![]() |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
You are here: Experimental > One molecule all properties |
Other names |
---|
1,1-Difluoroethane; Algofrene Type 67; Difluoroethane; Dymel 152; Ethane, 1,1-difluoro-; Ethylene fluoride; Ethylidene difluoride; Ethylidene fluoride; FC 152a; Freon 152; Freon 152a; GENETRON 100; Genetron 152a; Halocarbon 152A; Propellant 152a; R 152a; |
INChI | INChIKey | SMILES | IUPAC name |
---|---|---|---|
InChI=1S/C2H4F2/c1-2(3)4/h2H,1H3 | NPNPZTNLOVBDOC-UHFFFAOYSA-N | CC(F)F | 1,1-Difluoroethane |
State | Conformation |
---|---|
1A' | CS |
Property | Value | Uncertainty | units | Reference | Comment |
---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-500.80 | kJ mol-1 | TRC | ||
Hfg(0K) ![]() |
-487.00 | kJ mol-1 | TRC | ||
Entropy (298.15K) ![]() |
282.70 | J K-1 mol-1 | TRC | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
14.05 | kJ mol-1 | TRC | ||
Heat Capacity (298.15K) ![]() |
68.45 | J K-1 mol-1 | TRC | ||
Barrier to Internal Rotation | 13.3 | kJ mol-1 |
Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
---|---|---|---|---|---|---|---|---|---|
Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
1 | A' | 3015 | 1999Tai/Pap:9 | ||||||
2 | A' | 2975 | 1999Tai/Pap:9 | ||||||
3 | A' | 2964 | 1999Tai/Pap:9 | ||||||
4 | A' | 1457 | 1999Tai/Pap:9 | ||||||
5 | A' | 1413 | 1999Tai/Pap:9 | ||||||
6 | A' | 1357 | 1999Tai/Pap:9 | ||||||
7 | A' | 1171 | 1999Tai/Pap:9 | ||||||
8 | A' | 1140 | 1999Tai/Pap:9 | ||||||
9 | A' | 868 | 1999Tai/Pap:9 | ||||||
10 | A' | 569 | 1999Tai/Pap:9 | ||||||
11 | A' | 468 | 1999Tai/Pap:9 | ||||||
12 | A" | ||||||||
13 | A" | ||||||||
14 | A" | 1362 | 1999Tai/Pap:9 | ||||||
15 | A" | 1135 | 1999Tai/Pap:9 | ||||||
16 | A" | 942 | 1999Tai/Pap:9 | ||||||
17 | A" | ||||||||
18 | A" |
A | B | C | reference | comment |
---|---|---|---|---|
0.31662 | 0.29896 | 0.17247 | 1954Sol/Dai:2042 |
Product of moments of inertia ![]() | ||||
---|---|---|---|---|
293449.5 | amu3Å6 | 1.343697043914E-114 | gm3 cm6 |
Point Group Cs
Description | Value | unc. | Connectivity | Reference | Comment | |||
---|---|---|---|---|---|---|---|---|
Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
rCC | 1.498 | 1 | 2 | 1980Bea/Jon:105 | ||||
rCF | 1.364 | 1 | 4 | 1980Bea/Jon:105 | ||||
rCH | 1.081 | 2 | 6 | 1980Bea/Jon:105 | ||||
aHCC | 111 | 1 | 2 | 6 | 1980Bea/Jon:105 | |||
aCCF | 110.7 | 2 | 1 | 4 | 1980Bea/Jon:105 | |||
aFCF | 107.4 | 4 | 1 | 5 | 1980Bea/Jon:105 | |||
aHCF | 108.5 | 3 | 1 | 4 | 1980Bea/Jon:105 | |||
aHCH | 107.9 | 6 | 2 | 7 | 1980Bea/Jon:105 |
Atom | x (Å) | y (Å) | z (Å) |
---|---|---|---|
C1 | 0.0000 | 0.3353 | 0.0000 |
C2 | -1.3064 | -0.3978 | 0.0000 |
H3 | -0.1560 | 1.4049 | 0.0000 |
F4 | 0.7182 | 0.0406 | 1.1215 |
F5 | 0.7182 | 0.0406 | -1.1215 |
H6 | -1.1503 | -1.4675 | 0.0000 |
H7 | -1.8919 | -0.1460 | 0.8731 |
H8 | -1.8919 | -0.1460 | -0.8731 |
C1 | C2 | H3 | F4 | F5 | H6 | H7 | H8 | |
---|---|---|---|---|---|---|---|---|
C1 | 1.4980 | 1.0810 | 1.3640 | 1.3640 | 2.1385 | 2.1385 | 2.1385 | |
C2 | 1.4980 | 2.1385 | 2.3556 | 2.3556 | 1.0810 | 1.0810 | 1.0810 | |
H3 | 1.0810 | 2.1385 | 1.9707 | 1.9707 | 3.0397 | 2.4862 | 2.4862 | |
F4 | 1.3640 | 2.3556 | 1.9707 | 2.2430 | 2.6502 | 2.6286 | 3.2903 | |
F5 | 1.3640 | 2.3556 | 1.9707 | 2.2430 | 2.6502 | 3.2903 | 2.6286 | |
H6 | 2.1385 | 1.0810 | 3.0397 | 2.6502 | 2.6502 | 1.7489 | 1.7489 | |
H7 | 2.1385 | 1.0810 | 2.4862 | 2.6286 | 3.2903 | 1.7489 | 1.7462 | |
H8 | 2.1385 | 1.0810 | 2.4862 | 3.2903 | 2.6286 | 1.7489 | 1.7462 |
Experimental Bond Angles (degrees) from cartesians
atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
---|---|---|---|---|---|---|---|---|
C1 | C2 | H6 | 111.000 | C1 | C2 | H7 | 111.000 | |
C1 | C2 | H8 | 111.000 | C2 | C1 | H3 | 111.000 | |
C2 | C1 | F4 | 110.700 | C2 | C1 | F5 | 110.700 | |
H3 | C1 | F4 | 106.846 | H3 | C1 | F5 | 106.846 | |
F4 | C1 | F5 | 110.615 | H6 | C2 | H7 | 107.980 | |
H6 | C2 | H8 | 107.980 | H7 | C2 | H8 | 107.741 |
Bond descriptions
Bond Type | Count |
---|---|
C-C | 1 |
C-F | 2 |
H-C | 4 |
Atom 1 | Atom 2 |
---|---|
C1 | C2 |
C1 | H3 |
C1 | F4 |
C1 | F5 |
C2 | H6 |
C2 | H7 |
C2 | H8 |
Energy (cm-1) | Degeneracy | reference | description |
---|---|---|---|
0 | 1 | 1A' |
Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
---|---|---|---|---|
11.865 | 0.030 | 12.800 | webbook |
State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
x | y | z | total | dipole | quadrupole | ||||||||
1 | 1 | 1A' | Cs | True | 2.262 | 1991Mey/Mor:3860 | ± 0.008 DT | Cs | 2 | 3 |
State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
---|---|---|---|---|---|---|---|---|---|---|---|---|
xx | yy | zz | dipole | quadrupole | ||||||||
1 | 1 | 1A' | Cs | True | 1.800 | 0.900 | -2.700 | 1971Fly/Ben:225 | Qxx=0.9+-0.8, Qyy=-2.7+-0.9, Qzz=1.8+-1.3 | Cs | 2 | 3 |
squib | reference | DOI |
---|---|---|
1954Sol/Dai:2042 | Solimene, N.; Dailey, B.P. "Microwave Spectrum of 1,1-Difluoroethane." Journal of Physical Chemistry. 22, 2042-2044 (1954) | 10.1063/1.1739988 |
1971Fly/Ben:225 | WH Flygare, RC Benson "The molecular Zeeman effect in diamagnetic molecules and the determination of molecular magnetic moments (g values), magnetic susceptibilities, and molecular quadrupole moments" Mol. Phys. 1971, 20 (2), 225-250 | 10.1080/00268977100100221 |
1980Bea/Jon:105 | Beagly, B., Jones, M., Houldsworth, N., A Gas-Phase Electron Diffraction Study of the Molecular Structure of 1,1-Difluoroethane, J. of Mol. Struct., Vol. 62, pgs. 105-109 | 10.1016/0022-2860(80)85228-8 |
1991Mey/Mor:3860 | CW Meyer, G Morrison "Dipole Moments of Seven Partially Halogenated Ethane Refrigerants" J. Phys. Chem. 1991, 95, 3860-3866 | 10.1021/j100162a077 |
1999Tai/Pap:9 | Tai, Papasavva, Kenny, Gilbert, Janni, Steinfeld, Taylor,and Weinstein. Reassignment of the Vibrational Spectra of CHF2CH3 (HFC-152a), CF3CH3 (HFC-143a), CF3CHF2 (HFC-125), and CHCl2CF2 (HCFC-123). Spectrochimica Acta Part A. Vol. 55. pgs. 9-24. | 10.1016/S1386-1425(98)00160-7 |
TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
Browse | |
---|---|
Previous | Next |