| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| 2-Chloropropane; 2-Propyl chloride; Chlorodimethylmethane; iso-C3H7Cl; Isoprid; Isopropyl chloride; Narcosop; Propane, 2-chloro-; sec-Propyl chloride; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C3H7Cl/c1-3(2)4/h3H,1-2H3 | ULYZAYCEDJDHCC-UHFFFAOYSA-N | CC(C)Cl | 2-Chloropropane |
| State | Conformation |
|---|---|
| 1A' | CS |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-144.80 | kJ mol-1 | TRC | ||
Hfg(0K) ![]() |
-124.30 | kJ mol-1 | TRC | ||
Entropy (298.15K) ![]() |
306.05 | J K-1 mol-1 | TRC | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
16.95 | kJ mol-1 | TRC | ||
Heat Capacity (298.15K) ![]() |
87.56 | J K-1 mol-1 | TRC |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A' | 3005 | 1970Kla:87 | ||||||
| 2 | A' | 2955 | 1970Kla:87 | ||||||
| 3 | A' | 2927 | 1970Kla:87 | ||||||
| 4 | A' | 2878 | 1970Kla:87 | ||||||
| 5 | A' | 1472 | 1970Kla:87 | ||||||
| 6 | A' | 1454 | 1970Kla:87 | ||||||
| 7 | A' | 1390 | 1970Kla:87 | ||||||
| 8 | A' | 1270 | 1970Kla:87 | ||||||
| 9 | A' | 1163 | 1970Kla:87 | ||||||
| 10 | A' | 1065 | 1970Kla:87 | ||||||
| 11 | A' | 888 | 1970Kla:87 | ||||||
| 12 | A' | 633 | 1970Kla:87 | ||||||
| 13 | A' | 418 | 1970Kla:87 | ||||||
| 14 | A' | 336 | 1970Kla:87 | ||||||
| 15 | A' | 253 | 1970Kla:87 | ||||||
| 16 | A" | 2997 | 1970Kla:87 | ||||||
| 17 | A" | 2985 | 1970Kla:87 | ||||||
| 18 | A" | 2947 | 1970Kla:87 | ||||||
| 19 | A" | 1472 | 1970Kla:87 | ||||||
| 20 | A" | 1454 | 1970Kla:87 | ||||||
| 21 | A" | 1377 | 1970Kla:87 | ||||||
| 22 | A" | 1334 | 1970Kla:87 | ||||||
| 23 | A" | 1123 | 1970Kla:87 | ||||||
| 24 | A" | 972 | 1970Kla:87 | ||||||
| 25 | A" | 936 | 1970Kla:87 | ||||||
| 26 | A" | 317 | 1970Kla:87 | ||||||
| 27 | A" | 276 | 1970Kla:87 | ||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.26912 | 0.15247 | 0.10699 | 1963Tob/Sch:1014 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 1091217 | amu3Å6 | 4.996649799438E-114 | gm3 cm6 | |
Point Group Cs
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.522 | 2 | 3 | 1963Tob/Sch:1014 | ||||
| rCCl | 1.798 | 1 | 2 | 1963Tob/Sch:1014 | ||||
| rCH | 1.091 | 2 | 5 | 1963Tob/Sch:1014 | on Cl carbon | |||
| rCH | 1.092 | 3 | 6 | 1963Tob/Sch:1014 | methyl | |||
| aCCC | 112.7 | 3 | 2 | 4 | 1963Tob/Sch:1014 | |||
| aCCCl | 109.4 | 1 | 2 | 3 | 1963Tob/Sch:1014 | |||
| aHCC | 109.9 | 3 | 2 | 5 | 1963Tob/Sch:1014 | to H on middle | ||
| aHCC | 110.9 | 2 | 4 | 9 | 1963Tob/Sch:1014 | CH3 alpha | ||
| aHCC | 109.7 | 2 | 3 | 6 | 1963Tob/Sch:1014 | |||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| Cl1 | 1.2286 | 0.0000 | 0.0409 |
| C2 | -0.5128 | 0.0000 | -0.4021 |
| C3 | -1.1695 | 1.2666 | 0.1222 |
| C4 | -1.1695 | -1.2666 | 0.1222 |
| H5 | -0.5303 | 0.0000 | -1.4929 |
| H6 | -2.2184 | 1.2891 | -0.1796 |
| H7 | -2.2184 | -1.2891 | -0.1796 |
| H8 | -0.6664 | 2.1546 | -0.2588 |
| H9 | -0.6664 | -2.1546 | -0.2588 |
| H10 | -1.1136 | 1.2833 | 1.2203 |
| H11 | -1.1136 | -1.2833 | 1.2203 |
| Cl1 | C2 | C3 | C4 | H5 | H6 | H7 | H8 | H9 | H10 | H11 | |
|---|---|---|---|---|---|---|---|---|---|---|---|
| Cl1 | 1.7969 | 2.7133 | 2.7133 | 2.3337 | 3.6868 | 3.6868 | 2.8850 | 2.8850 | 2.9195 | 2.9195 | |
| C2 | 1.7969 | 1.5200 | 1.5200 | 1.0909 | 2.1495 | 2.1495 | 2.1648 | 2.1648 | 2.1541 | 2.1541 | |
| C3 | 2.7133 | 1.5200 | 2.5332 | 2.1497 | 1.0917 | 2.7790 | 1.0894 | 3.4789 | 1.0996 | 2.7769 | |
| C4 | 2.7133 | 1.5200 | 2.5332 | 2.1497 | 2.7790 | 1.0917 | 3.4789 | 1.0894 | 2.7769 | 1.0996 | |
| H5 | 2.3337 | 1.0909 | 2.1497 | 2.1497 | 2.4972 | 2.4972 | 2.4867 | 2.4867 | 3.0575 | 3.0575 | |
| H6 | 3.6868 | 2.1495 | 1.0917 | 2.7790 | 2.4972 | 2.5782 | 1.7788 | 3.7781 | 1.7833 | 3.1301 | |
| H7 | 3.6868 | 2.1495 | 2.7790 | 1.0917 | 2.4972 | 2.5782 | 3.7781 | 1.7788 | 3.1301 | 1.7833 | |
| H8 | 2.8850 | 2.1648 | 1.0894 | 3.4789 | 2.4867 | 1.7788 | 3.7781 | 4.3092 | 1.7739 | 3.7692 | |
| H9 | 2.8850 | 2.1648 | 3.4789 | 1.0894 | 2.4867 | 3.7781 | 1.7788 | 4.3092 | 3.7692 | 1.7739 | |
| H10 | 2.9195 | 2.1541 | 1.0996 | 2.7769 | 3.0575 | 1.7833 | 3.1301 | 1.7739 | 3.7692 | 2.5666 | |
| H11 | 2.9195 | 2.1541 | 2.7769 | 1.0996 | 3.0575 | 3.1301 | 1.7833 | 3.7692 | 1.7739 | 2.5666 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| Cl1 | C2 | C3 | 109.491 | Cl1 | C2 | C4 | 109.491 | |
| Cl1 | C3 | H5 | 55.920 | C2 | C3 | H6 | 109.689 | |
| C2 | C3 | H8 | 111.043 | C2 | C3 | H10 | 109.581 | |
| C2 | C4 | H7 | 109.689 | C2 | C4 | H9 | 111.043 | |
| C2 | C4 | H11 | 109.581 | C3 | C2 | C4 | 112.876 | |
| C3 | C2 | H5 | 109.753 | C4 | C2 | H5 | 109.753 | |
| H6 | C3 | H8 | 109.282 | H6 | C3 | H10 | 108.941 | |
| H7 | C4 | H9 | 109.282 | H7 | C4 | H11 | 108.941 | |
| H8 | C3 | H10 | 108.263 | H9 | C4 | H11 | 108.263 |
Bond descriptions
| Bond Type | Count |
|---|---|
| C-C | 2 |
| C-Cl | 1 |
| H-C | 7 |
| Atom 1 | Atom 2 |
|---|---|
| Cl1 | C2 |
| C2 | C3 |
| C2 | C4 |
| C2 | H5 |
| C3 | H6 |
| C3 | H8 |
| C3 | H10 |
| C4 | H7 |
| C4 | H9 |
| C4 | H11 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A' |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 10.780 | 0.020 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | 2.170 | NSRDS-NBS10 | DR | Cs | 2 | 3 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | Cs | 2 | 3 | |||||
| squib | reference | DOI |
|---|---|---|
| 1963Tob/Sch:1014 | Tobiason, Schwendeman, Microwave Spectrum, Molecular Structure, and Quadrupole Coupling Constants of 2-Chloropropane, J. of Chem. Phys., Vol. 40, #4, pgs. 1014-1021 | 10.1063/1.1725240 |
| 1970Kla:87 | Klaboe. The Vibrational Spectra of 2-chloro, 2-bromo, 2-iodo, and 2-cyanopropane. Spectrochimica Acta. Vol. 26A. pgs. 87-108. | 10.1016/0584-8539(70)80253-7 |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |