| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C6H4Cl2/c7-5-2-1-3-6(8)4-5/h1-4H | ZPQOPVIELGIULI-UHFFFAOYSA-N | ClC1=CC(Cl)=CC=C1 | 1,3-dichlorobenzene |
| State | Conformation |
|---|---|
| 1A1 | C2V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
29.00 | 3.80 | kJ mol-1 | TRC | |
Hfg(0K) ![]() |
3.80 | kJ mol-1 | TRC | ||
Entropy (298.15K) ![]() |
344.20 | 3.40 | J K-1 mol-1 | TRC | |
Heat Capacity (298.15K) ![]() |
114.50 | 1.10 | J K-1 mol-1 | TRC |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 2 | A1 | 3071 | 1970Gree:1523 | ||||||
| 3 | A1 | 3071 | |||||||
| 4 | A1 | 1577 | |||||||
| 5 | A1 | 1412 | |||||||
| 6 | A1 | 1124 | |||||||
| 7 | A1 | 1073 | |||||||
| 8 | A1 | 997 | |||||||
| 9 | A1 | 663 | |||||||
| 10 | A1 | 398 | |||||||
| 11 | A1 | 198 | |||||||
| 12 | A2 | 892 | |||||||
| 13 | A2 | 532 | |||||||
| 14 | A2 | 212 | |||||||
| 15 | B1 | 964 | |||||||
| 16 | B1 | 867 | |||||||
| 17 | B1 | 773 | |||||||
| 18 | B1 | 672 | |||||||
| 19 | B1 | 433 | |||||||
| 20 | B1 | 175 | |||||||
| 21 | B2 | 3095 | |||||||
| 22 | B2 | 1577 | |||||||
| 23 | B2 | 1462 | |||||||
| 24 | B2 | 1289 | |||||||
| 25 | B2 | 1258 | |||||||
| 26 | B2 | 1161 | |||||||
| 27 | B2 | 1080 | |||||||
| 28 | B2 | 784 | |||||||
| 29 | B2 | 429 | |||||||
| 30 | B2 | 365 | |||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.09448 | 0.02878 | 0.02206 | 1993Ond/Ats:101 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 7.987365E+07 | amu3Å6 | 3.65739197729856E-112 | gm3 cm6 | |
Point Group C2v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.388 | 0.004 | 1 | 2 | 1998Kuc | |||
| rCC | 1.392 | 0.003 | 2 | 4 | 1998Kuc | |||
| rCC | 1.404 | 0.003 | 4 | 6 | 1998Kuc | |||
| rCCl | 1.736 | 0.001 | 4 | 7 | 1998Kuc | |||
| rHC | 1.091 | 0.006 | 6 | 12 | 1998Kuc | |||
| rHC | 1.085 | 0.002 | 2 | 10 | 1998Kuc | |||
| rHC | 1.091 | 0.007 | 1 | 9 | ||||
| aCCC | 118.1 | 0.4 | 4 | 6 | 5 | 1998Kuc | ||
| aCCC | 122.3 | 0.2 | 2 | 4 | 6 | 1998Kuc | ||
| aCCC | 118.1 | 0.2 | 1 | 2 | 4 | 1998Kuc | ||
| aCCC | 121.1 | 0.4 | 2 | 1 | 3 | |||
| aCCCl | 118.9 | 0.3 | 6 | 4 | 7 | 1998Kuc | ||
| aCCH | 121.2 | 0.2 | 4 | 2 | 10 | 1998Kuc | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C:C | 6 |
| H-C | 4 |
| C-Cl | 2 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C1 | H9 |
| C2 | C4 |
| C2 | H10 |
| C3 | C5 |
| C3 | H11 |
| C4 | C6 |
| C4 | Cl7 |
| C5 | C6 |
| C5 | Cl8 |
| C6 | H12 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.100 | 0.020 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | C2v | 1 | 2 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | C2v | 1 | 2 | |||||
| alpha | unc. | Reference |
|---|---|---|
| 13.729 | 1998Gus/Rui:163 |
| squib | reference | DOI |
|---|---|---|
| 1993Ond/Ats:101 | M Onda, M Atsuki, J Yamaguchi, K Suga, I Yamaguchi "Microwave spectra and structure of 1,3-dichlorobenzene" J. Mol. Struct. 295 (1993) 101-104 | 10.1016/0022-2860(93)85010-R |
| 1998Gus/Rui:163 | M Gussoni, R Rui, G Zerbi "Electronic and relaxation contribution to linear molecular polarizability. An analysis of the experimental values" J. Mol. Struct. 447 (1998) 163-215 | 10.1016/S0022-2860(97)00292-5 |
| 1998Kuc | K Kuchitsu(ed) "Structure of Free Polyatomic Molecules - Basic Data" Springer, Berlin, 1998 | 10.1007/978-3-642-45748-7 |
| TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |