| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| 1,1-Difluoroethene; 1,1-Difluoroethylene; Ethene, 1,1-difluoro-; Ethylene, 1,1-difluoro-; Genetron 1132a; Halocarbon 1132A; Vinylidene difluoride; Vinylidene fluoride; VDF; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C2H2F2/c1-2(3)4/h1H2 | BQCIDUSAKPWEOX-UHFFFAOYSA-N | FC(F)=C | 1,1-Difluoroethene |
| State | Conformation |
|---|---|
| 1A1 | C2V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-336.40 | 4.00 | kJ mol-1 | Gurvich | |
Hfg(0K) ![]() |
-329.48 | 4.00 | kJ mol-1 | Gurvich | |
Entropy (298.15K) ![]() |
266.04 | J K-1 mol-1 | Gurvich | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
12.05 | kJ mol-1 | Gurvich | ||
Heat Capacity (298.15K) ![]() |
60.12 | J K-1 mol-1 | Gurvich |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 3070 | 1982Kag/Pow:1099 | 42.2 | 5.0 | 1982Kag/Pow:1099 | |||
| 2 | A1 | 1728 | 1982Kag/Pow:1099 | 216.0 | 4.3 | 1982Kag/Pow:1099 | |||
| 3 | A1 | 1360 | 1982Kag/Pow:1099 | 0.0 | 20.4 | 1982Kag/Pow:1099 | |||
| 4 | A1 | 926 | 1982Kag/Pow:1099 | 64.8 | 17.6 | 1982Kag/Pow:1099 | |||
| 5 | A1 | 550 | 1982Kag/Pow:1099 | 5.1 | 0.2 | 1982Kag/Pow:1099 | |||
| 6 | A2 | 714 | 1974sve/kov | ||||||
| 7 | B1 | 803 | 1982Kag/Pow:1099 | 60.3 | 0.5 | 1982Kag/Pow:1099 | B1 & B2 switched in 1974sve/kov | ||
| 8 | B1 | 611 | 1982Kag/Pow:1099 | 0.3 | 0.1 | 1982Kag/Pow:1099 | |||
| 9 | B2 | 3154 | 1982Kag/Pow:1099 | 8.6 | 5.2 | 1982Kag/Pow:1099 | |||
| 10 | B2 | 1302 | 1982Kag/Pow:1099 | 190.1 | 19.5 | 1982Kag/Pow:1099 | |||
| 11 | B2 | 955 | 1982Kag/Pow:1099 | 23.5 | 18.1 | 1982Kag/Pow:1099 | |||
| 12 | B2 | 438 | 1982Kag/Pow:1099 | 0.6 | 0.0 | 1982Kag/Pow:1099 | |||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.36669 | 0.34731 | 0.17837 | 1949Rob/Edg:742 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 210888.5 | amu3Å6 | 9.65652393529125E-115 | gm3 cm6 | |
Point Group C2v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCC | 1.340 | 0.006 | 1 | 2 | 1987Kuchitsu(II/15) | |||
| rCF | 1.315 | 0.003 | 2 | 5 | 1987Kuchitsu(II/15) | |||
| rCH | 1.091 | 0.009 | 1 | 3 | 1987Kuchitsu(II/15) | |||
| aFCF | 110.6 | 0.3 | 5 | 2 | 6 | 1987Kuchitsu(II/15) | ||
| aHCH | 122 | 0.4 | 3 | 1 | 4 | 1987Kuchitsu(II/15) | ||
| aCCF | 124.7 | 0.3 | 1 | 2 | 5 | 1987Kuchitsu(II/15) | ||
| aHCC | 119 | 0.4 | 2 | 1 | 3 | 1987Kuchitsu(II/15) | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.0000 | 1.3930 |
| C2 | 0.0000 | 0.0000 | 0.0530 |
| H3 | 0.0000 | 0.9542 | 1.9220 |
| H4 | 0.0000 | -0.9542 | 1.9220 |
| F5 | 0.0000 | 1.0811 | -0.6956 |
| F6 | 0.0000 | -1.0811 | -0.6956 |
| C1 | C2 | H3 | H4 | F5 | F6 | |
|---|---|---|---|---|---|---|
| C1 | 1.3400 | 1.0910 | 1.0910 | 2.3518 | 2.3518 | |
| C2 | 1.3400 | 2.0984 | 2.0984 | 1.3150 | 1.3150 | |
| H3 | 1.0910 | 2.0984 | 1.9084 | 2.6206 | 3.3157 | |
| H4 | 1.0910 | 2.0984 | 1.9084 | 3.3157 | 2.6206 | |
| F5 | 2.3518 | 1.3150 | 2.6206 | 3.3157 | 2.1622 | |
| F6 | 2.3518 | 1.3150 | 3.3157 | 2.6206 | 2.1622 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| C1 | C2 | F5 | 124.700 | C1 | C2 | F6 | 124.700 | |
| C2 | C1 | H3 | 119.000 | C2 | C1 | H4 | 119.000 | |
| H3 | C1 | H4 | 122.000 | F5 | C2 | F6 | 110.600 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 2 |
| C=C | 1 |
| C-F | 2 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | H3 |
| C1 | H4 |
| C2 | F5 |
| C2 | F6 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 10.290 | 0.010 | 10.700 | 0.020 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | 1.389 | 1987Joh/Cho:317-332 | MW μ |
C2v | 1 | 2 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | -1.500 | -0.900 | 2.400 | 1971Fly/Ben:225 | Qxx=2.4+-0.5, Qyy=-0.9+-0.4, Qzz=-1.5+-0.8 | C2v | 1 | 2 |
| squib | reference | DOI |
|---|---|---|
| 1949Rob/Edg:742 | Roberts, A.; Edgell, W. "The Microwave Spectrum of CF2CH2." Journal of Chemical Physics. 17, 742-743 (1949) | 10.1063/1.1747384 |
| 1971Fly/Ben:225 | WH Flygare, RC Benson "The molecular Zeeman effect in diamagnetic molecules and the determination of molecular magnetic moments (g values), magnetic susceptibilities, and molecular quadrupole moments" Mol. Phys. 1971, 20 (2), 225-250 | 10.1080/00268977100100221 |
| 1974sve/kov | L.M. Sverdlov, M. A. Kovner, E. P. Krainov, "Vibrational Spectra of Polyatomic Molecules" Wiley, New York 1974 | |
| 1982Kag/Pow:1099 | RO Kagel, DL Powell, J Overend, MN Ramos, ABMS Bassi, RE Bruns " Infrared gas phase intensity measurements, polar tensors, and effective charges of vinylidene fluoride and its deuterated modifications" J. Chem. Phys. 77(3), 1099, 1982 | 10.1063/1.443993 |
| 1987Joh/Cho:317-332 | LH Johnston, HC Chou, SRRaju, GR Sudhakaran, MCL Gerry, RW Davis "Laser Stark spectroscopy of 1,1 difluoroethylene at λ = 337 μm" J. Mol. Spect. 124, 1987, 317-332 | 10.1016/0022-2852(87)90144-5 |
| 1987Kuchitsu(II/15) | Kuchitsu (ed.), Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 15: Structure Data of Free Polyatomic Molecules. Springer-Verlag, Berlin, 1987. | |
| Gurvich | Gurvich, L.V.; Veyts, I. V.; Alcock, C. B., Thermodynamic Properties of Individual Substances, Fouth Edition, Hemisphere Pub. Co., New York, 1989 | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |