| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/H2N2O2/c1-2(3)4/h1H2 | SFDJOSRHYKHMOK-UHFFFAOYSA-N | N[N+]([O-])=O |
| State | Conformation |
|---|---|
| 1A1 | C2V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A' | 3361 | webbook | ||||||
| 2 | A' | 1581 | |||||||
| 3 | A' | 1368 | |||||||
| 4 | A' | 951 | |||||||
| 5 | A' | 776 | |||||||
| 6 | A' | 714 | |||||||
| 7 | A' | 587 | |||||||
| 8 | A" | 3474 | |||||||
| 9 | A" | 1610 | |||||||
| 10 | A" | 1238 | |||||||
| 11 | A" | 484 | |||||||
| 12 | A" | 434 | |||||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| N-N | 1 |
| H-N | 2 |
| N=O | 2 |
| Atom 1 | Atom 2 |
|---|---|
| N1 | N2 |
| N1 | H5 |
| N1 | H6 |
| N2 | O3 |
| N2 | O4 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | False | C2v | 1 | 2 | ||||||
| 1 | 2 | 1A' | Cs | False | Cs | 2 | 3 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | False | C2v | 1 | 2 | |||||
| 1 | 2 | 1A' | Cs | False | Cs | 2 | 3 | |||||
| squib | reference | DOI |
|---|---|---|
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |