| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Formamide, N,N-dimethyl-; DMFA; N-Formyldimethylamine; N,N-Dimethylformamide; Formyldimethylamine; Dimethylforamide; NSC-5356; U-4224; DMF; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3 | ZMXDDKWLCZADIW-UHFFFAOYSA-N | CN(C)C=O | N,N-Dimethylformamide |
| State | Conformation |
|---|---|
| 1A' | CS |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-191.60 | 3.30 | kJ mol-1 | 1970COX/PIL | |
Hfg(0K) ![]() |
3.30 | kJ mol-1 | 1970COX/PIL |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group C1
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCH | 1.112 | 0.003 | 4 | 7 | 1995Kuchitsu(II/23) | |||
| rCN | 1.391 | 0.007 | 1 | 3 | 1995Kuchitsu(II/23) | |||
| rCN | 1.453 | 0.004 | 3 | 4 | 1995Kuchitsu(II/23) | |||
| rCO | 1.224 | 0.003 | 1 | 2 | 1995Kuchitsu(II/23) | |||
| aCNC | 120.8 | 0.3 | 1 | 3 | 4 | 1995Kuchitsu(II/23) | ||
| aCNC | 122.3 | 0.4 | 1 | 3 | 5 | 1995Kuchitsu(II/23) | ||
| aCNC | 113.9 | 0.5 | 4 | 3 | 5 | 1995Kuchitsu(II/23) | ||
| aNCO | 123.5 | 0.6 | 2 | 1 | 3 | 1995Kuchitsu(II/23) | ||
| aHCN | 117 | 2.8 | 3 | 1 | 6 | 1995Kuchitsu(II/23) | ||
| dCNCO | -16.3 | 4.5 | 2 | 1 | 3 | 4 | 1995Kuchitsu(II/23) | |
| dCNCO | -168.6 | 3.9 | 2 | 1 | 3 | 5 | 1995Kuchitsu(II/23) | |
| aHCN | 110.1 | 0.3 | 3 | 4 | 7 | 1995Kuchitsu(II/23) | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C-N | 3 |
| C=O | 1 |
| H-C | 7 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | O2 |
| C1 | N3 |
| C1 | H6 |
| N3 | C4 |
| N3 | C5 |
| C4 | H7 |
| C4 | H8 |
| C4 | H9 |
| C5 | H10 |
| C5 | H11 |
| C5 | H12 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A' |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.130 | webbook |
| Electron Affinity | unc. | reference |
|---|---|---|
| 0.014 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | False | 3.820 | NSRDS-NBS10 | DR | Cs | 2 | 3 | |||
| 1 | 2 | 1A | C1 | True | C1 | 3 | 5 | ||||||
| 1 | 3 | 1A' | CS methyls geared | False | Cs | 2 | 3 | ||||||
| alpha | unc. | Reference |
|---|---|---|
| 7.809 | 1998Gus/Rui:163 |
| squib | reference | DOI |
|---|---|---|
| 1970COX/PIL | J.D. Cox, G. Pilcher, "Thermochemistry of Organic and Organometallic Compounds" Academic Press, London, 1970 | 10.1002/bbpc.19700740727 |
| 1995Kuchitsu(II/23) | Kuchitsu (ed.), Landolt-Bornstein: Group II: Molecules and Radicals Volume 23: Structure Data for Free Polyatomic Molecules. Springer. Berlin. 1995 | |
| 1998Gus/Rui:163 | M Gussoni, R Rui, G Zerbi "Electronic and relaxation contribution to linear molecular polarizability. An analysis of the experimental values" J. Mol. Struct. 447 (1998) 163-215 | 10.1016/S0022-2860(97)00292-5 |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |