| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Dimethyl Sulfoxide; Dimethyl Sulphoxide; DMSO; Domoso; Dromisol; Methane, sulfinylbis-; Methyl sulfoxide; Methylsulfinylmethane; Sulfinylbis[Methane]; (methylsulfinyl)methane; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 | IAZDPXIOMUYVGZ-UHFFFAOYSA-N | C[S](C)=O | (methylsulfinyl)methane |
| State | Conformation |
|---|---|
| 1A' | CS |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-150.50 | 1.50 | kJ mol-1 | webbook | |
Hfg(0K) ![]() |
1.50 | kJ mol-1 | webbook | ||
Entropy (298.15K) ![]() |
J K-1 mol-1 | ||||
Integrated Heat Capacity (0 to 298.15K) ![]() |
kJ mol-1 |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A' | 3010 | 1972Gei/Han:283 | ||||||
| 2 | A' | 3010 | |||||||
| 3 | A' | 2933 | |||||||
| 4 | A' | 1419 | |||||||
| 5 | A' | 1405 | |||||||
| 6 | A' | 1304 | |||||||
| 7 | A' | 1102 | |||||||
| 8 | A' | 1016 | |||||||
| 9 | A' | 1006 | |||||||
| 10 | A' | 672 | |||||||
| 11 | A' | 382 | |||||||
| 12 | A' | 308 | |||||||
| 13 | |||||||||
| 14 | A" | 3010 | |||||||
| 15 | A" | 3010 | |||||||
| 16 | A" | 2933 | |||||||
| 17 | A" | 1455 | |||||||
| 18 | A" | 1440 | |||||||
| 19 | A" | 1319 | |||||||
| 20 | A" | 953 | |||||||
| 21 | A" | 933 | |||||||
| 22 | A" | 695 | |||||||
| 23 | A" | 333 | |||||||
| 24 | |||||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.23471 | 0.23052 | 0.14072 | 1969Fed/Dre:266 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 629189.9 | amu3Å6 | 2.8810428203085E-114 | gm3 cm6 | |
Point Group Cs
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCS | 1.799 | 1 | 3 | 1998Kuc | ||||
| rSO | 1.485 | 1 | 2 | 1998Kuc | ||||
| rCH | 1.054 | 3 | 7 | 1998Kuc | ||||
| rCH | 1.097 | 3 | 8 | 1998Kuc | ||||
| rCH | 1.093 | 3 | 5 | 1998Kuc | ||||
| aCSC | 96.6 | 3 | 1 | 4 | 1998Kuc | |||
| aCSO | 106.5 | 2 | 1 | 3 | 1998Kuc | |||
| aHCS | 108.3 | 1 | 3 | 7 | 1998Kuc | |||
| aHCS | 108.2 | 1 | 3 | 8 | 1998Kuc | |||
| aHCS | 109.6 | 1 | 3 | 5 | 1998Kuc | |||
| aHCH | 113.6 | 7 | 3 | 8 | 1998Kuc | |||
| aHCH | 106.6 | 5 | 3 | 7 | 1998Kuc | |||
| aHCH | 110.6 | 5 | 3 | 8 | 1998Kuc | |||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| S1 | 0.0000 | 0.1432 | 0.4202 |
| O2 | 0.0000 | 1.4024 | -0.3667 |
| C3 | 1.3425 | -0.8664 | -0.2227 |
| C4 | -1.3425 | -0.8664 | -0.2227 |
| H5 | 2.2553 | -0.4311 | 0.0751 |
| H6 | -2.2553 | -0.4311 | 0.0751 |
| H7 | 1.3057 | -1.8579 | 0.2349 |
| H8 | 1.2255 | -0.9383 | -1.3113 |
| H9 | -1.3057 | -1.8579 | 0.2349 |
| H10 | -1.2255 | -0.9383 | -1.3113 |
| S1 | O2 | C3 | C4 | H5 | H6 | H7 | H8 | H9 | H10 | |
|---|---|---|---|---|---|---|---|---|---|---|
| S1 | 1.4849 | 1.7986 | 1.7986 | 2.3527 | 2.3527 | 2.3966 | 2.3811 | 2.3966 | 2.3811 | |
| O2 | 1.4849 | 2.6402 | 2.6402 | 2.9399 | 2.9399 | 3.5632 | 2.8059 | 3.5632 | 2.8059 | |
| C3 | 1.7986 | 2.6402 | 2.6850 | 1.0542 | 3.6363 | 1.0926 | 1.0972 | 2.8645 | 2.7901 | |
| C4 | 1.7986 | 2.6402 | 2.6850 | 3.6363 | 1.0542 | 2.8645 | 2.7901 | 1.0926 | 1.0972 | |
| H5 | 2.3527 | 2.9399 | 1.0542 | 3.6363 | 4.5106 | 1.7213 | 1.8000 | 3.8395 | 3.7809 | |
| H6 | 2.3527 | 2.9399 | 3.6363 | 1.0542 | 4.5106 | 3.8395 | 3.7809 | 1.7213 | 1.8000 | |
| H7 | 2.3966 | 3.5632 | 1.0926 | 2.8645 | 1.7213 | 3.8395 | 1.8008 | 2.6114 | 3.1054 | |
| H8 | 2.3811 | 2.8059 | 1.0972 | 2.7901 | 1.8000 | 3.7809 | 1.8008 | 3.1054 | 2.4510 | |
| H9 | 2.3966 | 3.5632 | 2.8645 | 1.0926 | 3.8395 | 1.7213 | 2.6114 | 3.1054 | 1.8008 | |
| H10 | 2.3811 | 2.8059 | 2.7901 | 1.0972 | 3.7809 | 1.8000 | 3.1054 | 2.4510 | 1.8008 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| S1 | C3 | H5 | 108.273 | S1 | C3 | H7 | 109.544 | |
| S1 | C3 | H9 | 56.437 | S1 | C4 | H6 | 108.273 | |
| S1 | C4 | H8 | 57.787 | S1 | C4 | H10 | 108.169 | |
| O2 | S1 | C3 | 106.654 | O2 | S1 | C4 | 106.654 | |
| C3 | S1 | C4 | 96.562 | H5 | C3 | H7 | 106.592 | |
| H5 | C3 | H9 | 153.931 | H6 | C4 | H8 | 156.603 | |
| H6 | C4 | H10 | 113.556 | H7 | C3 | H9 | 65.661 | |
| H8 | C4 | H10 | 60.861 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 6 |
| C-S | 2 |
| O=S | 1 |
| Atom 1 | Atom 2 |
|---|---|
| S1 | O2 |
| S1 | C3 |
| S1 | C4 |
| C3 | H5 |
| C3 | H7 |
| C3 | H9 |
| C4 | H6 |
| C4 | H8 |
| C4 | H10 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A' |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.100 | 9.100 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | 3.960 | NSRDS-NBS10 | MW | Cs | 2 | 3 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | Cs | 2 | 3 | |||||
| alpha | unc. | Reference |
|---|---|---|
| 7.969 | 1998Gus/Rui:163 |
| squib | reference | DOI |
|---|---|---|
| 1969Fed/Dre:266 | W Feder, H Dreizler, HD Rudolph, Vtypke "rs-Struktur von Dimeethylsulfoxid im Vergleich zur r0 Struktur" Z. Naturforsch 24a, 266-278, 1969 | 10.1515/zna-1969-0215 |
| 1972Gei/Han:283 | G Gieseler, G Hanschmann "Schwingungsverhalten von Dimethylsulfid, Dimethylsulfoxid, Dimethylsulfon und den Entsprechenden Perdeuterierten Verbindungen" J. Mol. Structure 11, 283, 1972 | 10.1016/0022-2860(72)80013-9 |
| 1998Gus/Rui:163 | M Gussoni, R Rui, G Zerbi "Electronic and relaxation contribution to linear molecular polarizability. An analysis of the experimental values" J. Mol. Struct. 447 (1998) 163-215 | 10.1016/S0022-2860(97)00292-5 |
| 1998Kuc | K Kuchitsu(ed) "Structure of Free Polyatomic Molecules - Basic Data" Springer, Berlin, 1998 | 10.1007/978-3-642-45748-7 |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |