| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Bicyclo(3.1.0)hex-2-ene; bicyclo[3.1.0]hex-2-ene; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C6H8/c1-2-5-4-6(5)3-1/h1-2,5-6H,3-4H2 | BAOZQZPGQWXJOW-UHFFFAOYSA-N | [C@@H]12C=CC[C@@H]1C2 | bicyclo[3.1.0]hex-2-ene |
| State | Conformation |
|---|---|
| 1A | C1 |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
158.16 | kJ mol-1 | webbook | ||
Hfg(0K) ![]() |
kJ mol-1 | webbook | |||
Entropy (298.15K) ![]() |
J K-1 mol-1 | ||||
Integrated Heat Capacity (0 to 298.15K) ![]() |
kJ mol-1 |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| A | B | C | reference | comment |
|---|---|---|---|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group C1
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCH | 1.089 | 4 | 11 | 1987Kuchitsu(II/15) | assumed | |||
| rCH | 1.082 | 3 | 10 | 1987Kuchitsu(II/15) | assumed | |||
| rCH | 1.078 | 6 | 14 | 1987Kuchitsu(II/15) | assumed | |||
| rCH | 1.091 | 2 | 8 | 1987Kuchitsu(II/15) | assumed | |||
| rCC | 1.521 | 0.001 | 1 | 3 | 1987Kuchitsu(II/15) | |||
| rCC | 1.494 | 0.010 | 3 | 6 | 1987Kuchitsu(II/15) | |||
| rCC | 1.482 | 0.006 | 1 | 4 | 1987Kuchitsu(II/15) | |||
| rCC | 1.522 | 0.007 | 3 | 4 | 1987Kuchitsu(II/15) | |||
| rCC | 1.529 | 0.015 | 1 | 2 | 1987Kuchitsu(II/15) | |||
| rCC | 1.530 | 0.015 | 2 | 5 | 1987Kuchitsu(II/15) | |||
| rCC | 1.338 | 0.010 | 5 | 6 | 1987Kuchitsu(II/15) | |||
| aHCC | 128.9 | 5 | 6 | 14 | 1987Kuchitsu(II/15) | assumed | ||
| aHCH | 116.7 | 11 | 4 | 12 | 1987Kuchitsu(II/15) | assumed | ||
| aCCC | 112 | 1 | 3 | 6 | 5 | 1987Kuchitsu(II/15) | ||
| aCCC | 111.5 | 1 | 2 | 5 | 6 | 1987Kuchitsu(II/15) | ||
| aHCC | 121.4 | 6 | 3 | 10 | 1987Kuchitsu(II/15) | |||
| aHCC | 118.5 | 2 | 1 | 7 | 1987Kuchitsu(II/15) | |||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 8 |
| C-C | 6 |
| C=C | 1 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C1 | C4 |
| C1 | H7 |
| C2 | C5 |
| C2 | H8 |
| C2 | H9 |
| C3 | C4 |
| C3 | C6 |
| C3 | H10 |
| C4 | H11 |
| C4 | H12 |
| C5 | C6 |
| C5 | H13 |
| C6 | H14 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A | C1 | True | 0.292 | NISThydrocarbon | μa= 0.166(9),μb= 0.209(15),μc= 0.119(1) | C1 | 3 | 5 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A | C1 | True | C1 | 3 | 5 | |||||
| squib | reference | DOI |
|---|---|---|
| 1987Kuchitsu(II/15) | Kuchitsu (ed.), Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 15: Structure Data of Free Polyatomic Molecules. Springer-Verlag, Berlin, 1987. | |
| NISThydrocarbon | NIST Hydrocarbon spectral database (http://www.physics.nist.gov/PhysRefData/MolSpec/Hydro/index.html) | 10.18434/T4PC70 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |