| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Acetic acid chloride; Acetic chloride; Acetyl chloride; Ethanoyl chloride; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C2H3ClO/c1-2(3)4/h1H3 | WETWJCDKMRHUPV-UHFFFAOYSA-N | CC(Cl)=O | Acetyl chloride |
| State | Conformation |
|---|---|
| 1A' | CS |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-242.80 | kJ mol-1 | TRC | ||
Hfg(0K) ![]() |
-233.80 | kJ mol-1 | TRC | ||
Entropy (298.15K) ![]() |
295.21 | J K-1 mol-1 | TRC | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
kJ mol-1 | ||||
Heat Capacity (298.15K) ![]() |
67.86 | J K-1 mol-1 | TRC |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A' | 3027 | 1994Dur/Dav:189 | ||||||
| 2 | A' | 2948 | 1994Dur/Dav:189 | ||||||
| 3 | A' | 1818 | 1994Dur/Dav:189 | ||||||
| 4 | A' | 1415 | 1994Dur/Dav:189 | ||||||
| 5 | A' | 1368 | 1994Dur/Dav:189 | ||||||
| 6 | A' | 1108 | 1994Dur/Dav:189 | ||||||
| 7 | A' | 956 | 1994Dur/Dav:189 | ||||||
| 8 | A' | 604 | 1994Dur/Dav:189 | ||||||
| 9 | A' | 445 | 1994Dur/Dav:189 | ||||||
| 10 | A' | 348 | 1994Dur/Dav:189 | ||||||
| 11 | A" | 2990 | 1994Dur/Dav:189 | ||||||
| 12 | A" | 1431 | 1994Dur/Dav:189 | ||||||
| 13 | A" | 1032 | 1994Dur/Dav:189 | ||||||
| 14 | A" | 518 | 1994Dur/Dav:189 | ||||||
| 15 | A" | 166 | 1994Dur/Dav:189 | ||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.33898 | 0.16500 | 0.11318 | 1994Dur/Dav:189 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 756744.3 | amu3Å6 | 3.465110731911E-114 | gm3 cm6 | |
Point Group Cs
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCO | 1.187 | 1 | 3 | 1998Kuc | rg | |||
| rCCl | 1.798 | 1 | 4 | 1998Kuc | rg | |||
| rCC | 1.506 | 1 | 2 | 1998Kuc | rg | |||
| rCH | 1.105 | 2 | 5 | 1998Kuc | rg | |||
| aOCCl | 121.2 | 3 | 1 | 4 | 1998Kuc | |||
| aCCCl | 111.6 | 2 | 1 | 4 | 1998Kuc | |||
| aHCH | 108.6 | 5 | 2 | 6 | 1998Kuc | |||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.5272 | 0.0000 |
| C2 | 1.4961 | 0.6994 | 0.0000 |
| O3 | -0.8349 | 1.3710 | 0.0000 |
| Cl4 | -0.4665 | -1.2092 | 0.0000 |
| H5 | 1.7591 | 1.7726 | 0.0000 |
| H6 | 1.9367 | 0.2285 | 0.8973 |
| H7 | 1.9367 | 0.2285 | -0.8973 |
| C1 | C2 | O3 | Cl4 | H5 | H6 | H7 | |
|---|---|---|---|---|---|---|---|
| C1 | 1.5060 | 1.1870 | 1.7980 | 2.1553 | 2.1553 | 2.1553 | |
| C2 | 1.5060 | 2.4259 | 2.7376 | 1.1050 | 1.1050 | 1.1050 | |
| O3 | 1.1870 | 2.4259 | 2.6063 | 2.6249 | 3.1293 | 3.1293 | |
| Cl4 | 1.7980 | 2.7376 | 2.6063 | 3.7208 | 2.9407 | 2.9407 | |
| H5 | 2.1553 | 1.1050 | 2.6249 | 3.7208 | 1.7947 | 1.7947 | |
| H6 | 2.1553 | 1.1050 | 3.1293 | 2.9407 | 1.7947 | 1.7947 | |
| H7 | 2.1553 | 1.1050 | 3.1293 | 2.9407 | 1.7947 | 1.7947 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| C1 | C2 | H5 | 110.330 | C1 | C2 | H6 | 110.330 | |
| C1 | C2 | H7 | 110.330 | C2 | C1 | O3 | 128.136 | |
| C2 | C1 | Cl4 | 111.600 | O3 | C1 | Cl4 | 120.264 | |
| H5 | C2 | H6 | 108.599 | H5 | C2 | H7 | 108.599 | |
| H6 | C2 | H7 | 108.599 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 3 |
| C-C | 1 |
| C=O | 1 |
| C-Cl | 1 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | O3 |
| C1 | Cl4 |
| C2 | H5 |
| C2 | H6 |
| C2 | H7 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A' |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 10.820 | 0.040 | 11.030 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | 2.720 | NSRDS-NBS10 | DT | Cs | 2 | 3 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A' | Cs | True | Cs | 2 | 3 | |||||
| squib | reference | DOI |
|---|---|---|
| 1994Dur/Dav:189 | JR Durig, JF Davis, GA Guirgis "Raman and Far Infrared Spectra, Structural Parameters, and Ab Initio Calculations on Acetyl Chloride" Journal of Raman Spectroscopy Vol 25, 189-198 (1994) | 10.1002/jrs.1250250208 |
| 1998Kuc | K Kuchitsu(ed) "Structure of Free Polyatomic Molecules - Basic Data" Springer, Berlin, 1998 | 10.1007/978-3-642-45748-7 |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |