| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| Methanamine, N,N-dimethyl-; Methylamine, N,N-dimethyl-; TMA; Trimethylamine; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C3H9N/c1-4(2)3/h1-3H3 | GETQZCLCWQTVFV-UHFFFAOYSA-N | CN(C)C | Trimethylamine |
| State | Conformation |
|---|---|
| 1A1 | C3V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
-23.60 | kJ mol-1 | TRC | ||
Hfg(0K) ![]() |
kJ mol-1 | TRC | |||
Entropy (298.15K) ![]() |
288.80 | J K-1 mol-1 | TRC | ||
Integrated Heat Capacity (0 to 298.15K) ![]() |
kJ mol-1 |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 2953 | 1993Mur/Zer:581 | ||||||
| 2 | A1 | 2775 | 1993Mur/Zer:581 | ||||||
| 3 | A1 | 1459 | 1993Mur/Zer:581 | ||||||
| 4 | A1 | 1444 | 1993Mur/Zer:581 | ||||||
| 5 | A1 | 1186 | 1993Mur/Zer:581 | ||||||
| 6 | A1 | 828 | 1993Mur/Zer:581 | ||||||
| 7 | A1 | 367 | 1993Mur/Zer:581 | ||||||
| 8 | A2 | 2977 | 1993Mur/Zer:581 | ||||||
| 9 | A2 | 1453 | 1993Mur/Zer:581 | ||||||
| 10 | A2 | 1046 | 1993Mur/Zer:581 | ||||||
| 11 | A2 | 255 | 1993Mur/Zer:581 | ||||||
| 12 | E | 2981 | 1993Mur/Zer:581 | ||||||
| 13 | E | 2953 | 1993Mur/Zer:581 | ||||||
| 14 | E | 2776 | 1993Mur/Zer:581 | ||||||
| 15 | E | 1471 | 1993Mur/Zer:581 | ||||||
| 16 | E | 1444 | 1993Mur/Zer:581 | ||||||
| 17 | E | 1409 | 1993Mur/Zer:581 | ||||||
| 18 | E | 1275 | 1993Mur/Zer:581 | ||||||
| 19 | E | 1103 | 1993Mur/Zer:581 | ||||||
| 20 | E | 1043 | 1993Mur/Zer:581 | ||||||
| 21 | E | 424 | 1993Mur/Zer:581 | ||||||
| 22 | E | 281 | 1993Mur/Zer:581 | ||||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group C3v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| rCN | 1.451 | 1 | 2 | 1976Hellwege(II/7) | ||||
| rCH | 1.109 | 2 | 8 | 1976Hellwege(II/7) | sides | |||
| rCH | 1.088 | 2 | 5 | 1976Hellwege(II/7) | middle | |||
| aCNC | 110.9 | 2 | 1 | 3 | 1976Hellwege(II/7) | |||
| aHCN | 111.7 | 1 | 2 | 5 | 1976Hellwege(II/7) | to middle H | ||
| aHCN | 110.1 | 1 | 2 | 8 | 1976Hellwege(II/7) | to side H | ||
| aHCH | 108.1 | 5 | 2 | 8 | 1976Hellwege(II/7) | side to middle | ||
| aHCH | 108.6 | 8 | 2 | 9 | 1976Hellwege(II/7) | side to side | ||
| dHCCH | 120.11 | 5 | 2 | 1 | 8 | from symmetry, anti to sy | ||
| Atom | x (Å) | y (Å) | z (Å) |
|---|---|---|---|
| N1 | 0.0000 | -0.0000 | -0.3852 |
| C2 | -0.9758 | -0.9757 | 0.0634 |
| C3 | 1.3330 | -0.3571 | 0.0634 |
| C4 | -0.3572 | 1.3328 | 0.0634 |
| H5 | -1.0253 | -1.0252 | 1.1492 |
| H6 | 1.4006 | -0.3752 | 1.1492 |
| H7 | -0.3753 | 1.4004 | 1.1492 |
| H8 | -1.9833 | -0.7091 | -0.3156 |
| H9 | -0.7093 | -1.9833 | -0.3156 |
| H10 | 1.6060 | -1.3629 | -0.3156 |
| H11 | 2.0722 | 0.3776 | -0.3156 |
| H12 | 0.3774 | 2.0722 | -0.3156 |
| H13 | -1.3631 | 1.6057 | -0.3156 |
| N1 | C2 | C3 | C4 | H5 | H6 | H7 | H8 | H9 | H10 | H11 | H12 | H13 | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| N1 | 1.4510 | 1.4510 | 1.4510 | 2.1111 | 2.1111 | 2.1111 | 2.1074 | 2.1074 | 2.1074 | 2.1074 | 2.1074 | 2.1074 | |
| C2 | 1.4510 | 2.3902 | 2.3899 | 1.0880 | 2.6808 | 2.6806 | 1.1090 | 1.1090 | 2.6380 | 3.3564 | 3.3562 | 2.6376 | |
| C3 | 1.4510 | 2.3902 | 2.3901 | 2.6808 | 1.0880 | 2.6807 | 3.3564 | 2.6380 | 1.1090 | 1.1090 | 2.6378 | 3.3563 | |
| C4 | 1.4510 | 2.3899 | 2.3901 | 2.6806 | 2.6807 | 1.0880 | 2.6376 | 3.3562 | 3.3563 | 2.6378 | 1.1090 | 1.1090 | |
| H5 | 2.1111 | 1.0880 | 2.6808 | 2.6806 | 2.5115 | 2.5112 | 1.7786 | 1.7786 | 3.0304 | 3.7024 | 3.7023 | 3.0300 | |
| H6 | 2.1111 | 2.6808 | 1.0880 | 2.6807 | 2.5115 | 2.5113 | 3.7024 | 3.0304 | 1.7786 | 1.7786 | 3.0302 | 3.7023 | |
| H7 | 2.1111 | 2.6806 | 2.6807 | 1.0880 | 2.5112 | 2.5113 | 3.0300 | 3.7023 | 3.7023 | 3.0302 | 1.7786 | 1.7786 | |
| H8 | 2.1074 | 1.1090 | 3.3564 | 2.6376 | 1.7786 | 3.7024 | 3.0300 | 1.8019 | 3.6484 | 4.1986 | 3.6480 | 2.3964 | |
| H9 | 2.1074 | 1.1090 | 2.6380 | 3.3562 | 1.7786 | 3.0304 | 3.7023 | 1.8019 | 2.3970 | 3.6484 | 4.1985 | 3.6480 | |
| H10 | 2.1074 | 2.6380 | 1.1090 | 3.3563 | 3.0304 | 1.7786 | 3.7023 | 3.6484 | 2.3970 | 1.8019 | 3.6482 | 4.1985 | |
| H11 | 2.1074 | 3.3564 | 1.1090 | 2.6378 | 3.7024 | 1.7786 | 3.0302 | 4.1986 | 3.6484 | 1.8019 | 2.3967 | 3.6482 | |
| H12 | 2.1074 | 3.3562 | 2.6378 | 1.1090 | 3.7023 | 3.0302 | 1.7786 | 3.6480 | 4.1985 | 3.6482 | 2.3967 | 1.8019 | |
| H13 | 2.1074 | 2.6376 | 3.3563 | 1.1090 | 3.0300 | 3.7023 | 1.7786 | 2.3964 | 3.6480 | 4.1985 | 3.6482 | 1.8019 |
Experimental Bond Angles (degrees) from cartesians
| atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
|---|---|---|---|---|---|---|---|---|
| N1 | C2 | H5 | 111.700 | N1 | C2 | H8 | 110.100 | |
| N1 | C2 | H9 | 110.100 | N1 | C3 | H6 | 111.700 | |
| N1 | C3 | H10 | 110.100 | N1 | C3 | H11 | 110.100 | |
| N1 | C4 | H7 | 111.700 | N1 | C4 | H12 | 110.100 | |
| N1 | C4 | H13 | 110.100 | C2 | N1 | C3 | 110.900 | |
| C2 | N1 | C4 | 110.884 | C3 | N1 | C4 | 110.892 | |
| H5 | C2 | H8 | 108.099 | H5 | C2 | H9 | 108.099 | |
| H6 | C3 | H10 | 108.099 | H6 | C3 | H11 | 108.099 | |
| H7 | C4 | H12 | 108.099 | H7 | C4 | H13 | 108.099 | |
| H8 | C2 | H9 | 108.658 | H10 | C3 | H11 | 108.658 | |
| H12 | C4 | H13 | 108.658 |
Bond descriptions
| Bond Type | Count |
|---|---|
| H-C | 9 |
| C-N | 3 |
| Atom 1 | Atom 2 |
|---|---|
| N1 | C2 |
| N1 | C3 |
| N1 | C4 |
| C2 | H5 |
| C2 | H8 |
| C2 | H9 |
| C3 | H6 |
| C3 | H10 |
| C3 | H11 |
| C4 | H7 |
| C4 | H12 |
| C4 | H13 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 7.850 | 0.050 | 8.540 | webbook |
| Proton Affinity | unc. | Product | reference | comment |
|---|---|---|---|---|
| 948.9 | (CH3)3NH+ | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C3v | True | 0.612 | NSRDS-NBS10 | MW | C3v | 1 | 1 | |||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C3v | True | C3v | 1 | 1 | |||||
| alpha | unc. | Reference |
|---|---|---|
| 7.076 | 1997Oln/Can:59 |
| squib | reference | DOI |
|---|---|---|
| 1976Hellwege(II/7) | Hellwege, KH and AM Hellwege (ed.). Landolt-Bornstein: Group II: Atomic and Molecular Physics Volume 7: Structure Data of Free Polyatomic Molecules. Springer-Verlag. Berlin. 1976. | |
| 1993Mur/Zer:581 | Murphy, Zerbetto, Duncan, and McKean. Vibrational Spectrum and Harmonic Force Field of Trimethlamine. J. Phys. Chem. Vol. 97, #3, pgs. 581-595. | 10.1021/j100105a010 |
| 1997Oln/Can:59 | TN Olney, NM Cann, G Cooper, CE Brion, Absolute scale determination for photoabsorption spectra and the calculation of molecular properties using dipole sum-rules, Chem. Phys. 223 (1997) 59-98 | 10.1016/S0301-0104(97)00145-6 |
| NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
| TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |