| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Arcton; Arcton 1; Carbon trifluoride; Fluoroform; Fluoryl; Freon 23; Freon F-23; Genetron 23; Halocarbon 23; Methane, trifluoro-; Methyl trifluoride; R 23; Trifluoromethane; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/CHF3/c2-1(3)4/h1H | XPDWGBQVDMORPB-UHFFFAOYSA-N | FC(F)F | Fluoroform |
| State | Conformation |
|---|---|
| 1A1 | C3V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-696.70 | 2.30 | kJ mol-1 | Gurvich | |
Hfg(0K) ![]() |
-689.74 | 2.30 | kJ mol-1 | Gurvich | |
Entropy (298.15K) ![]() |
259.67 | J K-1 mol-1 | Gurvich | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
11.56 | kJ mol-1 | Gurvich | ||
Heat Capacity (298.15K) ![]() |
51.07 | J K-1 mol-1 | Gurvich |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 3036 | Shim | 23.9 | 0.4 | 1980Kim/Kin:5591 | CH stretch | ||
| 2 | A1 | 1117 | Shim | combined mode 2 and mode 5 has intensity of 626.8 +- 6.6 | CF3 s-stretch | ||||
| 3 | A1 | 700 | Shim | 12.1 | 0.2 | 1980Kim/Kin:5591 | CF3 s-bend | ||
| 4 | E | 1372 | Shim | 82.0 | 0.3 | 1980Kim/Kin:5591 | CH bend | ||
| 5 | E | 1152 | Shim | CF3 d-stretch | |||||
| 6 | E | 507 | Shim | 4.2 | 0.1 | 1980Kim/Kin:5591 | CF3 d-deform | ||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.34520 | 0.34520 | 0.18925 | 1981Mee/Ozi:596 | 1949Gil/Edw:1014 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 212436.6 | amu3Å6 | 9.72741286103062E-115 | gm3 cm6 | |
Point Group C3v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCH | 1.091 | 0.014 | 1 | 2 | 1998Kuc | re | ||
| rCF | 1.328 | 0.003 | 1 | 3 | 1998Kuc | re | ||
| aFCF | 108.58 | 0.34 | 3 | 1 | 4 | 1998Kuc | re | |
| aHCF | 110.34838 | 0.34 | 2 | 1 | 3 | from symmetry | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| C1 | 0.0000 | 0.0000 | 0.3347 |
| H2 | 0.0000 | 0.0000 | 1.4257 |
| F3 | 0.0000 | 1.2455 | -0.1272 |
| F4 | 1.0786 | -0.6228 | -0.1272 |
| F5 | -1.0786 | -0.6228 | -0.1272 |
| C1 | H2 | F3 | F4 | F5 | |
|---|---|---|---|---|---|
| C1 | 1.0910 | 1.3284 | 1.3284 | 1.3284 | |
| H2 | 1.0910 | 1.9907 | 1.9907 | 1.9907 | |
| F3 | 1.3284 | 1.9907 | 2.1573 | 2.1573 | |
| F4 | 1.3284 | 1.9907 | 2.1573 | 2.1573 | |
| F5 | 1.3284 | 1.9907 | 2.1573 | 2.1573 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| H2 | C1 | F3 | 110.348 | H2 | C1 | F4 | 110.348 | |
| H2 | C1 | F5 | 110.348 | F3 | C1 | F4 | 108.580 | |
| F3 | C1 | F5 | 108.580 | F4 | C1 | F5 | 108.580 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 1 |
| C-F | 3 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | H2 |
| C1 | F3 |
| C1 | F4 |
| C1 | F5 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 13.860 | 15.500 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C3v | True | 1.645 | 1951Sho/Sha:95 | ±0.009 D MW μ0 | C3v | 1 | 1 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C3v | True | -1.800 | -1.800 | 3.600 | 1971Fly/Ben:225 | 3.6+-2.0 (1984Gra/Gub give 4.87+-0.02) | C3v | 1 | 1 |
| alpha | unc. | Reference |
|---|---|---|
| 2.801 | 1998Gus/Rui:163 |
| squib | reference | DOI |
|---|---|---|
| 1951Sho/Sha:95 | JN Shoolery, AH Sharbaugh "Some Molecular Dipole Moments Determined by Microwave Spectroscopy" Phys. Rev. 82, 95, 1951 | 10.1103/PhysRev.82.95 |
| 1971Fly/Ben:225 | WH Flygare, RC Benson "The molecular Zeeman effect in diamagnetic molecules and the determination of molecular magnetic moments (g values), magnetic susceptibilities, and molecular quadrupole moments" Mol. Phys. 1971, 20 (2), 225-250 | 10.1080/00268977100100221 |
| 1980Kim/Kin:5591 | K Kim, WT King "Integrated infrared intensities and atomic polar tensors in fluoroform" J. Chem. Phys. 73(11), 5591, 1980 | 10.1063/1.440079 |
| 1981Mee/Ozi:596 | Meerts, W.L.; Ozier, I. "Avoided-crossing molecular-beam experiments on fluoroform (CF3H) and fluoroform-d (CF3D)." Journal of Chemical Physics. 75, 596-603 (1981) | 10.1063/1.442075 |
| 1998Gus/Rui:163 | M Gussoni, R Rui, G Zerbi "Electronic and relaxation contribution to linear molecular polarizability. An analysis of the experimental values" J. Mol. Struct. 447 (1998) 163-215 | 10.1016/S0022-2860(97)00292-5 |
| 1998Kuc | K Kuchitsu(ed) "Structure of Free Polyatomic Molecules - Basic Data" Springer, Berlin, 1998 | 10.1007/978-3-642-45748-7 |
| Gurvich | Gurvich, L.V.; Veyts, I. V.; Alcock, C. B., Thermodynamic Properties of Individual Substances, Fouth Edition, Hemisphere Pub. Co., New York, 1989 | |
| Shim | Shimanouchi, T. , Tables of Molecular Vibrational Frequencies, Consolidated Volu | 10.6028/NBS.NSRDS.39 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |