| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| thioacetamide; acetothioamide; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C2H5NS/c1-2(3)4/h1H3,(H2,3,4) | YUKQRDCYNOVPGJ-UHFFFAOYSA-N | S=C(N)C | thioacetamide |
| State | Conformation |
|---|---|
| 1A | C1 |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
12.70 | 1.20 | kJ mol-1 | webbook | |
Hfg(0K) ![]() |
1.20 | kJ mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A' | 3521 | |||||||
| 2 | A' | 3413 | |||||||
| 3 | A' | 2964 | |||||||
| 4 | A' | 2925 | |||||||
| 5 | A' | 1597 | |||||||
| 6 | A' | 1433 | |||||||
| 7 | A' | 1372 | |||||||
| 8 | A' | 1348 | |||||||
| 9 | A' | 1309 | |||||||
| 10 | A' | 999 | |||||||
| 11 | A' | 987 | |||||||
| 12 | A' | 735 | |||||||
| 13 | A' | 434 | |||||||
| 14 | A' | ||||||||
| 15 | A" | 2941 | |||||||
| 16 | A" | 1437 | |||||||
| 17 | A" | ||||||||
| 18 | A" | 603 | |||||||
| 19 | A" | 501 | |||||||
| 20 | A" | ||||||||
| 21 | A" | ||||||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group C1
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCS | 1.647 | 0.002 | 1 | 2 | 1987Kuchitsu(II/15) | rg | ||
| rCN | 1.356 | 0.002 | 1 | 4 | 1987Kuchitsu(II/15) | |||
| rCC | 1.512 | 0.002 | 1 | 3 | 1987Kuchitsu(II/15) | |||
| rHN | 1.050 | 0.004 | 4 | 8 | 1987Kuchitsu(II/15) | |||
| rHC | 1.102 | 0.003 | 3 | 5 | 1987Kuchitsu(II/15) | |||
| aCCS | 122.9 | 0.1 | 2 | 1 | 3 | 1987Kuchitsu(II/15) | ||
| aCCN | 114.8 | 0.2 | 3 | 1 | 4 | 1987Kuchitsu(II/15) | ||
| aHCC | 113.8 | 0.7 | 1 | 3 | 5 | 1987Kuchitsu(II/15) | ||
| aHNC | 124 | 1.8 | 1 | 4 | 8 | 1987Kuchitsu(II/15) | ||
| aHNC | 114.4 | 1.4 | 1 | 4 | 9 | 1987Kuchitsu(II/15) | ||
| dHNCS | 0 | 2 | 1 | 4 | 9 | 1987Kuchitsu(II/15) | assumed | |
| dHNCS | 180 | 2 | 1 | 4 | 8 | 1987Kuchitsu(II/15) | assumed | |
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 3 |
| H-N | 2 |
| C-C | 1 |
| C-N | 1 |
| C=S | 1 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | S2 |
| C1 | C3 |
| C1 | N4 |
| C3 | H5 |
| C3 | H6 |
| C3 | H7 |
| N4 | H8 |
| N4 | H9 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 8.350 | 0.020 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A | C1 | True | C1 | 3 | 5 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A | C1 | True | C1 | 3 | 5 | |||||
| squib | reference | DOI |
|---|---|---|
| 1987Kuchitsu(II/15) | Kuchitsu (ed.), Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 15: Structure Data of Free Polyatomic Molecules. Springer-Verlag, Berlin, 1987. | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |