228 | |||||||
| 13 | B1u | 1014 | |||||||
| 14 | B1u | 740 | |||||||
| 15 | B2g | 928 | |||||||
| 16 | B2g | 692 | |||||||
| 18 | B2g | 374 | |||||||
| 18 | B2u | 3073 | |||||||
| 19 | B2u | 1633 | or maybe 1431 | ||||||
| 20 | B2u | 1306 | |||||||
| 21 | B2u | 1085 | |||||||
| 22 | B2u | 348 | |||||||
| 23 | B3g | 3085 | |||||||
| 24 | B3g | 1617 | |||||||
| 25 | B3g | 1285 | |||||||
| 26 | B3g | 635 | |||||||
| 27 | B3g | 434 | |||||||
| 28 | B3u | 838 | |||||||
| 29 | B3u | 505 | |||||||
| 30 | B3u | 158 | |||||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group D2h
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 4 |
| C-F | 2 |
| C:C | 6 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C3 |
| C1 | C4 |
| C1 | F7 |
| C2 | C5 |
| C2 | C6 |
| C2 | F8 |
| C3 | C6 |
| C3 | H9 |
| C4 | C5 |
| C4 | H10 |
| C5 | H11 |
| C6 | H12 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1Ag |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.159 | 0.001 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1Ag | D2h | True | D2h | 0 | 2 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1Ag | D2h | True | D2h | 0 | 2 | |||||
| squib | reference | DOI |
|---|---|---|
| 1985Zim/Dun:312 | RL Zimmerman, TM Dunn "THE VAPOR-PHASE INFRARED AND RAMAN-SPECTRA OF PARA-DIFLUOROBENZENE (H-4) AND (D4)" J. Mol. Spect. 110(2) 312-325, 1985 | 10.1016/0022-2852(85)90297-8 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |