| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| 1,1-DCE; 1,1-Dichloroethene; 1,1-Dichloroethylene; Chlorure de vinylidene; Ethene, 1,1-dichloro-; Ethylene, 1,1-dichloro-; Sconatex; VDC; Vinylidine chloride; Vinylidene dichloride; Vinylidene chloride; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C2H2Cl2/c1-2(3)4/h1H2 | LGXVIGDEPROXKC-UHFFFAOYSA-N | ClC(Cl)=C | 1,1-Dichloroethene |
| State | Conformation |
|---|---|
| 1A1 | C2V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
2.40 | 3.00 | kJ mol-1 | 2002Man:123 | |
Hfg(0K) ![]() |
3.00 | kJ mol-1 | 2002Man:123 | ||
Entropy (298.15K) ![]() |
288.16 | J K-1 mol-1 | Gurvich | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
13.77 | kJ mol-1 | Gurvich | ||
Heat Capacity (298.15K) ![]() |
67.12 | J K-1 mol-1 | Gurvich |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 3035 | Shim | ||||||
| 2 | A1 | 1627 | Shim | ||||||
| 3 | A1 | 1400 | Shim | ||||||
| 4 | A1 | 603 | Shim | ||||||
| 5 | A1 | 299 | Shim | ||||||
| 6 | A2 | 686 | Shim | ||||||
| 7 | B1 | 875 | Shim | ||||||
| 8 | B1 | 460 | Shim | ||||||
| 9 | B2 | 3130 | Shim | ||||||
| 10 | B2 | 1095 | Shim | ||||||
| 11 | B2 | 800 | Shim | ||||||
| 12 | B2 | 372 | Shim | ||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.24907 | 0.11379 | 0.07802 | 1966Herzberg |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 2166497 | amu3Å6 | 9.920330245827E-114 | gm3 cm6 | |
Point Group C2v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.324 | 1 | 2 | 1974sve/kov | ||||
| rCCl | 1.710 | 2 | 5 | 1974sve/kov | ||||
| rCH | 1.070 | 1 | 3 | 1974sve/kov | ||||
| aClCCl | 114.5 | 5 | 2 | 6 | 1974sve/kov | |||
| aHCH | 120 | 3 | 1 | 4 | 1974sve/kov | |||
| aCCCl | 122.75 | 1 | 2 | 5 | 1974sve/kov | by symmetry | ||
| aHCC | 120 | 2 | 1 | 3 | 1974sve/kov | by symmetry | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.0000 | 1.7363 |
| C2 | 0.0000 | 0.0000 | 0.4123 |
| H3 | 0.0000 | 0.9266 | 2.2713 |
| H4 | 0.0000 | -0.9266 | 2.2713 |
| Cl5 | 0.0000 | 1.4382 | -0.5128 |
| Cl6 | 0.0000 | -1.4382 | -0.5128 |
| C1 | C2 | H3 | H4 | Cl5 | Cl6 | |
|---|---|---|---|---|---|---|
| C1 | 1.3240 | 1.0700 | 1.0700 | 2.6696 | 2.6696 | |
| C2 | 1.3240 | 2.0772 | 2.0772 | 1.7100 | 1.7100 | |
| H3 | 1.0700 | 2.0772 | 1.8533 | 2.8307 | 3.6529 | |
| H4 | 1.0700 | 2.0772 | 1.8533 | 3.6529 | 2.8307 | |
| Cl5 | 2.6696 | 1.7100 | 2.8307 | 3.6529 | 2.8764 | |
| Cl6 | 2.6696 | 1.7100 | 3.6529 | 2.8307 | 2.8764 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| C1 | C2 | Cl5 | 122.750 | C1 | C2 | Cl6 | 122.750 | |
| C2 | C1 | H3 | 120.000 | C2 | C1 | H4 | 120.000 | |
| H3 | C1 | H4 | 120.000 | Cl5 | C2 | Cl6 | 114.500 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 2 |
| C=C | 1 |
| C-Cl | 2 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | H3 |
| C1 | H4 |
| C2 | Cl5 |
| C2 | Cl6 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 | |
| 41900 | 1 | 1966Herzberg |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.810 | 0.040 | 10.000 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | 1.340 | 1962How/Fly:650-652 | MW μ0 | C2v | 1 | 2 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | C2v | 1 | 2 | |||||
| alpha | unc. | Reference |
|---|---|---|
| 7.830 | 1998Gus/Rui:163 |
| squib | reference | DOI |
|---|---|---|
| 1962How/Fly:650-652 | JA Howe, WH Flygare "Strong Field Stark Effect" J. Chem. Phys. 36, 650 (1962) | 10.1063/1.1732587 |
| 1966Herzberg | Herzberg, G., Electronic spectra and electronic structure of polyatomic molecules,Van Nostrand,New York, 1966 | |
| 1974sve/kov | L.M. Sverdlov, M. A. Kovner, E. P. Krainov, "Vibrational Spectra of Polyatomic Molecules" Wiley, New York 1974 | |
| 1998Gus/Rui:163 | M Gussoni, R Rui, G Zerbi "Electronic and relaxation contribution to linear molecular polarizability. An analysis of the experimental values" J. Mol. Struct. 447 (1998) 163-215 | 10.1016/S0022-2860(97)00292-5 |
| 2002Man:123 | JA Manion "Evaluated Enthalpies of Formation of the Stable Closed Shell C1 and C2 Chlorinated Hydrocarbons" J. Phys. Chem. Ref. Data 31(1), 123-172, 2002 | 10.1063/1.1420703 |
| Gurvich | Gurvich, L.V.; Veyts, I. V.; Alcock, C. B., Thermodynamic Properties of Individual Substances, Fouth Edition, Hemisphere Pub. Co., New York, 1989 | |
| Shim | Shimanouchi, T. , Tables of Molecular Vibrational Frequencies, Consolidated Volu | 10.6028/NBS.NSRDS.39 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |